pongodot

Tinkering with Godot, remaking pong
git clone git://git.hellocld.com/pongodot
Log | Files | Refs

commit c331e9e672232a99ddddc467f88f03e9a7db0028
parent 583c362084ad93f980107cb1492309f0d174a4d3
Author: Christopher Ray Langford <chris@hellocld.com>
Date:   Thu, 14 Nov 2019 15:22:06 -0500

Scoring fixes, game over transitions to main menu

Diffstat:
ABuilds/HTML/P-NG.js | 424+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
ABuilds/HTML/P-NG.pck | 0
ABuilds/HTML/P-NG.png | 0
ABuilds/HTML/P-NG.png.import | 34++++++++++++++++++++++++++++++++++
ABuilds/HTML/P-NG.wasm | 0
ABuilds/HTML/index.html | 261+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
ABuilds/HTML/p-ng.zip | 0
ABuilds/Windows/P-NG.exe | 0
ABuilds/Windows/P-NG.pck | 0
MGame.gd | 31+++++++++++++++++++++++--------
10 files changed, 742 insertions(+), 8 deletions(-)

diff --git a/Builds/HTML/P-NG.js b/Builds/HTML/P-NG.js @@ -0,0 +1,424 @@ +var Engine = { + RuntimeEnvironment: function(Module, exposedLibs) { + // The above is concatenated with generated code, and acts as the start of + // a wrapper for said code. See engine.js for the other part of the + // wrapper. + +var Module=typeof Module!=="undefined"?Module:{};var moduleOverrides={};var key;for(key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}Module["arguments"]=[];Module["thisProgram"]="./this.program";Module["quit"]=function(status,toThrow){throw toThrow};Module["preRun"]=[];Module["postRun"]=[];var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_IS_SHELL=false;ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_IS_NODE=typeof process==="object"&&typeof require==="function"&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER;var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}else{return scriptDirectory+path}}if(ENVIRONMENT_IS_NODE){scriptDirectory=__dirname+"/";var nodeFS;var nodePath;Module["read"]=function shell_read(filename,binary){var ret;if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};Module["readBinary"]=function readBinary(filename){var ret=Module["read"](filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};if(process["argv"].length>1){Module["thisProgram"]=process["argv"][1].replace(/\\/g,"/")}Module["arguments"]=process["argv"].slice(2);if(typeof module!=="undefined"){module["exports"]=Module}process["on"]("uncaughtException",function(ex){if(!(ex instanceof ExitStatus)){throw ex}});process["on"]("unhandledRejection",abort);Module["quit"]=function(status){process["exit"](status)};Module["inspect"]=function(){return"[Emscripten Module object]"}}else if(ENVIRONMENT_IS_SHELL){if(typeof read!="undefined"){Module["read"]=function shell_read(f){return read(f)}}Module["readBinary"]=function readBinary(f){var data;if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){Module["arguments"]=scriptArgs}else if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof quit==="function"){Module["quit"]=function(status){quit(status)}}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(document.currentScript){scriptDirectory=document.currentScript.src}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.lastIndexOf("/")+1)}else{scriptDirectory=""}Module["read"]=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){Module["readBinary"]=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}Module["readAsync"]=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)};Module["setWindowTitle"]=function(title){document.title=title}}else{}var out=Module["print"]||(typeof console!=="undefined"?console.log.bind(console):typeof print!=="undefined"?print:null);var err=Module["printErr"]||(typeof printErr!=="undefined"?printErr:typeof console!=="undefined"&&console.warn.bind(console)||out);for(key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=undefined;function dynamicAlloc(size){var ret=HEAP32[DYNAMICTOP_PTR>>2];var end=ret+size+15&-16;if(end<=_emscripten_get_heap_size()){HEAP32[DYNAMICTOP_PTR>>2]=end}else{var success=_emscripten_resize_heap(end);if(!success)return 0}return ret}function getNativeTypeSize(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return 4}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0,"getNativeTypeSize invalid bits "+bits+", type "+type);return bits/8}else{return 0}}}}function warnOnce(text){if(!warnOnce.shown)warnOnce.shown={};if(!warnOnce.shown[text]){warnOnce.shown[text]=1;err(text)}}var asm2wasmImports={"f64-rem":function(x,y){return x%y},"debugger":function(){debugger}};var functionPointers=new Array(0);function makeBigInt(low,high,unsigned){return unsigned?+(low>>>0)+ +(high>>>0)*4294967296:+(low>>>0)+ +(high|0)*4294967296}var tempRet0=0;var setTempRet0=function(value){tempRet0=value};var getTempRet0=function(){return tempRet0};if(typeof WebAssembly!=="object"){err("no native wasm support detected")}function getValue(ptr,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return HEAPF64[ptr>>3];default:abort("invalid type for getValue: "+type)}return null}var wasmMemory;var wasmTable;var ABORT=false;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];assert(func,"Cannot call unknown function "+ident+", make sure it is exported");return func}function ccall(ident,returnType,argTypes,args,opts){var toC={"string":function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret},"array":function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}};function convertReturnValue(ret){if(returnType==="string")return UTF8ToString(ret);if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i<args.length;i++){var converter=toC[argTypes[i]];if(converter){if(stack===0)stack=stackSave();cArgs[i]=converter(args[i])}else{cArgs[i]=args[i]}}}var ret=func.apply(null,cArgs);ret=convertReturnValue(ret);if(stack!==0)stackRestore(stack);return ret}function cwrap(ident,returnType,argTypes,opts){argTypes=argTypes||[];var numericArgs=argTypes.every(function(type){return type==="number"});var numericRet=returnType!=="string";if(numericRet&&numericArgs&&!opts){return getCFunc(ident)}return function(){return ccall(ident,returnType,argTypes,arguments,opts)}}function setValue(ptr,value,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}var ALLOC_NORMAL=0;var ALLOC_NONE=3;function allocate(slab,types,allocator,ptr){var zeroinit,size;if(typeof slab==="number"){zeroinit=true;size=slab}else{zeroinit=false;size=slab.length}var singleType=typeof types==="string"?types:null;var ret;if(allocator==ALLOC_NONE){ret=ptr}else{ret=[_malloc,stackAlloc,dynamicAlloc][allocator](Math.max(size,singleType?1:types.length))}if(zeroinit){var stop;ptr=ret;assert((ret&3)==0);stop=ret+(size&~3);for(;ptr<stop;ptr+=4){HEAP32[ptr>>2]=0}stop=ret+size;while(ptr<stop){HEAP8[ptr++>>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i<size){var curr=slab[i];type=singleType||types[i];if(type===0){i++;continue}if(type=="i64")type="i32";setValue(ret+i,curr,type);if(previousType!==type){typeSize=getNativeTypeSize(type);previousType=type}i+=typeSize}return ret}function getMemory(size){if(!runtimeInitialized)return dynamicAlloc(size);return _malloc(size)}var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx,maxBytesToRead){var endIdx=idx+maxBytesToRead;var endPtr=idx;while(u8Array[endPtr]&&!(endPtr>=endIdx))++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var str="";while(idx<endPtr){var u0=u8Array[idx++];if(!(u0&128)){str+=String.fromCharCode(u0);continue}var u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}var u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{u0=(u0&7)<<18|u1<<12|u2<<6|u8Array[idx++]&63}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}return str}function UTF8ToString(ptr,maxBytesToRead){return ptr?UTF8ArrayToString(HEAPU8,ptr,maxBytesToRead):""}function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+3>=endIdx)break;outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}function lengthBytesUTF8(str){var len=0;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127)++len;else if(u<=2047)len+=2;else if(u<=65535)len+=3;else len+=4}return len}var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function allocateUTF8(str){var size=lengthBytesUTF8(str)+1;var ret=_malloc(size);if(ret)stringToUTF8Array(str,HEAP8,ret,size);return ret}function allocateUTF8OnStack(str){var size=lengthBytesUTF8(str)+1;var ret=stackAlloc(size);stringToUTF8Array(str,HEAP8,ret,size);return ret}function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i<str.length;++i){HEAP8[buffer++>>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}function demangle(func){return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,function(x){var y=demangle(x);return x===y?x:y+" ["+x+"]"})}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}var PAGE_SIZE=16384;var WASM_PAGE_SIZE=65536;function alignUp(x,multiple){if(x%multiple>0){x+=multiple-x%multiple}return x}var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var DYNAMIC_BASE=6928960,DYNAMICTOP_PTR=1685824;var TOTAL_STACK=5242880;var INITIAL_TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(INITIAL_TOTAL_MEMORY<TOTAL_STACK)err("TOTAL_MEMORY should be larger than TOTAL_STACK, was "+INITIAL_TOTAL_MEMORY+"! (TOTAL_STACK="+TOTAL_STACK+")");if(Module["buffer"]){buffer=Module["buffer"]}else{if(typeof WebAssembly==="object"&&typeof WebAssembly.Memory==="function"){wasmMemory=new WebAssembly.Memory({"initial":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE});buffer=wasmMemory.buffer}else{buffer=new ArrayBuffer(INITIAL_TOTAL_MEMORY)}}updateGlobalBufferViews();HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function ensureInitRuntime(){if(runtimeInitialized)return;runtimeInitialized=true;if(!Module["noFSInit"]&&!FS.init.initialized)FS.init();TTY.init();SOCKFS.root=FS.mount(SOCKFS,{},null);callRuntimeCallbacks(__ATINIT__)}function preMain(){FS.ignorePermissions=false;callRuntimeCallbacks(__ATMAIN__)}function exitRuntime(){runtimeExited=true}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}var Math_abs=Math.abs;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_min=Math.min;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function getUniqueRunDependency(id){return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["preloadedImages"]={};Module["preloadedAudios"]={};var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return String.prototype.startsWith?filename.startsWith(dataURIPrefix):filename.indexOf(dataURIPrefix)===0}var wasmBinaryFile="godot.javascript.opt.debug.wasm";if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}function getBinary(){try{if(Module["wasmBinary"]){return new Uint8Array(Module["wasmBinary"])}if(Module["readBinary"]){return Module["readBinary"](wasmBinaryFile)}else{throw"both async and sync fetching of the wasm failed"}}catch(err){abort(err)}}function getBinaryPromise(){if(!Module["wasmBinary"]&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&typeof fetch==="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}).catch(function(){return getBinary()})}return new Promise(function(resolve,reject){resolve(getBinary())})}function createWasm(env){var info={"env":env,"global":{"NaN":NaN,Infinity:Infinity},"global.Math":Math,"asm2wasm":asm2wasmImports};function receiveInstance(instance,module){var exports=instance.exports;Module["asm"]=exports;removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");if(Module["instantiateWasm"]){try{return Module["instantiateWasm"](info,receiveInstance)}catch(e){err("Module.instantiateWasm callback failed with error: "+e);return false}}function receiveInstantiatedSource(output){receiveInstance(output["instance"])}function instantiateArrayBuffer(receiver){getBinaryPromise().then(function(binary){return WebAssembly.instantiate(binary,info)}).then(receiver,function(reason){err("failed to asynchronously prepare wasm: "+reason);abort(reason)})}if(!Module["wasmBinary"]&&typeof WebAssembly.instantiateStreaming==="function"&&!isDataURI(wasmBinaryFile)&&typeof fetch==="function"){WebAssembly.instantiateStreaming(fetch(wasmBinaryFile,{credentials:"same-origin"}),info).then(receiveInstantiatedSource,function(reason){err("wasm streaming compile failed: "+reason);err("falling back to ArrayBuffer instantiation");instantiateArrayBuffer(receiveInstantiatedSource)})}else{instantiateArrayBuffer(receiveInstantiatedSource)}return{}}Module["asm"]=function(global,env,providedBuffer){env["memory"]=wasmMemory;env["table"]=wasmTable=new WebAssembly.Table({"initial":46864,"maximum":46864,"element":"anyfunc"});env["__memory_base"]=1024;env["__table_base"]=0;var exports=createWasm(env);return exports};var ASM_CONSTS=[function(){_audioDriver_audioContext=new(window.AudioContext||window.webkitAudioContext);_audioDriver_audioInput=null;_audioDriver_inputStream=null;_audioDriver_scriptNode=null},function($0){var channelCount=_audioDriver_audioContext.destination.channelCount;try{_audioDriver_scriptNode=_audioDriver_audioContext.createScriptProcessor(0,2,channelCount)}catch(e){_audioDriver_scriptNode=_audioDriver_audioContext.createScriptProcessor(4096,2,channelCount)}_audioDriver_scriptNode.connect(_audioDriver_audioContext.destination);return _audioDriver_scriptNode.bufferSize},function($0){var INTERNAL_BUFFER_PTR=$0;var audioDriverMixFunction=cwrap("audio_driver_js_mix");var audioDriverProcessCapture=cwrap("audio_driver_process_capture",null,["number"]);_audioDriver_scriptNode.onaudioprocess=function(audioProcessingEvent){audioDriverMixFunction();var input=audioProcessingEvent.inputBuffer;var output=audioProcessingEvent.outputBuffer;var internalBuffer=HEAPF32.subarray(INTERNAL_BUFFER_PTR/HEAPF32.BYTES_PER_ELEMENT,INTERNAL_BUFFER_PTR/HEAPF32.BYTES_PER_ELEMENT+output.length*output.numberOfChannels);for(var channel=0;channel<output.numberOfChannels;channel++){var outputData=output.getChannelData(channel);for(var sample=0;sample<outputData.length;sample++){outputData[sample]=internalBuffer[sample*output.numberOfChannels+channel]}}if(_audioDriver_audioInput){var inputDataL=input.getChannelData(0);var inputDataR=input.getChannelData(1);for(var i=0;i<inputDataL.length;i++){audioDriverProcessCapture(inputDataL[i]);audioDriverProcessCapture(inputDataR[i])}}}},function(){if(_audioDriver_audioContext.resume)_audioDriver_audioContext.resume()},function(){return _audioDriver_audioContext.sampleRate},function(){return _audioDriver_audioContext.destination.channelCount},function(){_audioDriver_audioContext=null;_audioDriver_audioInput=null;_audioDriver_scriptNode=null},function(){function gotMediaInput(stream){_audioDriver_inputStream=stream;_audioDriver_audioInput=_audioDriver_audioContext.createMediaStreamSource(stream);_audioDriver_audioInput.connect(_audioDriver_scriptNode)}function gotMediaInputError(e){out(e)}if(navigator.mediaDevices.getUserMedia){navigator.mediaDevices.getUserMedia({"audio":true}).then(gotMediaInput,gotMediaInputError)}else{if(!navigator.getUserMedia)navigator.getUserMedia=navigator.webkitGetUserMedia||navigator.mozGetUserMedia;navigator.getUserMedia({"audio":true},gotMediaInput,gotMediaInputError)}},function(){if(_audioDriver_inputStream){const tracks=_audioDriver_inputStream.getTracks();for(var i=0;i<tracks.length;i++){tracks[i].stop()}_audioDriver_inputStream=null}if(_audioDriver_audioInput){_audioDriver_audioInput.disconnect();_audioDriver_audioInput=null}},function($0,$1,$2,$3,$4){const CODE=$0;const USE_GLOBAL_EXEC_CONTEXT=$1;const PTR=$2;const BYTEARRAY_PTR=$3;const BYTEARRAY_WRITE_PTR=$4;var eval_ret;try{if(USE_GLOBAL_EXEC_CONTEXT){var global_eval=eval;eval_ret=global_eval(UTF8ToString(CODE))}else{eval_ret=eval(UTF8ToString(CODE))}}catch(e){err(e);eval_ret=null}switch(typeof eval_ret){case"boolean":setValue(PTR,eval_ret,"i32");return 1;case"number":setValue(PTR,eval_ret,"double");return 3;case"string":var array_len=lengthBytesUTF8(eval_ret)+1;var array_ptr=_malloc(array_len);try{if(array_ptr===0){throw new Error("String allocation failed (probably out of memory)")}setValue(PTR,array_ptr,"*");stringToUTF8(eval_ret,array_ptr,array_len);return 4}catch(e){if(array_ptr!==0){_free(array_ptr)}err(e)}break;case"object":if(eval_ret===null){break}if(ArrayBuffer.isView(eval_ret)&&!(eval_ret instanceof Uint8Array)){eval_ret=new Uint8Array(eval_ret.buffer)}else if(eval_ret instanceof ArrayBuffer){eval_ret=new Uint8Array(eval_ret)}if(eval_ret instanceof Uint8Array){var bytes_ptr=ccall("resize_poolbytearray_and_open_write","number",["number","number","number"],[BYTEARRAY_PTR,BYTEARRAY_WRITE_PTR,eval_ret.length]);HEAPU8.set(eval_ret,bytes_ptr);return 20}break}return 0},function($0){_free($0)},function(){FS.mkdir("/userfs");FS.mount(IDBFS,{},"/userfs");FS.syncfs(true,function(err){ccall("main_after_fs_sync",null,["string"],[err?err.message:""])})},function(){(canvas.requestFullscreen||canvas.msRequestFullscreen||canvas.mozRequestFullScreen||canvas.mozRequestFullscreen||canvas.webkitRequestFullscreen).call(canvas)},function(){return Module.resizeCanvasOnStart},function($0){stringToUTF8(Module.locale,$0,16)},function($0,$1,$2,$3){const send_notification=cwrap("send_notification",null,["number"]);const notifications=arguments;["mouseover","mouseleave","focus","blur"].forEach(function(event,index){Module.canvas.addEventListener(event,send_notification.bind(null,notifications[index]))})},function($0){window.alert(UTF8ToString($0))},function($0){document.title=UTF8ToString($0)},function($0){window.open(UTF8ToString($0),"_blank")},function($0,$1,$2){var PNG_PTR=$0;var PNG_LEN=$1;var PTR=$2;var png=new Blob([HEAPU8.slice(PNG_PTR,PNG_PTR+PNG_LEN)],{type:"image/png"});var url=URL.createObjectURL(png);var length_bytes=lengthBytesUTF8(url)+1;var string_on_wasm_heap=_malloc(length_bytes);setValue(PTR,string_on_wasm_heap,"*");stringToUTF8(url,string_on_wasm_heap,length_bytes)},function($0){URL.revokeObjectURL(UTF8ToString($0).split("?")[0])},function(){return"ontouchstart"in window},function($0,$1){var PNG_PTR=$0;var PNG_LEN=$1;var png=new Blob([HEAPU8.slice(PNG_PTR,PNG_PTR+PNG_LEN)],{type:"image/png"});var url=URL.createObjectURL(png);var link=document.getElementById("-gd-engine-icon");if(link===null){link=document.createElement("link");link.rel="icon";link.id="-gd-engine-icon";document.head.appendChild(link)}link.href=url},function($0){Module.canvas.style.cursor=UTF8ToString($0)},function(){return Module.canvas.style.cursor==="none"},function(){return document.activeElement==Module.canvas},function(){Module.canvas.focus()},function(){FS.syncfs(function(error){if(error){err("Failed to save IDB file system: "+error.message)}})},function($0){Module.IDHandler.remove($0)},function($0,$1,$2){var proto_str=UTF8ToString($2);var socket=null;if(proto_str){socket=new WebSocket(UTF8ToString($1),proto_str.split(","))}else{socket=new WebSocket(UTF8ToString($1))}var c_ptr=Module.IDHandler.get($0);socket.binaryType="arraybuffer";socket.addEventListener("open",function(event){if(!Module.IDHandler.has($0))return;ccall("_esws_on_connect","void",["number","string"],[c_ptr,socket.protocol])});socket.addEventListener("message",function(event){if(!Module.IDHandler.has($0))return;var buffer;var is_string=0;if(event.data instanceof ArrayBuffer){buffer=new Uint8Array(event.data)}else if(event.data instanceof Blob){alert("Blob type not supported");return}else if(typeof event.data==="string"){is_string=1;var enc=new TextEncoder("utf-8");buffer=new Uint8Array(enc.encode(event.data))}else{alert("Unknown message type");return}var len=buffer.length*buffer.BYTES_PER_ELEMENT;var out=Module._malloc(len);Module.HEAPU8.set(buffer,out);ccall("_esws_on_message","void",["number","number","number","number"],[c_ptr,out,len,is_string]);Module._free(out)});socket.addEventListener("error",function(event){if(!Module.IDHandler.has($0))return;ccall("_esws_on_error","void",["number"],[c_ptr])});socket.addEventListener("close",function(event){if(!Module.IDHandler.has($0))return;var was_clean=0;if(event.wasClean)was_clean=1;ccall("_esws_on_close","void",["number","number","string","number"],[c_ptr,event.code,event.reason,was_clean])});return Module.IDHandler.add(socket)},function($0,$1,$2,$3){var sock=Module.IDHandler.get($0);var bytes_array=new Uint8Array($2);var i=0;for(i=0;i<$2;i++){bytes_array[i]=getValue($1+i,"i8")}if($3){sock.send(bytes_array.buffer)}else{var string=new TextDecoder("utf-8").decode(bytes_array);sock.send(string)}},function($0,$1,$2){var sock=Module.IDHandler.get($0);var code=$1;var reason=UTF8ToString($2);sock.close(code,reason);Module.IDHandler.remove($0)},function(){var IDHandler={};IDHandler["ids"]={};IDHandler["has"]=function(id){return IDHandler.ids.hasOwnProperty(id)};IDHandler["add"]=function(obj){var id=crypto.getRandomValues(new Int32Array(32))[0];IDHandler.ids[id]=obj;return id};IDHandler["get"]=function(id){return IDHandler.ids[id]};IDHandler["remove"]=function(id){delete IDHandler.ids[id]};Module["IDHandler"]=IDHandler},function($0){return Module.IDHandler.add($0)},function($0,$1,$2,$3){GLctx.getBufferSubData($0,$1,HEAPU8,$2,$3)}];function _emscripten_asm_const_i(code){return ASM_CONSTS[code]()}function _emscripten_asm_const_iiiii(code,a0,a1,a2,a3){return ASM_CONSTS[code](a0,a1,a2,a3)}function _emscripten_asm_const_ii(code,a0){return ASM_CONSTS[code](a0)}function _emscripten_asm_const_iiiiii(code,a0,a1,a2,a3,a4){return ASM_CONSTS[code](a0,a1,a2,a3,a4)}function _emscripten_asm_const_iiii(code,a0,a1,a2){return ASM_CONSTS[code](a0,a1,a2)}function _emscripten_asm_const_iii(code,a0,a1){return ASM_CONSTS[code](a0,a1)}__ATINIT__.push({func:function(){globalCtors()}});function ___assert_fail(condition,filename,line,func){abort("Assertion failed: "+UTF8ToString(condition)+", at: "+[filename?UTF8ToString(filename):"unknown filename",line,func?UTF8ToString(func):"unknown function"])}var ENV={};function ___buildEnvironment(environ){var MAX_ENV_VALUES=64;var TOTAL_ENV_SIZE=1024;var poolPtr;var envPtr;if(!___buildEnvironment.called){___buildEnvironment.called=true;ENV["USER"]=ENV["LOGNAME"]="web_user";ENV["PATH"]="/";ENV["PWD"]="/";ENV["HOME"]="/home/web_user";ENV["LANG"]="C.UTF-8";ENV["_"]=Module["thisProgram"];poolPtr=getMemory(TOTAL_ENV_SIZE);envPtr=getMemory(MAX_ENV_VALUES*4);HEAP32[envPtr>>2]=poolPtr;HEAP32[environ>>2]=envPtr}else{envPtr=HEAP32[environ>>2];poolPtr=HEAP32[envPtr>>2]}var strings=[];var totalSize=0;for(var key in ENV){if(typeof ENV[key]==="string"){var line=key+"="+ENV[key];strings.push(line);totalSize+=line.length}}if(totalSize>TOTAL_ENV_SIZE){throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")}var ptrSize=4;for(var i=0;i<strings.length;i++){var line=strings[i];writeAsciiToMemory(line,poolPtr);HEAP32[envPtr+i*ptrSize>>2]=poolPtr;poolPtr+=line.length+1}HEAP32[envPtr+strings.length*ptrSize>>2]=0}function ___cxa_pure_virtual(){ABORT=true;throw"Pure virtual function called!"}function ___lock(){}function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;return value}var PATH={splitPath:function(filename){var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)},normalizeArray:function(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts},normalize:function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path},dirname:function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir},basename:function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)},extname:function(path){return PATH.splitPath(path)[3]},join:function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))},join2:function(l,r){return PATH.normalize(l+"/"+r)},resolve:function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter(function(p){return!!p}),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."},relative:function(from,to){from=PATH.resolve(from).substr(1);to=PATH.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=="")break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push("..")}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join("/")}};var TTY={ttys:[],init:function(){},shutdown:function(){},register:function(dev,ops){TTY.ttys[dev]={input:[],output:[],ops:ops};FS.registerDevice(dev,TTY.stream_ops)},stream_ops:{open:function(stream){var tty=TTY.ttys[stream.node.rdev];if(!tty){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}stream.tty=tty;stream.seekable=false},close:function(stream){stream.tty.ops.flush(stream.tty)},flush:function(stream){stream.tty.ops.flush(stream.tty)},read:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.get_char){throw new FS.ErrnoError(ERRNO_CODES.ENXIO)}var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=stream.tty.ops.get_char(stream.tty)}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.put_char){throw new FS.ErrnoError(ERRNO_CODES.ENXIO)}try{for(var i=0;i<length;i++){stream.tty.ops.put_char(stream.tty,buffer[offset+i])}}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EIO)}if(length){stream.node.timestamp=Date.now()}return i}},default_tty_ops:{get_char:function(tty){if(!tty.input.length){var result=null;if(ENVIRONMENT_IS_NODE){var BUFSIZE=256;var buf=new Buffer(BUFSIZE);var bytesRead=0;var isPosixPlatform=process.platform!="win32";var fd=process.stdin.fd;if(isPosixPlatform){var usingDevice=false;try{fd=fs.openSync("/dev/stdin","r");usingDevice=true}catch(e){}}try{bytesRead=fs.readSync(fd,buf,0,BUFSIZE,null)}catch(e){if(e.toString().indexOf("EOF")!=-1)bytesRead=0;else throw e}if(usingDevice){fs.closeSync(fd)}if(bytesRead>0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()},put_char:function(tty,val){if(val===null||val===10){out(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){out(UTF8ArrayToString(tty.output,0));tty.output=[]}}},default_tty1_ops:{put_char:function(tty,val){if(val===null||val===10){err(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){err(UTF8ArrayToString(tty.output,0));tty.output=[]}}}};var MEMFS={ops_table:null,mount:function(mount){return MEMFS.createNode(null,"/",16384|511,0)},createNode:function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node},getFileDataAsRegularArray:function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;i<node.usedBytes;++i)arr.push(node.contents[i]);return arr}return node.contents},getFileDataAsTypedArray:function(node){if(!node.contents)return new Uint8Array;if(node.contents.subarray)return node.contents.subarray(0,node.usedBytes);return new Uint8Array(node.contents)},expandFileStorage:function(node,newCapacity){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity<CAPACITY_DOUBLING_MAX?2:1.125)|0);if(prevCapacity!=0)newCapacity=Math.max(newCapacity,256);var oldContents=node.contents;node.contents=new Uint8Array(newCapacity);if(node.usedBytes>0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return},resizeFileStorage:function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0;return}if(!node.contents||node.contents.subarray){var oldContents=node.contents;node.contents=new Uint8Array(new ArrayBuffer(newSize));if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize;return}if(!node.contents)node.contents=[];if(node.contents.length>newSize)node.contents.length=newSize;else while(node.contents.length<newSize)node.contents.push(0);node.usedBytes=newSize},node_ops:{getattr:function(node){var attr={};attr.dev=FS.isChrdev(node.mode)?node.id:1;attr.ino=node.id;attr.mode=node.mode;attr.nlink=1;attr.uid=0;attr.gid=0;attr.rdev=node.rdev;if(FS.isDir(node.mode)){attr.size=4096}else if(FS.isFile(node.mode)){attr.size=node.usedBytes}else if(FS.isLink(node.mode)){attr.size=node.link.length}else{attr.size=0}attr.atime=new Date(node.timestamp);attr.mtime=new Date(node.timestamp);attr.ctime=new Date(node.timestamp);attr.blksize=4096;attr.blocks=Math.ceil(attr.size/attr.blksize);return attr},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}if(attr.size!==undefined){MEMFS.resizeFileStorage(node,attr.size)}},lookup:function(parent,name){throw FS.genericErrors[ERRNO_CODES.ENOENT]},mknod:function(parent,name,mode,dev){return MEMFS.createNode(parent,name,mode,dev)},rename:function(old_node,new_dir,new_name){if(FS.isDir(old_node.mode)){var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(new_node){for(var i in new_node.contents){throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)}}}delete old_node.parent.contents[old_node.name];old_node.name=new_name;new_dir.contents[new_name]=old_node;old_node.parent=new_dir},unlink:function(parent,name){delete parent.contents[name]},rmdir:function(parent,name){var node=FS.lookupNode(parent,name);for(var i in node.contents){throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)}delete parent.contents[name]},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newname,oldpath){var node=MEMFS.createNode(parent,newname,511|40960,0);node.link=oldpath;return node},readlink:function(node){if(!FS.isLink(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return node.link}},stream_ops:{read:function(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i<size;i++)buffer[offset+i]=contents[position+i]}return size},write:function(stream,buffer,offset,length,position,canOwn){canOwn=false;if(!length)return 0;var node=stream.node;node.timestamp=Date.now();if(buffer.subarray&&(!node.contents||node.contents.subarray)){if(canOwn){node.contents=buffer.subarray(offset,offset+length);node.usedBytes=length;return length}else if(node.usedBytes===0&&position===0){node.contents=new Uint8Array(buffer.subarray(offset,offset+length));node.usedBytes=length;return length}else if(position+length<=node.usedBytes){node.contents.set(buffer.subarray(offset,offset+length),position);return length}}MEMFS.expandFileStorage(node,position+length);if(node.contents.subarray&&buffer.subarray)node.contents.set(buffer.subarray(offset,offset+length),position);else{for(var i=0;i<length;i++){node.contents[position+i]=buffer[offset+i]}}node.usedBytes=Math.max(node.usedBytes,position+length);return length},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.usedBytes}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position},allocate:function(stream,offset,length){MEMFS.expandFileStorage(stream.node,offset+length);stream.node.usedBytes=Math.max(stream.node.usedBytes,offset+length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}var ptr;var allocated;var contents=stream.node.contents;if(!(flags&2)&&(contents.buffer===buffer||contents.buffer===buffer.buffer)){allocated=false;ptr=contents.byteOffset}else{if(position>0||position+length<stream.node.usedBytes){if(contents.subarray){contents=contents.subarray(position,position+length)}else{contents=Array.prototype.slice.call(contents,position,position+length)}}allocated=true;ptr=_malloc(length);if(!ptr){throw new FS.ErrnoError(ERRNO_CODES.ENOMEM)}buffer.set(contents,ptr)}return{ptr:ptr,allocated:allocated}},msync:function(stream,buffer,offset,length,mmapFlags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENODEV)}if(mmapFlags&2){return 0}var bytesWritten=MEMFS.stream_ops.write(stream,buffer,0,length,offset,false);return 0}}};var IDBFS={dbs:{},indexedDB:function(){if(typeof indexedDB!=="undefined")return indexedDB;var ret=null;if(typeof window==="object")ret=window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB;assert(ret,"IDBFS used, but indexedDB not supported");return ret},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function(mount){return MEMFS.mount.apply(null,arguments)},syncfs:function(mount,populate,callback){IDBFS.getLocalSet(mount,function(err,local){if(err)return callback(err);IDBFS.getRemoteSet(mount,function(err,remote){if(err)return callback(err);var src=populate?remote:local;var dst=populate?local:remote;IDBFS.reconcile(src,dst,callback)})})},getDB:function(name,callback){var db=IDBFS.dbs[name];if(db){return callback(null,db)}var req;try{req=IDBFS.indexedDB().open(name,IDBFS.DB_VERSION)}catch(e){return callback(e)}if(!req){return callback("Unable to connect to IndexedDB")}req.onupgradeneeded=function(e){var db=e.target.result;var transaction=e.target.transaction;var fileStore;if(db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)){fileStore=transaction.objectStore(IDBFS.DB_STORE_NAME)}else{fileStore=db.createObjectStore(IDBFS.DB_STORE_NAME)}if(!fileStore.indexNames.contains("timestamp")){fileStore.createIndex("timestamp","timestamp",{unique:false})}};req.onsuccess=function(){db=req.result;IDBFS.dbs[name]=db;callback(null,db)};req.onerror=function(e){callback(this.error);e.preventDefault()}},getLocalSet:function(mount,callback){var entries={};function isRealDir(p){return p!=="."&&p!==".."}function toAbsolute(root){return function(p){return PATH.join2(root,p)}}var check=FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));while(check.length){var path=check.pop();var stat;try{stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){check.push.apply(check,FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))}entries[path]={timestamp:stat.mtime}}return callback(null,{type:"local",entries:entries})},getRemoteSet:function(mount,callback){var entries={};IDBFS.getDB(mount.mountpoint,function(err,db){if(err)return callback(err);try{var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readonly");transaction.onerror=function(e){callback(this.error);e.preventDefault()};var store=transaction.objectStore(IDBFS.DB_STORE_NAME);var index=store.index("timestamp");index.openKeyCursor().onsuccess=function(event){var cursor=event.target.result;if(!cursor){return callback(null,{type:"remote",db:db,entries:entries})}entries[cursor.primaryKey]={timestamp:cursor.key};cursor.continue()}}catch(e){return callback(e)}})},loadLocalEntry:function(path,callback){var stat,node;try{var lookup=FS.lookupPath(path);node=lookup.node;stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){return callback(null,{timestamp:stat.mtime,mode:stat.mode})}else if(FS.isFile(stat.mode)){node.contents=MEMFS.getFileDataAsTypedArray(node);return callback(null,{timestamp:stat.mtime,mode:stat.mode,contents:node.contents})}else{return callback(new Error("node type not supported"))}},storeLocalEntry:function(path,entry,callback){try{if(FS.isDir(entry.mode)){FS.mkdir(path,entry.mode)}else if(FS.isFile(entry.mode)){FS.writeFile(path,entry.contents,{canOwn:true})}else{return callback(new Error("node type not supported"))}FS.chmod(path,entry.mode);FS.utime(path,entry.timestamp,entry.timestamp)}catch(e){return callback(e)}callback(null)},removeLocalEntry:function(path,callback){try{var lookup=FS.lookupPath(path);var stat=FS.stat(path);if(FS.isDir(stat.mode)){FS.rmdir(path)}else if(FS.isFile(stat.mode)){FS.unlink(path)}}catch(e){return callback(e)}callback(null)},loadRemoteEntry:function(store,path,callback){var req=store.get(path);req.onsuccess=function(event){callback(null,event.target.result)};req.onerror=function(e){callback(this.error);e.preventDefault()}},storeRemoteEntry:function(store,path,entry,callback){var req=store.put(entry,path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},removeRemoteEntry:function(store,path,callback){var req=store.delete(path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},reconcile:function(src,dst,callback){var total=0;var create=[];Object.keys(src.entries).forEach(function(key){var e=src.entries[key];var e2=dst.entries[key];if(!e2||e.timestamp>e2.timestamp){create.push(key);total++}});var remove=[];Object.keys(dst.entries).forEach(function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}});if(!total){return callback(null)}var errored=false;var completed=0;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err){if(!done.errored){done.errored=true;return callback(err)}return}if(++completed>=total){return callback(null)}}transaction.onerror=function(e){done(this.error);e.preventDefault()};create.sort().forEach(function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)})}else{IDBFS.loadLocalEntry(path,function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)})}});remove.sort().reverse().forEach(function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}})}};var NODEFS={isWindows:false,staticInit:function(){NODEFS.isWindows=!!process.platform.match(/^win/);var flags=process["binding"]("constants");if(flags["fs"]){flags=flags["fs"]}NODEFS.flagsForNodeMap={1024:flags["O_APPEND"],64:flags["O_CREAT"],128:flags["O_EXCL"],0:flags["O_RDONLY"],2:flags["O_RDWR"],4096:flags["O_SYNC"],512:flags["O_TRUNC"],1:flags["O_WRONLY"]}},bufferFrom:function(arrayBuffer){return Buffer.alloc?Buffer.from(arrayBuffer):new Buffer(arrayBuffer)},mount:function(mount){assert(ENVIRONMENT_IS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)},createNode:function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node},getMode:function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&292)>>2}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return stat.mode},realPath:function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)},flagsForNode:function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;var newFlags=0;for(var k in NODEFS.flagsForNodeMap){if(flags&k){newFlags|=NODEFS.flagsForNodeMap[k];flags^=k}}if(!flags){return newFlags}else{throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}},node_ops:{getattr:function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}},setattr:function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},lookup:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)},mknod:function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return node},rename:function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},unlink:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},rmdir:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},readdir:function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},symlink:function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},readlink:function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}},stream_ops:{open:function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsForNode(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},close:function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}},read:function(stream,buffer,offset,length,position){if(length===0)return 0;try{return fs.readSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}},write:function(stream,buffer,offset,length,position){try{return fs.writeSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){try{var stat=fs.fstatSync(stream.nfd);position+=stat.size}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position}}};var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function(mount){assert(ENVIRONMENT_IS_WORKER);if(!WORKERFS.reader)WORKERFS.reader=new FileReaderSync;var root=WORKERFS.createNode(null,"/",WORKERFS.DIR_MODE,0);var createdParents={};function ensureParent(path){var parts=path.split("/");var parent=root;for(var i=0;i<parts.length-1;i++){var curr=parts.slice(0,i+1).join("/");if(!createdParents[curr]){createdParents[curr]=WORKERFS.createNode(parent,parts[i],WORKERFS.DIR_MODE,0)}parent=createdParents[curr]}return parent}function base(path){var parts=path.split("/");return parts[parts.length-1]}Array.prototype.forEach.call(mount.opts["files"]||[],function(file){WORKERFS.createNode(ensureParent(file.name),base(file.name),WORKERFS.FILE_MODE,0,file,file.lastModifiedDate)});(mount.opts["blobs"]||[]).forEach(function(obj){WORKERFS.createNode(ensureParent(obj["name"]),base(obj["name"]),WORKERFS.FILE_MODE,0,obj["data"])});(mount.opts["packages"]||[]).forEach(function(pack){pack["metadata"].files.forEach(function(file){var name=file.filename.substr(1);WORKERFS.createNode(ensureParent(name),base(name),WORKERFS.FILE_MODE,0,pack["blob"].slice(file.start,file.end))})});return root},createNode:function(parent,name,mode,dev,contents,mtime){var node=FS.createNode(parent,name,mode);node.mode=mode;node.node_ops=WORKERFS.node_ops;node.stream_ops=WORKERFS.stream_ops;node.timestamp=(mtime||new Date).getTime();assert(WORKERFS.FILE_MODE!==WORKERFS.DIR_MODE);if(mode===WORKERFS.FILE_MODE){node.size=contents.size;node.contents=contents}else{node.size=4096;node.contents={}}if(parent){parent.contents[name]=node}return node},node_ops:{getattr:function(node){return{dev:1,ino:undefined,mode:node.mode,nlink:1,uid:0,gid:0,rdev:undefined,size:node.size,atime:new Date(node.timestamp),mtime:new Date(node.timestamp),ctime:new Date(node.timestamp),blksize:4096,blocks:Math.ceil(node.size/4096)}},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}},lookup:function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.ENOENT)},mknod:function(parent,name,mode,dev){throw new FS.ErrnoError(ERRNO_CODES.EPERM)},rename:function(oldNode,newDir,newName){throw new FS.ErrnoError(ERRNO_CODES.EPERM)},unlink:function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.EPERM)},rmdir:function(parent,name){throw new FS.ErrnoError(ERRNO_CODES.EPERM)},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newName,oldPath){throw new FS.ErrnoError(ERRNO_CODES.EPERM)},readlink:function(node){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}},stream_ops:{read:function(stream,buffer,offset,length,position){if(position>=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size},write:function(stream,buffer,offset,length,position){throw new FS.ErrnoError(ERRNO_CODES.EIO)},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position}}};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)},lookupPath:function(path,opts){path=PATH.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(40)}var parts=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),false);var current=FS.root;var current_path="/";for(var i=0;i<parts.length;i++){var islast=i===parts.length-1;if(islast&&opts.parent){break}current=FS.lookupNode(current,parts[i]);current_path=PATH.join2(current_path,parts[i]);if(FS.isMountpoint(current)){if(!islast||islast&&opts.follow_mount){current=current.mounted.root}}if(!islast||opts.follow){var count=0;while(FS.isLink(current.mode)){var link=FS.readlink(current_path);current_path=PATH.resolve(PATH.dirname(current_path),link);var lookup=FS.lookupPath(current_path,{recurse_count:opts.recurse_count});current=lookup.node;if(count++>40){throw new FS.ErrnoError(40)}}}}return{path:current_path,node:current}},getPath:function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}},hashName:function(parentid,name){var hash=0;for(var i=0;i<name.length;i++){hash=(hash<<5)-hash+name.charCodeAt(i)|0}return(parentid+hash>>>0)%FS.nameTable.length},hashAddNode:function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node},hashRemoveNode:function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}},lookupNode:function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)},createNode:function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev};FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:function(){return(this.mode&readMode)===readMode},set:function(val){val?this.mode|=readMode:this.mode&=~readMode}},write:{get:function(){return(this.mode&writeMode)===writeMode},set:function(val){val?this.mode|=writeMode:this.mode&=~writeMode}},isFolder:{get:function(){return FS.isDir(this.mode)}},isDevice:{get:function(){return FS.isChrdev(this.mode)}}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node},destroyNode:function(node){FS.hashRemoveNode(node)},isRoot:function(node){return node===node.parent},isMountpoint:function(node){return!!node.mounted},isFile:function(mode){return(mode&61440)===32768},isDir:function(mode){return(mode&61440)===16384},isLink:function(mode){return(mode&61440)===40960},isChrdev:function(mode){return(mode&61440)===8192},isBlkdev:function(mode){return(mode&61440)===24576},isFIFO:function(mode){return(mode&61440)===4096},isSocket:function(mode){return(mode&49152)===49152},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags},flagsToPermissionString:function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms},nodePermissions:function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return 13}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return 13}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return 13}return 0},mayLookup:function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return 13;return 0},mayCreate:function(dir,name){try{var node=FS.lookupNode(dir,name);return 17}catch(e){}return FS.nodePermissions(dir,"wx")},mayDelete:function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return 20}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return 16}}else{if(FS.isDir(node.mode)){return 21}}return 0},mayOpen:function(node,flags){if(!node){return 2}if(FS.isLink(node.mode)){return 40}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return 21}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))},MAX_OPEN_FDS:4096,nextfd:function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(24)},getStream:function(fd){return FS.streams[fd]},createStream:function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=function(){};FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:function(){return this.node},set:function(val){this.node=val}},isRead:{get:function(){return(this.flags&2097155)!==1}},isWrite:{get:function(){return(this.flags&2097155)!==0}},isAppend:{get:function(){return this.flags&1024}}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream},closeStream:function(fd){FS.streams[fd]=null},chrdev_stream_ops:{open:function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}},llseek:function(){throw new FS.ErrnoError(29)}},major:function(dev){return dev>>8},minor:function(dev){return dev&255},makedev:function(ma,mi){return ma<<8|mi},registerDevice:function(dev,ops){FS.devices[dev]={stream_ops:ops}},getDevice:function(dev){return FS.devices[dev]},getMounts:function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts},syncfs:function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach(function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)})},mount:function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(16)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot},unmount:function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(22)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach(function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}});node.mounted=null;var idx=node.mount.mounts.indexOf(mount);node.mount.mounts.splice(idx,1)},lookup:function(parent,name){return parent.node_ops.lookup(parent,name)},mknod:function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(22)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(1)}return parent.node_ops.mknod(parent,name,mode,dev)},create:function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)},mkdir:function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)},mkdirTree:function(path,mode){var dirs=path.split("/");var d="";for(var i=0;i<dirs.length;++i){if(!dirs[i])continue;d+="/"+dirs[i];try{FS.mkdir(d,mode)}catch(e){if(e.errno!=17)throw e}}},mkdev:function(path,mode,dev){if(typeof dev==="undefined"){dev=mode;mode=438}mode|=8192;return FS.mknod(path,mode,dev)},symlink:function(oldpath,newpath){if(!PATH.resolve(oldpath)){throw new FS.ErrnoError(2)}var lookup=FS.lookupPath(newpath,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(2)}var newname=PATH.basename(newpath);var err=FS.mayCreate(parent,newname);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.symlink){throw new FS.ErrnoError(1)}return parent.node_ops.symlink(parent,newname,oldpath)},rename:function(old_path,new_path){var old_dirname=PATH.dirname(old_path);var new_dirname=PATH.dirname(new_path);var old_name=PATH.basename(old_path);var new_name=PATH.basename(new_path);var lookup,old_dir,new_dir;try{lookup=FS.lookupPath(old_path,{parent:true});old_dir=lookup.node;lookup=FS.lookupPath(new_path,{parent:true});new_dir=lookup.node}catch(e){throw new FS.ErrnoError(16)}if(!old_dir||!new_dir)throw new FS.ErrnoError(2);if(old_dir.mount!==new_dir.mount){throw new FS.ErrnoError(18)}var old_node=FS.lookupNode(old_dir,old_name);var relative=PATH.relative(old_path,new_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(22)}relative=PATH.relative(new_path,old_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(39)}var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(old_node===new_node){return}var isdir=FS.isDir(old_node.mode);var err=FS.mayDelete(old_dir,old_name,isdir);if(err){throw new FS.ErrnoError(err)}err=new_node?FS.mayDelete(new_dir,new_name,isdir):FS.mayCreate(new_dir,new_name);if(err){throw new FS.ErrnoError(err)}if(!old_dir.node_ops.rename){throw new FS.ErrnoError(1)}if(FS.isMountpoint(old_node)||new_node&&FS.isMountpoint(new_node)){throw new FS.ErrnoError(16)}if(new_dir!==old_dir){err=FS.nodePermissions(old_dir,"w");if(err){throw new FS.ErrnoError(err)}}try{if(FS.trackingDelegate["willMovePath"]){FS.trackingDelegate["willMovePath"](old_path,new_path)}}catch(e){console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}FS.hashRemoveNode(old_node);try{old_dir.node_ops.rename(old_node,new_dir,new_name)}catch(e){throw e}finally{FS.hashAddNode(old_node)}try{if(FS.trackingDelegate["onMovePath"])FS.trackingDelegate["onMovePath"](old_path,new_path)}catch(e){console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}},rmdir:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,true);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.rmdir){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.rmdir(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readdir:function(path){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node.node_ops.readdir){throw new FS.ErrnoError(20)}return node.node_ops.readdir(node)},unlink:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,false);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.unlink){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.unlink(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readlink:function(path){var lookup=FS.lookupPath(path);var link=lookup.node;if(!link){throw new FS.ErrnoError(2)}if(!link.node_ops.readlink){throw new FS.ErrnoError(22)}return PATH.resolve(FS.getPath(link.parent),link.node_ops.readlink(link))},stat:function(path,dontFollow){var lookup=FS.lookupPath(path,{follow:!dontFollow});var node=lookup.node;if(!node){throw new FS.ErrnoError(2)}if(!node.node_ops.getattr){throw new FS.ErrnoError(1)}return node.node_ops.getattr(node)},lstat:function(path){return FS.stat(path,true)},chmod:function(path,mode,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{mode:mode&4095|node.mode&~4095,timestamp:Date.now()})},lchmod:function(path,mode){FS.chmod(path,mode,true)},fchmod:function(fd,mode){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chmod(stream.node,mode)},chown:function(path,uid,gid,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{timestamp:Date.now()})},lchown:function(path,uid,gid){FS.chown(path,uid,gid,true)},fchown:function(fd,uid,gid){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chown(stream.node,uid,gid)},truncate:function(path,len){if(len<0){throw new FS.ErrnoError(22)}var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:true});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}if(FS.isDir(node.mode)){throw new FS.ErrnoError(21)}if(!FS.isFile(node.mode)){throw new FS.ErrnoError(22)}var err=FS.nodePermissions(node,"w");if(err){throw new FS.ErrnoError(err)}node.node_ops.setattr(node,{size:len,timestamp:Date.now()})},ftruncate:function(fd,len){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(22)}FS.truncate(stream.node,len)},utime:function(path,atime,mtime){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;node.node_ops.setattr(node,{timestamp:Math.max(atime,mtime)})},open:function(path,flags,mode,fd_start,fd_end){if(path===""){throw new FS.ErrnoError(2)}flags=typeof flags==="string"?FS.modeStringToFlags(flags):flags;mode=typeof mode==="undefined"?438:mode;if(flags&64){mode=mode&4095|32768}else{mode=0}var node;if(typeof path==="object"){node=path}else{path=PATH.normalize(path);try{var lookup=FS.lookupPath(path,{follow:!(flags&131072)});node=lookup.node}catch(e){}}var created=false;if(flags&64){if(node){if(flags&128){throw new FS.ErrnoError(17)}}else{node=FS.mknod(path,mode,0);created=true}}if(!node){throw new FS.ErrnoError(2)}if(FS.isChrdev(node.mode)){flags&=~512}if(flags&65536&&!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}if(!created){var err=FS.mayOpen(node,flags);if(err){throw new FS.ErrnoError(err)}}if(flags&512){FS.truncate(node,0)}flags&=~(128|512);var stream=FS.createStream({node:node,path:FS.getPath(node),flags:flags,seekable:true,position:0,stream_ops:node.stream_ops,ungotten:[],error:false},fd_start,fd_end);if(stream.stream_ops.open){stream.stream_ops.open(stream)}if(Module["logReadFiles"]&&!(flags&1)){if(!FS.readFiles)FS.readFiles={};if(!(path in FS.readFiles)){FS.readFiles[path]=1;console.log("FS.trackingDelegate error on read file: "+path)}}try{if(FS.trackingDelegate["onOpenFile"]){var trackingFlags=0;if((flags&2097155)!==1){trackingFlags|=FS.tracking.openFlags.READ}if((flags&2097155)!==0){trackingFlags|=FS.tracking.openFlags.WRITE}FS.trackingDelegate["onOpenFile"](path,trackingFlags)}}catch(e){console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: "+e.message)}return stream},close:function(stream){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(stream.getdents)stream.getdents=null;try{if(stream.stream_ops.close){stream.stream_ops.close(stream)}}catch(e){throw e}finally{FS.closeStream(stream.fd)}stream.fd=null},isClosed:function(stream){return stream.fd===null},llseek:function(stream,offset,whence){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(!stream.seekable||!stream.stream_ops.llseek){throw new FS.ErrnoError(29)}if(whence!=0&&whence!=1&&whence!=2){throw new FS.ErrnoError(22)}stream.position=stream.stream_ops.llseek(stream,offset,whence);stream.ungotten=[];return stream.position},read:function(stream,buffer,offset,length,position){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.read){throw new FS.ErrnoError(22)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesRead=stream.stream_ops.read(stream,buffer,offset,length,position);if(!seeking)stream.position+=bytesRead;return bytesRead},write:function(stream,buffer,offset,length,position,canOwn){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.write){throw new FS.ErrnoError(22)}if(stream.flags&1024){FS.llseek(stream,0,2)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesWritten=stream.stream_ops.write(stream,buffer,offset,length,position,canOwn);if(!seeking)stream.position+=bytesWritten;try{if(stream.path&&FS.trackingDelegate["onWriteToFile"])FS.trackingDelegate["onWriteToFile"](stream.path)}catch(e){console.log("FS.trackingDelegate['onWriteToFile']('"+stream.path+"') threw an exception: "+e.message)}return bytesWritten},allocate:function(stream,offset,length){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(offset<0||length<=0){throw new FS.ErrnoError(22)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(!FS.isFile(stream.node.mode)&&!FS.isDir(stream.node.mode)){throw new FS.ErrnoError(19)}if(!stream.stream_ops.allocate){throw new FS.ErrnoError(95)}stream.stream_ops.allocate(stream,offset,length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if((stream.flags&2097155)===1){throw new FS.ErrnoError(13)}if(!stream.stream_ops.mmap){throw new FS.ErrnoError(19)}return stream.stream_ops.mmap(stream,buffer,offset,length,position,prot,flags)},msync:function(stream,buffer,offset,length,mmapFlags){if(!stream||!stream.stream_ops.msync){return 0}return stream.stream_ops.msync(stream,buffer,offset,length,mmapFlags)},munmap:function(stream){return 0},ioctl:function(stream,cmd,arg){if(!stream.stream_ops.ioctl){throw new FS.ErrnoError(25)}return stream.stream_ops.ioctl(stream,cmd,arg)},readFile:function(path,opts){opts=opts||{};opts.flags=opts.flags||"r";opts.encoding=opts.encoding||"binary";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var ret;var stream=FS.open(path,opts.flags);var stat=FS.stat(path);var length=stat.size;var buf=new Uint8Array(length);FS.read(stream,buf,0,length,0);if(opts.encoding==="utf8"){ret=UTF8ArrayToString(buf,0)}else if(opts.encoding==="binary"){ret=buf}FS.close(stream);return ret},writeFile:function(path,data,opts){opts=opts||{};opts.flags=opts.flags||"w";var stream=FS.open(path,opts.flags,opts.mode);if(typeof data==="string"){var buf=new Uint8Array(lengthBytesUTF8(data)+1);var actualNumBytes=stringToUTF8Array(data,buf,0,buf.length);FS.write(stream,buf,0,actualNumBytes,undefined,opts.canOwn)}else if(ArrayBuffer.isView(data)){FS.write(stream,data,0,data.byteLength,undefined,opts.canOwn)}else{throw new Error("Unsupported data type")}FS.close(stream)},cwd:function(){return FS.currentPath},chdir:function(path){var lookup=FS.lookupPath(path,{follow:true});if(lookup.node===null){throw new FS.ErrnoError(2)}if(!FS.isDir(lookup.node.mode)){throw new FS.ErrnoError(20)}var err=FS.nodePermissions(lookup.node,"x");if(err){throw new FS.ErrnoError(err)}FS.currentPath=lookup.path},createDefaultDirectories:function(){FS.mkdir("/tmp");FS.mkdir("/home");FS.mkdir("/home/web_user")},createDefaultDevices:function(){FS.mkdir("/dev");FS.registerDevice(FS.makedev(1,3),{read:function(){return 0},write:function(stream,buffer,offset,length,pos){return length}});FS.mkdev("/dev/null",FS.makedev(1,3));TTY.register(FS.makedev(5,0),TTY.default_tty_ops);TTY.register(FS.makedev(6,0),TTY.default_tty1_ops);FS.mkdev("/dev/tty",FS.makedev(5,0));FS.mkdev("/dev/tty1",FS.makedev(6,0));var random_device;if(typeof crypto==="object"&&typeof crypto["getRandomValues"]==="function"){var randomBuffer=new Uint8Array(1);random_device=function(){crypto.getRandomValues(randomBuffer);return randomBuffer[0]}}else if(ENVIRONMENT_IS_NODE){try{var crypto_module=require("crypto");random_device=function(){return crypto_module["randomBytes"](1)[0]}}catch(e){}}else{}if(!random_device){random_device=function(){abort("random_device")}}FS.createDevice("/dev","random",random_device);FS.createDevice("/dev","urandom",random_device);FS.mkdir("/dev/shm");FS.mkdir("/dev/shm/tmp")},createSpecialDirectories:function(){FS.mkdir("/proc");FS.mkdir("/proc/self");FS.mkdir("/proc/self/fd");FS.mount({mount:function(){var node=FS.createNode("/proc/self","fd",16384|511,73);node.node_ops={lookup:function(parent,name){var fd=+name;var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(9);var ret={parent:null,mount:{mountpoint:"fake"},node_ops:{readlink:function(){return stream.path}}};ret.parent=ret;return ret}};return node}},{},"/proc/self/fd")},createStandardStreams:function(){if(Module["stdin"]){FS.createDevice("/dev","stdin",Module["stdin"])}else{FS.symlink("/dev/tty","/dev/stdin")}if(Module["stdout"]){FS.createDevice("/dev","stdout",null,Module["stdout"])}else{FS.symlink("/dev/tty","/dev/stdout")}if(Module["stderr"]){FS.createDevice("/dev","stderr",null,Module["stderr"])}else{FS.symlink("/dev/tty1","/dev/stderr")}var stdin=FS.open("/dev/stdin","r");var stdout=FS.open("/dev/stdout","w");var stderr=FS.open("/dev/stderr","w")},ensureErrnoError:function(){if(FS.ErrnoError)return;FS.ErrnoError=function ErrnoError(errno,node){this.node=node;this.setErrno=function(errno){this.errno=errno};this.setErrno(errno);this.message="FS error";if(this.stack)Object.defineProperty(this,"stack",{value:(new Error).stack,writable:true})};FS.ErrnoError.prototype=new Error;FS.ErrnoError.prototype.constructor=FS.ErrnoError;[2].forEach(function(code){FS.genericErrors[code]=new FS.ErrnoError(code);FS.genericErrors[code].stack="<generic error, no stack>"})},staticInit:function(){FS.ensureErrnoError();FS.nameTable=new Array(4096);FS.mount(MEMFS,{},"/");FS.createDefaultDirectories();FS.createDefaultDevices();FS.createSpecialDirectories();FS.filesystems={"MEMFS":MEMFS,"IDBFS":IDBFS,"NODEFS":NODEFS,"WORKERFS":WORKERFS}},init:function(input,output,error){FS.init.initialized=true;FS.ensureErrnoError();Module["stdin"]=input||Module["stdin"];Module["stdout"]=output||Module["stdout"];Module["stderr"]=error||Module["stderr"];FS.createStandardStreams()},quit:function(){FS.init.initialized=false;var fflush=Module["_fflush"];if(fflush)fflush(0);for(var i=0;i<FS.streams.length;i++){var stream=FS.streams[i];if(!stream){continue}FS.close(stream)}},getMode:function(canRead,canWrite){var mode=0;if(canRead)mode|=292|73;if(canWrite)mode|=146;return mode},joinPath:function(parts,forceRelative){var path=PATH.join.apply(null,parts);if(forceRelative&&path[0]=="/")path=path.substr(1);return path},absolutePath:function(relative,base){return PATH.resolve(base,relative)},standardizePath:function(path){return PATH.normalize(path)},findObject:function(path,dontResolveLastLink){var ret=FS.analyzePath(path,dontResolveLastLink);if(ret.exists){return ret.object}else{___setErrNo(ret.error);return null}},analyzePath:function(path,dontResolveLastLink){try{var lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});path=lookup.path}catch(e){}var ret={isRoot:false,exists:false,error:0,name:null,path:null,object:null,parentExists:false,parentPath:null,parentObject:null};try{var lookup=FS.lookupPath(path,{parent:true});ret.parentExists=true;ret.parentPath=lookup.path;ret.parentObject=lookup.node;ret.name=PATH.basename(path);lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});ret.exists=true;ret.path=lookup.path;ret.object=lookup.node;ret.name=lookup.node.name;ret.isRoot=lookup.path==="/"}catch(e){ret.error=e.errno}return ret},createFolder:function(parent,name,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.mkdir(path,mode)},createPath:function(parent,path,canRead,canWrite){parent=typeof parent==="string"?parent:FS.getPath(parent);var parts=path.split("/").reverse();while(parts.length){var part=parts.pop();if(!part)continue;var current=PATH.join2(parent,part);try{FS.mkdir(current)}catch(e){}parent=current}return current},createFile:function(parent,name,properties,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.create(path,mode)},createDataFile:function(parent,name,data,canRead,canWrite,canOwn){var path=name?PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name):parent;var mode=FS.getMode(canRead,canWrite);var node=FS.create(path,mode);if(data){if(typeof data==="string"){var arr=new Array(data.length);for(var i=0,len=data.length;i<len;++i)arr[i]=data.charCodeAt(i);data=arr}FS.chmod(node,mode|146);var stream=FS.open(node,"w");FS.write(stream,data,0,data.length,0,canOwn);FS.close(stream);FS.chmod(node,mode)}return node},createDevice:function(parent,name,input,output){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(!!input,!!output);if(!FS.createDevice.major)FS.createDevice.major=64;var dev=FS.makedev(FS.createDevice.major++,0);FS.registerDevice(dev,{open:function(stream){stream.seekable=false},close:function(stream){if(output&&output.buffer&&output.buffer.length){output(10)}},read:function(stream,buffer,offset,length,pos){var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=input()}catch(e){throw new FS.ErrnoError(5)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(11)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){for(var i=0;i<length;i++){try{output(buffer[offset+i])}catch(e){throw new FS.ErrnoError(5)}}if(length){stream.node.timestamp=Date.now()}return i}});return FS.mkdev(path,mode,dev)},createLink:function(parent,name,target,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);return FS.symlink(target,path)},forceLoadFile:function(obj){if(obj.isDevice||obj.isFolder||obj.link||obj.contents)return true;var success=true;if(typeof XMLHttpRequest!=="undefined"){throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")}else if(Module["read"]){try{obj.contents=intArrayFromString(Module["read"](obj.url),true);obj.usedBytes=obj.contents.length}catch(e){success=false}}else{throw new Error("Cannot load without read() or XMLHttpRequest.")}if(!success)___setErrNo(5);return success},createLazyFile:function(parent,name,url,canRead,canWrite){function LazyUint8Array(){this.lengthKnown=false;this.chunks=[]}LazyUint8Array.prototype.get=function LazyUint8Array_get(idx){if(idx>this.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}};var lazyArray=this;lazyArray.setDataGetter(function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]});if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._length}},chunkSize:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize}}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:function(){return this.contents.length}}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach(function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}return fn.apply(null,arguments)}});stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);if(contents.slice){for(var i=0;i<size;i++){buffer[offset+i]=contents[position+i]}}else{for(var i=0;i<size;i++){buffer[offset+i]=contents.get(position+i)}}return size};node.stream_ops=stream_ops;return node},createPreloadedFile:function(parent,name,url,canRead,canWrite,onload,onerror,dontCreateFile,canOwn,preFinish){Browser.init();var fullname=name?PATH.resolve(PATH.join2(parent,name)):parent;var dep=getUniqueRunDependency("cp "+fullname);function processData(byteArray){function finish(byteArray){if(preFinish)preFinish();if(!dontCreateFile){FS.createDataFile(parent,name,byteArray,canRead,canWrite,canOwn)}if(onload)onload();removeRunDependency(dep)}var handled=false;Module["preloadPlugins"].forEach(function(plugin){if(handled)return;if(plugin["canHandle"](fullname)){plugin["handle"](byteArray,fullname,finish,function(){if(onerror)onerror();removeRunDependency(dep)});handled=true}});if(!handled)finish(byteArray)}addRunDependency(dep);if(typeof url=="string"){Browser.asyncLoad(url,function(byteArray){processData(byteArray)},onerror)}else{processData(url)}},indexedDB:function(){return window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB},DB_NAME:function(){return"EM_FS_"+window.location.pathname},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=function openRequest_onupgradeneeded(){console.log("creating db");var db=openRequest.result;db.createObjectStore(FS.DB_STORE_NAME)};openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;var transaction=db.transaction([FS.DB_STORE_NAME],"readwrite");var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var putRequest=files.put(FS.analyzePath(path).object.contents,path);putRequest.onsuccess=function putRequest_onsuccess(){ok++;if(ok+fail==total)finish()};putRequest.onerror=function putRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror},loadFilesFromDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=onerror;openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;try{var transaction=db.transaction([FS.DB_STORE_NAME],"readonly")}catch(e){onerror(e);return}var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var getRequest=files.get(path);getRequest.onsuccess=function getRequest_onsuccess(){if(FS.analyzePath(path).exists){FS.unlink(path)}FS.createDataFile(PATH.dirname(path),PATH.basename(path),getRequest.result,true,true,true);ok++;if(ok+fail==total)finish()};getRequest.onerror=function getRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror}};var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function(dirfd,path){if(path[0]!=="/"){var dir;if(dirfd===-100){dir=FS.cwd()}else{var dirstream=FS.getStream(dirfd);if(!dirstream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);dir=dirstream.path}path=PATH.join2(dir,path)}return path},doStat:function(func,path,buf){try{var stat=func(path)}catch(e){if(e&&e.node&&PATH.normalize(path)!==PATH.normalize(FS.getPath(e.node))){return-ERRNO_CODES.ENOTDIR}throw e}HEAP32[buf>>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;HEAP32[buf+36>>2]=stat.size;HEAP32[buf+40>>2]=4096;HEAP32[buf+44>>2]=stat.blocks;HEAP32[buf+48>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+52>>2]=0;HEAP32[buf+56>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ino;return 0},doMsync:function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)},doMkdir:function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0},doMknod:function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-ERRNO_CODES.EINVAL}FS.mknod(path,mode,dev);return 0},doReadlink:function(path,buf,bufsize){if(bufsize<=0)return-ERRNO_CODES.EINVAL;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len},doAccess:function(path,amode){if(amode&~7){return-ERRNO_CODES.EINVAL}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-ERRNO_CODES.EACCES}return 0},doDup:function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd},doReadv:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr<len)break}return ret},doWritev:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret},varargs:0,get:function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret},getStr:function(){var ret=UTF8ToString(SYSCALLS.get());return ret},getStreamFromFD:function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return stream},getSocketFromFD:function(){var socket=SOCKFS.getSocket(SYSCALLS.get());if(!socket)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return socket},getSocketAddress:function(allowNull){var addrp=SYSCALLS.get(),addrlen=SYSCALLS.get();if(allowNull&&addrp===0)return null;var info=__read_sockaddr(addrp,addrlen);if(info.errno)throw new FS.ErrnoError(info.errno);info.addr=DNS.lookup_addr(info.addr)||info.addr;return info},get64:function(){var low=SYSCALLS.get(),high=SYSCALLS.get();return low},getZero:function(){SYSCALLS.get()}};function ___syscall10(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.unlink(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}var SOCKFS={mount:function(mount){Module["websocket"]=Module["websocket"]&&"object"===typeof Module["websocket"]?Module["websocket"]:{};Module["websocket"]._callbacks={};Module["websocket"]["on"]=function(event,callback){if("function"===typeof callback){this._callbacks[event]=callback}return this};Module["websocket"].emit=function(event,param){if("function"===typeof this._callbacks[event]){this._callbacks[event].call(this,param)}};return FS.createNode(null,"/",16384|511,0)},createSocket:function(family,type,protocol){var streaming=type==1;if(protocol){assert(streaming==(protocol==6))}var sock={family:family,type:type,protocol:protocol,server:null,error:null,peers:{},pending:[],recv_queue:[],sock_ops:SOCKFS.websocket_sock_ops};var name=SOCKFS.nextname();var node=FS.createNode(SOCKFS.root,name,49152,0);node.sock=sock;var stream=FS.createStream({path:name,node:node,flags:FS.modeStringToFlags("r+"),seekable:false,stream_ops:SOCKFS.stream_ops});sock.stream=stream;return sock},getSocket:function(fd){var stream=FS.getStream(fd);if(!stream||!FS.isSocket(stream.node.mode)){return null}return stream.node.sock},stream_ops:{poll:function(stream){var sock=stream.node.sock;return sock.sock_ops.poll(sock)},ioctl:function(stream,request,varargs){var sock=stream.node.sock;return sock.sock_ops.ioctl(sock,request,varargs)},read:function(stream,buffer,offset,length,position){var sock=stream.node.sock;var msg=sock.sock_ops.recvmsg(sock,length);if(!msg){return 0}buffer.set(msg.buffer,offset);return msg.buffer.length},write:function(stream,buffer,offset,length,position){var sock=stream.node.sock;return sock.sock_ops.sendmsg(sock,buffer,offset,length)},close:function(stream){var sock=stream.node.sock;sock.sock_ops.close(sock)}},nextname:function(){if(!SOCKFS.nextname.current){SOCKFS.nextname.current=0}return"socket["+SOCKFS.nextname.current+++"]"},websocket_sock_ops:{createPeer:function(sock,addr,port){var ws;if(typeof addr==="object"){ws=addr;addr=null;port=null}if(ws){if(ws._socket){addr=ws._socket.remoteAddress;port=ws._socket.remotePort}else{var result=/ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);if(!result){throw new Error("WebSocket URL must be in the format ws(s)://address:port")}addr=result[1];port=parseInt(result[2],10)}}else{try{var runtimeConfig=Module["websocket"]&&"object"===typeof Module["websocket"];var url="ws:#".replace("#","//");if(runtimeConfig){if("string"===typeof Module["websocket"]["url"]){url=Module["websocket"]["url"]}}if(url==="ws://"||url==="wss://"){var parts=addr.split("/");url=url+parts[0]+":"+port+"/"+parts.slice(1).join("/")}var subProtocols="binary";if(runtimeConfig){if("string"===typeof Module["websocket"]["subprotocol"]){subProtocols=Module["websocket"]["subprotocol"]}}subProtocols=subProtocols.replace(/^ +| +$/g,"").split(/ *, */);var opts=ENVIRONMENT_IS_NODE?{"protocol":subProtocols.toString()}:subProtocols;if(runtimeConfig&&null===Module["websocket"]["subprotocol"]){subProtocols="null";opts=undefined}var WebSocketConstructor;if(ENVIRONMENT_IS_NODE){WebSocketConstructor=require("ws")}else if(ENVIRONMENT_IS_WEB){WebSocketConstructor=window["WebSocket"]}else{WebSocketConstructor=WebSocket}ws=new WebSocketConstructor(url,opts);ws.binaryType="arraybuffer"}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH)}}var peer={addr:addr,port:port,socket:ws,dgram_send_queue:[]};SOCKFS.websocket_sock_ops.addPeer(sock,peer);SOCKFS.websocket_sock_ops.handlePeerEvents(sock,peer);if(sock.type===2&&typeof sock.sport!=="undefined"){peer.dgram_send_queue.push(new Uint8Array([255,255,255,255,"p".charCodeAt(0),"o".charCodeAt(0),"r".charCodeAt(0),"t".charCodeAt(0),(sock.sport&65280)>>8,sock.sport&255]))}return peer},getPeer:function(sock,addr,port){return sock.peers[addr+":"+port]},addPeer:function(sock,peer){sock.peers[peer.addr+":"+peer.port]=peer},removePeer:function(sock,peer){delete sock.peers[peer.addr+":"+peer.port]},handlePeerEvents:function(sock,peer){var first=true;var handleOpen=function(){Module["websocket"].emit("open",sock.stream.fd);try{var queued=peer.dgram_send_queue.shift();while(queued){peer.socket.send(queued);queued=peer.dgram_send_queue.shift()}}catch(e){peer.socket.close()}};function handleMessage(data){assert(typeof data!=="string"&&data.byteLength!==undefined);if(data.byteLength==0){return}data=new Uint8Array(data);var wasfirst=first;first=false;if(wasfirst&&data.length===10&&data[0]===255&&data[1]===255&&data[2]===255&&data[3]===255&&data[4]==="p".charCodeAt(0)&&data[5]==="o".charCodeAt(0)&&data[6]==="r".charCodeAt(0)&&data[7]==="t".charCodeAt(0)){var newport=data[8]<<8|data[9];SOCKFS.websocket_sock_ops.removePeer(sock,peer);peer.port=newport;SOCKFS.websocket_sock_ops.addPeer(sock,peer);return}sock.recv_queue.push({addr:peer.addr,port:peer.port,data:data});Module["websocket"].emit("message",sock.stream.fd)}if(ENVIRONMENT_IS_NODE){peer.socket.on("open",handleOpen);peer.socket.on("message",function(data,flags){if(!flags.binary){return}handleMessage(new Uint8Array(data).buffer)});peer.socket.on("close",function(){Module["websocket"].emit("close",sock.stream.fd)});peer.socket.on("error",function(error){sock.error=ERRNO_CODES.ECONNREFUSED;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])})}else{peer.socket.onopen=handleOpen;peer.socket.onclose=function(){Module["websocket"].emit("close",sock.stream.fd)};peer.socket.onmessage=function peer_socket_onmessage(event){handleMessage(event.data)};peer.socket.onerror=function(error){sock.error=ERRNO_CODES.ECONNREFUSED;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])}}},poll:function(sock){if(sock.type===1&&sock.server){return sock.pending.length?64|1:0}var mask=0;var dest=sock.type===1?SOCKFS.websocket_sock_ops.getPeer(sock,sock.daddr,sock.dport):null;if(sock.recv_queue.length||!dest||dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=64|1}if(!dest||dest&&dest.socket.readyState===dest.socket.OPEN){mask|=4}if(dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=16}return mask},ioctl:function(sock,request,arg){switch(request){case 21531:var bytes=0;if(sock.recv_queue.length){bytes=sock.recv_queue[0].data.length}HEAP32[arg>>2]=bytes;return 0;default:return ERRNO_CODES.EINVAL}},close:function(sock){if(sock.server){try{sock.server.close()}catch(e){}sock.server=null}var peers=Object.keys(sock.peers);for(var i=0;i<peers.length;i++){var peer=sock.peers[peers[i]];try{peer.socket.close()}catch(e){}SOCKFS.websocket_sock_ops.removePeer(sock,peer)}return 0},bind:function(sock,addr,port){if(typeof sock.saddr!=="undefined"||typeof sock.sport!=="undefined"){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}sock.saddr=addr;sock.sport=port;if(sock.type===2){if(sock.server){sock.server.close();sock.server=null}try{sock.sock_ops.listen(sock,0)}catch(e){if(!(e instanceof FS.ErrnoError))throw e;if(e.errno!==ERRNO_CODES.EOPNOTSUPP)throw e}}},connect:function(sock,addr,port){if(sock.server){throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)}if(typeof sock.daddr!=="undefined"&&typeof sock.dport!=="undefined"){var dest=SOCKFS.websocket_sock_ops.getPeer(sock,sock.daddr,sock.dport);if(dest){if(dest.socket.readyState===dest.socket.CONNECTING){throw new FS.ErrnoError(ERRNO_CODES.EALREADY)}else{throw new FS.ErrnoError(ERRNO_CODES.EISCONN)}}}var peer=SOCKFS.websocket_sock_ops.createPeer(sock,addr,port);sock.daddr=peer.addr;sock.dport=peer.port;throw new FS.ErrnoError(ERRNO_CODES.EINPROGRESS)},listen:function(sock,backlog){if(!ENVIRONMENT_IS_NODE){throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)}if(sock.server){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var WebSocketServer=require("ws").Server;var host=sock.saddr;sock.server=new WebSocketServer({host:host,port:sock.sport});Module["websocket"].emit("listen",sock.stream.fd);sock.server.on("connection",function(ws){if(sock.type===1){var newsock=SOCKFS.createSocket(sock.family,sock.type,sock.protocol);var peer=SOCKFS.websocket_sock_ops.createPeer(newsock,ws);newsock.daddr=peer.addr;newsock.dport=peer.port;sock.pending.push(newsock);Module["websocket"].emit("connection",newsock.stream.fd)}else{SOCKFS.websocket_sock_ops.createPeer(sock,ws);Module["websocket"].emit("connection",sock.stream.fd)}});sock.server.on("closed",function(){Module["websocket"].emit("close",sock.stream.fd);sock.server=null});sock.server.on("error",function(error){sock.error=ERRNO_CODES.EHOSTUNREACH;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"EHOSTUNREACH: Host is unreachable"])})},accept:function(listensock){if(!listensock.server){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var newsock=listensock.pending.shift();newsock.stream.flags=listensock.stream.flags;return newsock},getname:function(sock,peer){var addr,port;if(peer){if(sock.daddr===undefined||sock.dport===undefined){throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)}addr=sock.daddr;port=sock.dport}else{addr=sock.saddr||0;port=sock.sport||0}return{addr:addr,port:port}},sendmsg:function(sock,buffer,offset,length,addr,port){if(sock.type===2){if(addr===undefined||port===undefined){addr=sock.daddr;port=sock.dport}if(addr===undefined||port===undefined){throw new FS.ErrnoError(ERRNO_CODES.EDESTADDRREQ)}}else{addr=sock.daddr;port=sock.dport}var dest=SOCKFS.websocket_sock_ops.getPeer(sock,addr,port);if(sock.type===1){if(!dest||dest.socket.readyState===dest.socket.CLOSING||dest.socket.readyState===dest.socket.CLOSED){throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)}else if(dest.socket.readyState===dest.socket.CONNECTING){throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}}if(ArrayBuffer.isView(buffer)){offset+=buffer.byteOffset;buffer=buffer.buffer}var data;data=buffer.slice(offset,offset+length);if(sock.type===2){if(!dest||dest.socket.readyState!==dest.socket.OPEN){if(!dest||dest.socket.readyState===dest.socket.CLOSING||dest.socket.readyState===dest.socket.CLOSED){dest=SOCKFS.websocket_sock_ops.createPeer(sock,addr,port)}dest.dgram_send_queue.push(data);return length}}try{dest.socket.send(data);return length}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}},recvmsg:function(sock,length){if(sock.type===1&&sock.server){throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)}var queued=sock.recv_queue.shift();if(!queued){if(sock.type===1){var dest=SOCKFS.websocket_sock_ops.getPeer(sock,sock.daddr,sock.dport);if(!dest){throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN)}else if(dest.socket.readyState===dest.socket.CLOSING||dest.socket.readyState===dest.socket.CLOSED){return null}else{throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}}else{throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)}}var queuedLength=queued.data.byteLength||queued.data.length;var queuedOffset=queued.data.byteOffset||0;var queuedBuffer=queued.data.buffer||queued.data;var bytesRead=Math.min(length,queuedLength);var res={buffer:new Uint8Array(queuedBuffer,queuedOffset,bytesRead),addr:queued.addr,port:queued.port};if(sock.type===1&&bytesRead<queuedLength){var bytesRemaining=queuedLength-bytesRead;queued.data=new Uint8Array(queuedBuffer,queuedOffset+bytesRead,bytesRemaining);sock.recv_queue.unshift(queued)}return res}}};function __inet_pton4_raw(str){var b=str.split(".");for(var i=0;i<4;i++){var tmp=Number(b[i]);if(isNaN(tmp))return null;b[i]=tmp}return(b[0]|b[1]<<8|b[2]<<16|b[3]<<24)>>>0}function __inet_pton6_raw(str){var words;var w,offset,z;var valid6regx=/^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;var parts=[];if(!valid6regx.test(str)){return null}if(str==="::"){return[0,0,0,0,0,0,0,0]}if(str.indexOf("::")===0){str=str.replace("::","Z:")}else{str=str.replace("::",":Z:")}if(str.indexOf(".")>0){str=str.replace(new RegExp("[.]","g"),":");words=str.split(":");words[words.length-4]=parseInt(words[words.length-4])+parseInt(words[words.length-3])*256;words[words.length-3]=parseInt(words[words.length-2])+parseInt(words[words.length-1])*256;words=words.slice(0,words.length-2)}else{words=str.split(":")}offset=0;z=0;for(w=0;w<words.length;w++){if(typeof words[w]==="string"){if(words[w]==="Z"){for(z=0;z<8-words.length+1;z++){parts[w+z]=0}offset=z-1}else{parts[w+offset]=_htons(parseInt(words[w],16))}}else{parts[w+offset]=words[w]}}return[parts[1]<<16|parts[0],parts[3]<<16|parts[2],parts[5]<<16|parts[4],parts[7]<<16|parts[6]]}var DNS={address_map:{id:1,addrs:{},names:{}},lookup_name:function(name){var res=__inet_pton4_raw(name);if(res!==null){return name}res=__inet_pton6_raw(name);if(res!==null){return name}var addr;if(DNS.address_map.addrs[name]){addr=DNS.address_map.addrs[name]}else{var id=DNS.address_map.id++;assert(id<65535,"exceeded max address mappings of 65535");addr="172.29."+(id&255)+"."+(id&65280);DNS.address_map.names[addr]=name;DNS.address_map.addrs[name]=addr}return addr},lookup_addr:function(addr){if(DNS.address_map.names[addr]){return DNS.address_map.names[addr]}return null}};function __inet_ntop4_raw(addr){return(addr&255)+"."+(addr>>8&255)+"."+(addr>>16&255)+"."+(addr>>24&255)}function __inet_ntop6_raw(ints){var str="";var word=0;var longest=0;var lastzero=0;var zstart=0;var len=0;var i=0;var parts=[ints[0]&65535,ints[0]>>16,ints[1]&65535,ints[1]>>16,ints[2]&65535,ints[2]>>16,ints[3]&65535,ints[3]>>16];var hasipv4=true;var v4part="";for(i=0;i<5;i++){if(parts[i]!==0){hasipv4=false;break}}if(hasipv4){v4part=__inet_ntop4_raw(parts[6]|parts[7]<<16);if(parts[5]===-1){str="::ffff:";str+=v4part;return str}if(parts[5]===0){str="::";if(v4part==="0.0.0.0")v4part="";if(v4part==="0.0.0.1")v4part="1";str+=v4part;return str}}for(word=0;word<8;word++){if(parts[word]===0){if(word-lastzero>1){len=0}lastzero=word;len++}if(len>longest){longest=len;zstart=word-longest+1}}for(word=0;word<8;word++){if(longest>1){if(parts[word]===0&&word>=zstart&&word<zstart+longest){if(word===zstart){str+=":";if(zstart===0)str+=":"}continue}}str+=Number(_ntohs(parts[word]&65535)).toString(16);str+=word<7?":":""}return str}function __read_sockaddr(sa,salen){var family=HEAP16[sa>>1];var port=_ntohs(HEAP16[sa+2>>1]);var addr;switch(family){case 2:if(salen!==16){return{errno:22}}addr=HEAP32[sa+4>>2];addr=__inet_ntop4_raw(addr);break;case 10:if(salen!==28){return{errno:22}}addr=[HEAP32[sa+8>>2],HEAP32[sa+12>>2],HEAP32[sa+16>>2],HEAP32[sa+20>>2]];addr=__inet_ntop6_raw(addr);break;default:return{errno:97}}return{family:family,addr:addr,port:port}}function __write_sockaddr(sa,family,addr,port){switch(family){case 2:addr=__inet_pton4_raw(addr);HEAP16[sa>>1]=family;HEAP32[sa+4>>2]=addr;HEAP16[sa+2>>1]=_htons(port);break;case 10:addr=__inet_pton6_raw(addr);HEAP32[sa>>2]=family;HEAP32[sa+8>>2]=addr[0];HEAP32[sa+12>>2]=addr[1];HEAP32[sa+16>>2]=addr[2];HEAP32[sa+20>>2]=addr[3];HEAP16[sa+2>>1]=_htons(port);HEAP32[sa+4>>2]=0;HEAP32[sa+24>>2]=0;break;default:return{errno:97}}return{}}function ___syscall102(which,varargs){SYSCALLS.varargs=varargs;try{var call=SYSCALLS.get(),socketvararg=SYSCALLS.get();SYSCALLS.varargs=socketvararg;switch(call){case 1:{var domain=SYSCALLS.get(),type=SYSCALLS.get(),protocol=SYSCALLS.get();var sock=SOCKFS.createSocket(domain,type,protocol);return sock.stream.fd}case 2:{var sock=SYSCALLS.getSocketFromFD(),info=SYSCALLS.getSocketAddress();sock.sock_ops.bind(sock,info.addr,info.port);return 0}case 3:{var sock=SYSCALLS.getSocketFromFD(),info=SYSCALLS.getSocketAddress();sock.sock_ops.connect(sock,info.addr,info.port);return 0}case 4:{var sock=SYSCALLS.getSocketFromFD(),backlog=SYSCALLS.get();sock.sock_ops.listen(sock,backlog);return 0}case 5:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var newsock=sock.sock_ops.accept(sock);if(addr){var res=__write_sockaddr(addr,newsock.family,DNS.lookup_name(newsock.daddr),newsock.dport)}return newsock.stream.fd}case 6:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(sock.saddr||"0.0.0.0"),sock.sport);return 0}case 7:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();if(!sock.daddr){return-ERRNO_CODES.ENOTCONN}var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(sock.daddr),sock.dport);return 0}case 11:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),length=SYSCALLS.get(),flags=SYSCALLS.get(),dest=SYSCALLS.getSocketAddress(true);if(!dest){return FS.write(sock.stream,HEAP8,message,length)}else{return sock.sock_ops.sendmsg(sock,HEAP8,message,length,dest.addr,dest.port)}}case 12:{var sock=SYSCALLS.getSocketFromFD(),buf=SYSCALLS.get(),len=SYSCALLS.get(),flags=SYSCALLS.get(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var msg=sock.sock_ops.recvmsg(sock,len);if(!msg)return 0;if(addr){var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(msg.addr),msg.port)}HEAPU8.set(msg.buffer,buf);return msg.buffer.byteLength}case 14:{return-ERRNO_CODES.ENOPROTOOPT}case 15:{var sock=SYSCALLS.getSocketFromFD(),level=SYSCALLS.get(),optname=SYSCALLS.get(),optval=SYSCALLS.get(),optlen=SYSCALLS.get();if(level===1){if(optname===4){HEAP32[optval>>2]=sock.error;HEAP32[optlen>>2]=4;sock.error=null;return 0}}return-ERRNO_CODES.ENOPROTOOPT}case 16:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),flags=SYSCALLS.get();var iov=HEAP32[message+8>>2];var num=HEAP32[message+12>>2];var addr,port;var name=HEAP32[message>>2];var namelen=HEAP32[message+4>>2];if(name){var info=__read_sockaddr(name,namelen);if(info.errno)return-info.errno;port=info.port;addr=DNS.lookup_addr(info.addr)||info.addr}var total=0;for(var i=0;i<num;i++){total+=HEAP32[iov+(8*i+4)>>2]}var view=new Uint8Array(total);var offset=0;for(var i=0;i<num;i++){var iovbase=HEAP32[iov+(8*i+0)>>2];var iovlen=HEAP32[iov+(8*i+4)>>2];for(var j=0;j<iovlen;j++){view[offset++]=HEAP8[iovbase+j>>0]}}return sock.sock_ops.sendmsg(sock,view,0,total,addr,port)}case 17:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),flags=SYSCALLS.get();var iov=HEAP32[message+8>>2];var num=HEAP32[message+12>>2];var total=0;for(var i=0;i<num;i++){total+=HEAP32[iov+(8*i+4)>>2]}var msg=sock.sock_ops.recvmsg(sock,total);if(!msg)return 0;var name=HEAP32[message>>2];if(name){var res=__write_sockaddr(name,sock.family,DNS.lookup_name(msg.addr),msg.port)}var bytesRead=0;var bytesRemaining=msg.buffer.byteLength;for(var i=0;bytesRemaining>0&&i<num;i++){var iovbase=HEAP32[iov+(8*i+0)>>2];var iovlen=HEAP32[iov+(8*i+4)>>2];if(!iovlen){continue}var length=Math.min(iovlen,bytesRemaining);var buf=msg.buffer.subarray(bytesRead,bytesRead+length);HEAPU8.set(buf,iovbase+bytesRead);bytesRead+=length;bytesRemaining-=length}return bytesRead}default:abort("unsupported socketcall syscall "+call)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall12(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.chdir(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();var offset=offset_low;FS.llseek(stream,offset,whence);HEAP32[result>>2]=stream.position;if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall142(which,varargs){SYSCALLS.varargs=varargs;try{var nfds=SYSCALLS.get(),readfds=SYSCALLS.get(),writefds=SYSCALLS.get(),exceptfds=SYSCALLS.get(),timeout=SYSCALLS.get();var total=0;var srcReadLow=readfds?HEAP32[readfds>>2]:0,srcReadHigh=readfds?HEAP32[readfds+4>>2]:0;var srcWriteLow=writefds?HEAP32[writefds>>2]:0,srcWriteHigh=writefds?HEAP32[writefds+4>>2]:0;var srcExceptLow=exceptfds?HEAP32[exceptfds>>2]:0,srcExceptHigh=exceptfds?HEAP32[exceptfds+4>>2]:0;var dstReadLow=0,dstReadHigh=0;var dstWriteLow=0,dstWriteHigh=0;var dstExceptLow=0,dstExceptHigh=0;var allLow=(readfds?HEAP32[readfds>>2]:0)|(writefds?HEAP32[writefds>>2]:0)|(exceptfds?HEAP32[exceptfds>>2]:0);var allHigh=(readfds?HEAP32[readfds+4>>2]:0)|(writefds?HEAP32[writefds+4>>2]:0)|(exceptfds?HEAP32[exceptfds+4>>2]:0);var check=function(fd,low,high,val){return fd<32?low&val:high&val};for(var fd=0;fd<nfds;fd++){var mask=1<<fd%32;if(!check(fd,allLow,allHigh,mask)){continue}var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);var flags=SYSCALLS.DEFAULT_POLLMASK;if(stream.stream_ops.poll){flags=stream.stream_ops.poll(stream)}if(flags&1&&check(fd,srcReadLow,srcReadHigh,mask)){fd<32?dstReadLow=dstReadLow|mask:dstReadHigh=dstReadHigh|mask;total++}if(flags&4&&check(fd,srcWriteLow,srcWriteHigh,mask)){fd<32?dstWriteLow=dstWriteLow|mask:dstWriteHigh=dstWriteHigh|mask;total++}if(flags&2&&check(fd,srcExceptLow,srcExceptHigh,mask)){fd<32?dstExceptLow=dstExceptLow|mask:dstExceptHigh=dstExceptHigh|mask;total++}}if(readfds){HEAP32[readfds>>2]=dstReadLow;HEAP32[readfds+4>>2]=dstReadHigh}if(writefds){HEAP32[writefds>>2]=dstWriteLow;HEAP32[writefds+4>>2]=dstWriteHigh}if(exceptfds){HEAP32[exceptfds>>2]=dstExceptLow;HEAP32[exceptfds+4>>2]=dstExceptHigh}return total}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall145(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doReadv(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall15(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),mode=SYSCALLS.get();FS.chmod(path,mode);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall168(which,varargs){SYSCALLS.varargs=varargs;try{var fds=SYSCALLS.get(),nfds=SYSCALLS.get(),timeout=SYSCALLS.get();var nonzero=0;for(var i=0;i<nfds;i++){var pollfd=fds+8*i;var fd=HEAP32[pollfd>>2];var events=HEAP16[pollfd+4>>1];var mask=32;var stream=FS.getStream(fd);if(stream){mask=SYSCALLS.DEFAULT_POLLMASK;if(stream.stream_ops.poll){mask=stream.stream_ops.poll(stream)}}mask&=events|8|16;if(mask)nonzero++;HEAP16[pollfd+6>>1]=mask}return nonzero}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall183(which,varargs){SYSCALLS.varargs=varargs;try{var buf=SYSCALLS.get(),size=SYSCALLS.get();if(size===0)return-ERRNO_CODES.EINVAL;var cwd=FS.cwd();var cwdLengthInBytes=lengthBytesUTF8(cwd);if(size<cwdLengthInBytes+1)return-ERRNO_CODES.ERANGE;stringToUTF8(cwd,buf,size);return buf}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall195(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};function ___syscall20(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.pid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall220(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),dirp=SYSCALLS.get(),count=SYSCALLS.get();if(!stream.getdents){stream.getdents=FS.readdir(stream.path)}var pos=0;while(stream.getdents.length>0&&pos+268<=count){var id;var type;var name=stream.getdents.pop();if(name[0]==="."){id=1;type=4}else{var child=FS.lookupNode(stream.node,name);id=child.id;type=FS.isChrdev(child.mode)?2:FS.isDir(child.mode)?4:FS.isLink(child.mode)?10:8}HEAP32[dirp+pos>>2]=id;HEAP32[dirp+pos+4>>2]=stream.position;HEAP16[dirp+pos+8>>1]=268;HEAP8[dirp+pos+10>>0]=type;stringToUTF8(name,dirp+pos+11,256);pos+=268}return pos}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall221(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),cmd=SYSCALLS.get();switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-ERRNO_CODES.EINVAL}var newStream;newStream=FS.open(stream.path,stream.flags,0,arg);return newStream.fd}case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0}case 12:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0}case 13:case 14:return 0;case 16:case 8:return-ERRNO_CODES.EINVAL;case 9:___setErrNo(ERRNO_CODES.EINVAL);return-1;default:{return-ERRNO_CODES.EINVAL}}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall268(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),size=SYSCALLS.get(),buf=SYSCALLS.get();HEAP32[buf+4>>2]=4096;HEAP32[buf+40>>2]=4096;HEAP32[buf+8>>2]=1e6;HEAP32[buf+12>>2]=5e5;HEAP32[buf+16>>2]=5e5;HEAP32[buf+20>>2]=FS.nextInode;HEAP32[buf+24>>2]=1e6;HEAP32[buf+28>>2]=42;HEAP32[buf+44>>2]=2;HEAP32[buf+36>>2]=255;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall3(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.read(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall33(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),amode=SYSCALLS.get();return SYSCALLS.doAccess(path,amode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall38(which,varargs){SYSCALLS.varargs=varargs;try{var old_path=SYSCALLS.getStr(),new_path=SYSCALLS.getStr();FS.rename(old_path,new_path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall39(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),mode=SYSCALLS.get();return SYSCALLS.doMkdir(path,mode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall4(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.write(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall40(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.rmdir(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall5(which,varargs){SYSCALLS.varargs=varargs;try{var pathname=SYSCALLS.getStr(),flags=SYSCALLS.get(),mode=SYSCALLS.get();var stream=FS.open(pathname,flags,mode);return stream.fd}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21509:case 21505:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21510:case 21511:case 21512:case 21506:case 21507:case 21508:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21519:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0}case 21520:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return-ERRNO_CODES.EINVAL}case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)}case 21523:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21524:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___unlock(){}function _abort(){Module["abort"]()}function _emscripten_get_now(){abort()}function _emscripten_get_now_is_monotonic(){return 0||ENVIRONMENT_IS_NODE||typeof dateNow!=="undefined"||typeof performance==="object"&&performance&&typeof performance["now"]==="function"}function _clock_gettime(clk_id,tp){var now;if(clk_id===0){now=Date.now()}else if(clk_id===1&&_emscripten_get_now_is_monotonic()){now=_emscripten_get_now()}else{___setErrNo(22);return-1}HEAP32[tp>>2]=now/1e3|0;HEAP32[tp+4>>2]=now%1e3*1e3*1e3|0;return 0}function _dlopen(){abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/emscripten-core/emscripten/wiki/Linking")}function _dlclose(){return _dlopen.apply(null,arguments)}function _dlerror(){return _dlopen.apply(null,arguments)}function _dlsym(){return _dlopen.apply(null,arguments)}function _emscripten_set_main_loop_timing(mode,value){Browser.mainLoop.timingMode=mode;Browser.mainLoop.timingValue=value;if(!Browser.mainLoop.func){return 1}if(mode==0){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setTimeout(){var timeUntilNextTick=Math.max(0,Browser.mainLoop.tickStartTime+value-_emscripten_get_now())|0;setTimeout(Browser.mainLoop.runner,timeUntilNextTick)};Browser.mainLoop.method="timeout"}else if(mode==1){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_rAF(){Browser.requestAnimationFrame(Browser.mainLoop.runner)};Browser.mainLoop.method="rAF"}else if(mode==2){if(typeof setImmediate==="undefined"){var setImmediates=[];var emscriptenMainLoopMessageId="setimmediate";var Browser_setImmediate_messageHandler=function(event){if(event.data===emscriptenMainLoopMessageId||event.data.target===emscriptenMainLoopMessageId){event.stopPropagation();setImmediates.shift()()}};addEventListener("message",Browser_setImmediate_messageHandler,true);setImmediate=function Browser_emulated_setImmediate(func){setImmediates.push(func);if(ENVIRONMENT_IS_WORKER){if(Module["setImmediates"]===undefined)Module["setImmediates"]=[];Module["setImmediates"].push(func);postMessage({target:emscriptenMainLoopMessageId})}else postMessage(emscriptenMainLoopMessageId,"*")}}Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setImmediate(){setImmediate(Browser.mainLoop.runner)};Browser.mainLoop.method="immediate"}return 0}function _emscripten_set_main_loop(func,fps,simulateInfiniteLoop,arg,noSetTiming){Module["noExitRuntime"]=true;assert(!Browser.mainLoop.func,"emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");Browser.mainLoop.func=func;Browser.mainLoop.arg=arg;var browserIterationFunc;if(typeof arg!=="undefined"){browserIterationFunc=function(){Module["dynCall_vi"](func,arg)}}else{browserIterationFunc=function(){Module["dynCall_v"](func)}}var thisMainLoopId=Browser.mainLoop.currentlyRunningMainloop;Browser.mainLoop.runner=function Browser_mainLoop_runner(){if(ABORT)return;if(Browser.mainLoop.queue.length>0){var start=Date.now();var blocker=Browser.mainLoop.queue.shift();blocker.func(blocker.arg);if(Browser.mainLoop.remainingBlockers){var remaining=Browser.mainLoop.remainingBlockers;var next=remaining%1==0?remaining-1:Math.floor(remaining);if(blocker.counted){Browser.mainLoop.remainingBlockers=next}else{next=next+.5;Browser.mainLoop.remainingBlockers=(8*remaining+next)/9}}console.log('main loop blocker "'+blocker.name+'" took '+(Date.now()-start)+" ms");Browser.mainLoop.updateStatus();if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;setTimeout(Browser.mainLoop.runner,0);return}if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;Browser.mainLoop.currentFrameNumber=Browser.mainLoop.currentFrameNumber+1|0;if(Browser.mainLoop.timingMode==1&&Browser.mainLoop.timingValue>1&&Browser.mainLoop.currentFrameNumber%Browser.mainLoop.timingValue!=0){Browser.mainLoop.scheduler();return}else if(Browser.mainLoop.timingMode==0){Browser.mainLoop.tickStartTime=_emscripten_get_now()}if(Browser.mainLoop.method==="timeout"&&Module.ctx){err("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");Browser.mainLoop.method=""}Browser.mainLoop.runIter(browserIterationFunc);if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;if(typeof SDL==="object"&&SDL.audio&&SDL.audio.queueNewAudioData)SDL.audio.queueNewAudioData();Browser.mainLoop.scheduler()};if(!noSetTiming){if(fps&&fps>0)_emscripten_set_main_loop_timing(0,1e3/fps);else _emscripten_set_main_loop_timing(1,1);Browser.mainLoop.scheduler()}if(simulateInfiniteLoop){throw"SimulateInfiniteLoop"}}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function(){Browser.mainLoop.scheduler=null;Browser.mainLoop.currentlyRunningMainloop++},resume:function(){Browser.mainLoop.currentlyRunningMainloop++;var timingMode=Browser.mainLoop.timingMode;var timingValue=Browser.mainLoop.timingValue;var func=Browser.mainLoop.func;Browser.mainLoop.func=null;_emscripten_set_main_loop(func,0,false,Browser.mainLoop.arg,true);_emscripten_set_main_loop_timing(timingMode,timingValue);Browser.mainLoop.scheduler()},updateStatus:function(){if(Module["setStatus"]){var message=Module["statusMessage"]||"Please wait...";var remaining=Browser.mainLoop.remainingBlockers;var expected=Browser.mainLoop.expectedBlockers;if(remaining){if(remaining<expected){Module["setStatus"](message+" ("+(expected-remaining)+"/"+expected+")")}else{Module["setStatus"](message)}}else{Module["setStatus"]("")}}},runIter:function(func){if(ABORT)return;if(Module["preMainLoop"]){var preRet=Module["preMainLoop"]();if(preRet===false){return}}try{func()}catch(e){if(e instanceof ExitStatus){return}else{if(e&&typeof e==="object"&&e.stack)err("exception thrown: "+[e,e.stack]);throw e}}if(Module["postMainLoop"])Module["postMainLoop"]()}},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function(){if(!Module["preloadPlugins"])Module["preloadPlugins"]=[];if(Browser.initted)return;Browser.initted=true;try{new Blob;Browser.hasBlobConstructor=true}catch(e){Browser.hasBlobConstructor=false;console.log("warning: no blob constructor, cannot create blobs with mimetypes")}Browser.BlobBuilder=typeof MozBlobBuilder!="undefined"?MozBlobBuilder:typeof WebKitBlobBuilder!="undefined"?WebKitBlobBuilder:!Browser.hasBlobConstructor?console.log("warning: no BlobBuilder"):null;Browser.URLObject=typeof window!="undefined"?window.URL?window.URL:window.webkitURL:undefined;if(!Module.noImageDecoding&&typeof Browser.URLObject==="undefined"){console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");Module.noImageDecoding=true}var imagePlugin={};imagePlugin["canHandle"]=function imagePlugin_canHandle(name){return!Module.noImageDecoding&&/\.(jpg|jpeg|png|bmp)$/i.test(name)};imagePlugin["handle"]=function imagePlugin_handle(byteArray,name,onload,onerror){var b=null;if(Browser.hasBlobConstructor){try{b=new Blob([byteArray],{type:Browser.getMimetype(name)});if(b.size!==byteArray.length){b=new Blob([new Uint8Array(byteArray).buffer],{type:Browser.getMimetype(name)})}}catch(e){warnOnce("Blob constructor present but fails: "+e+"; falling back to blob builder")}}if(!b){var bb=new Browser.BlobBuilder;bb.append(new Uint8Array(byteArray).buffer);b=bb.getBlob()}var url=Browser.URLObject.createObjectURL(b);var img=new Image;img.onload=function img_onload(){assert(img.complete,"Image "+name+" could not be decoded");var canvas=document.createElement("canvas");canvas.width=img.width;canvas.height=img.height;var ctx=canvas.getContext("2d");ctx.drawImage(img,0,0);Module["preloadedImages"][name]=canvas;Browser.URLObject.revokeObjectURL(url);if(onload)onload(byteArray)};img.onerror=function img_onerror(event){console.log("Image "+url+" could not be decoded");if(onerror)onerror()};img.src=url};Module["preloadPlugins"].push(imagePlugin);var audioPlugin={};audioPlugin["canHandle"]=function audioPlugin_canHandle(name){return!Module.noAudioDecoding&&name.substr(-4)in{".ogg":1,".wav":1,".mp3":1}};audioPlugin["handle"]=function audioPlugin_handle(byteArray,name,onload,onerror){var done=false;function finish(audio){if(done)return;done=true;Module["preloadedAudios"][name]=audio;if(onload)onload(byteArray)}function fail(){if(done)return;done=true;Module["preloadedAudios"][name]=new Audio;if(onerror)onerror()}if(Browser.hasBlobConstructor){try{var b=new Blob([byteArray],{type:Browser.getMimetype(name)})}catch(e){return fail()}var url=Browser.URLObject.createObjectURL(b);var audio=new Audio;audio.addEventListener("canplaythrough",function(){finish(audio)},false);audio.onerror=function audio_onerror(event){if(done)return;console.log("warning: browser could not fully decode audio "+name+", trying slower base64 approach");function encode64(data){var BASE="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";var PAD="=";var ret="";var leftchar=0;var leftbits=0;for(var i=0;i<data.length;i++){leftchar=leftchar<<8|data[i];leftbits+=8;while(leftbits>=6){var curr=leftchar>>leftbits-6&63;leftbits-=6;ret+=BASE[curr]}}if(leftbits==2){ret+=BASE[(leftchar&3)<<4];ret+=PAD+PAD}else if(leftbits==4){ret+=BASE[(leftchar&15)<<2];ret+=PAD}return ret}audio.src="data:audio/x-"+name.substr(-3)+";base64,"+encode64(byteArray);finish(audio)};audio.src=url;Browser.safeSetTimeout(function(){finish(audio)},1e4)}else{return fail()}};Module["preloadPlugins"].push(audioPlugin);function pointerLockChange(){Browser.pointerLock=document["pointerLockElement"]===Module["canvas"]||document["mozPointerLockElement"]===Module["canvas"]||document["webkitPointerLockElement"]===Module["canvas"]||document["msPointerLockElement"]===Module["canvas"]}var canvas=Module["canvas"];if(canvas){canvas.requestPointerLock=canvas["requestPointerLock"]||canvas["mozRequestPointerLock"]||canvas["webkitRequestPointerLock"]||canvas["msRequestPointerLock"]||function(){};canvas.exitPointerLock=document["exitPointerLock"]||document["mozExitPointerLock"]||document["webkitExitPointerLock"]||document["msExitPointerLock"]||function(){};canvas.exitPointerLock=canvas.exitPointerLock.bind(document);document.addEventListener("pointerlockchange",pointerLockChange,false);document.addEventListener("mozpointerlockchange",pointerLockChange,false);document.addEventListener("webkitpointerlockchange",pointerLockChange,false);document.addEventListener("mspointerlockchange",pointerLockChange,false);if(Module["elementPointerLock"]){canvas.addEventListener("click",function(ev){if(!Browser.pointerLock&&Module["canvas"].requestPointerLock){Module["canvas"].requestPointerLock();ev.preventDefault()}},false)}}},createContext:function(canvas,useWebGL,setInModule,webGLContextAttributes){if(useWebGL&&Module.ctx&&canvas==Module.canvas)return Module.ctx;var ctx;var contextHandle;if(useWebGL){var contextAttributes={antialias:false,alpha:false,majorVersion:typeof WebGL2RenderingContext!=="undefined"?2:1};if(webGLContextAttributes){for(var attribute in webGLContextAttributes){contextAttributes[attribute]=webGLContextAttributes[attribute]}}if(typeof GL!=="undefined"){contextHandle=GL.createContext(canvas,contextAttributes);if(contextHandle){ctx=GL.getContext(contextHandle).GLctx}}}else{ctx=canvas.getContext("2d")}if(!ctx)return null;if(setInModule){if(!useWebGL)assert(typeof GLctx==="undefined","cannot set in module if GLctx is used, but we are a non-GL context that would replace it");Module.ctx=ctx;if(useWebGL)GL.makeContextCurrent(contextHandle);Module.useWebGL=useWebGL;Browser.moduleContextCreatedCallbacks.forEach(function(callback){callback()});Browser.init()}return ctx},destroyContext:function(canvas,useWebGL,setInModule){},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function(lockPointer,resizeCanvas,vrDevice){Browser.lockPointer=lockPointer;Browser.resizeCanvas=resizeCanvas;Browser.vrDevice=vrDevice;if(typeof Browser.lockPointer==="undefined")Browser.lockPointer=true;if(typeof Browser.resizeCanvas==="undefined")Browser.resizeCanvas=false;if(typeof Browser.vrDevice==="undefined")Browser.vrDevice=null;var canvas=Module["canvas"];function fullscreenChange(){Browser.isFullscreen=false;var canvasContainer=canvas.parentNode;if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvasContainer){canvas.exitFullscreen=Browser.exitFullscreen;if(Browser.lockPointer)canvas.requestPointerLock();Browser.isFullscreen=true;if(Browser.resizeCanvas){Browser.setFullscreenCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}else{canvasContainer.parentNode.insertBefore(canvas,canvasContainer);canvasContainer.parentNode.removeChild(canvasContainer);if(Browser.resizeCanvas){Browser.setWindowedCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}if(Module["onFullScreen"])Module["onFullScreen"](Browser.isFullscreen);if(Module["onFullscreen"])Module["onFullscreen"](Browser.isFullscreen)}if(!Browser.fullscreenHandlersInstalled){Browser.fullscreenHandlersInstalled=true;document.addEventListener("fullscreenchange",fullscreenChange,false);document.addEventListener("mozfullscreenchange",fullscreenChange,false);document.addEventListener("webkitfullscreenchange",fullscreenChange,false);document.addEventListener("MSFullscreenChange",fullscreenChange,false)}var canvasContainer=document.createElement("div");canvas.parentNode.insertBefore(canvasContainer,canvas);canvasContainer.appendChild(canvas);canvasContainer.requestFullscreen=canvasContainer["requestFullscreen"]||canvasContainer["mozRequestFullScreen"]||canvasContainer["msRequestFullscreen"]||(canvasContainer["webkitRequestFullscreen"]?function(){canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null)||(canvasContainer["webkitRequestFullScreen"]?function(){canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null);if(vrDevice){canvasContainer.requestFullscreen({vrDisplay:vrDevice})}else{canvasContainer.requestFullscreen()}},requestFullScreen:function(lockPointer,resizeCanvas,vrDevice){err("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.");Browser.requestFullScreen=function(lockPointer,resizeCanvas,vrDevice){return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)};return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)},exitFullscreen:function(){if(!Browser.isFullscreen){return false}var CFS=document["exitFullscreen"]||document["cancelFullScreen"]||document["mozCancelFullScreen"]||document["msExitFullscreen"]||document["webkitCancelFullScreen"]||function(){};CFS.apply(document,[]);return true},nextRAF:0,fakeRequestAnimationFrame:function(func){var now=Date.now();if(Browser.nextRAF===0){Browser.nextRAF=now+1e3/60}else{while(now+2>=Browser.nextRAF){Browser.nextRAF+=1e3/60}}var delay=Math.max(Browser.nextRAF-now,0);setTimeout(func,delay)},requestAnimationFrame:function requestAnimationFrame(func){if(typeof window==="undefined"){Browser.fakeRequestAnimationFrame(func)}else{if(!window.requestAnimationFrame){window.requestAnimationFrame=window["requestAnimationFrame"]||window["mozRequestAnimationFrame"]||window["webkitRequestAnimationFrame"]||window["msRequestAnimationFrame"]||window["oRequestAnimationFrame"]||Browser.fakeRequestAnimationFrame}window.requestAnimationFrame(func)}},safeCallback:function(func){return function(){if(!ABORT)return func.apply(null,arguments)}},allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function(){Browser.allowAsyncCallbacks=false},resumeAsyncCallbacks:function(){Browser.allowAsyncCallbacks=true;if(Browser.queuedAsyncCallbacks.length>0){var callbacks=Browser.queuedAsyncCallbacks;Browser.queuedAsyncCallbacks=[];callbacks.forEach(function(func){func()})}},safeRequestAnimationFrame:function(func){return Browser.requestAnimationFrame(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}})},safeSetTimeout:function(func,timeout){Module["noExitRuntime"]=true;return setTimeout(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}},timeout)},safeSetInterval:function(func,timeout){Module["noExitRuntime"]=true;return setInterval(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}},timeout)},getMimetype:function(name){return{"jpg":"image/jpeg","jpeg":"image/jpeg","png":"image/png","bmp":"image/bmp","ogg":"audio/ogg","wav":"audio/wav","mp3":"audio/mpeg"}[name.substr(name.lastIndexOf(".")+1)]},getUserMedia:function(func){if(!window.getUserMedia){window.getUserMedia=navigator["getUserMedia"]||navigator["mozGetUserMedia"]}window.getUserMedia(func)},getMovementX:function(event){return event["movementX"]||event["mozMovementX"]||event["webkitMovementX"]||0},getMovementY:function(event){return event["movementY"]||event["mozMovementY"]||event["webkitMovementY"]||0},getMouseWheelDelta:function(event){var delta=0;switch(event.type){case"DOMMouseScroll":delta=event.detail/3;break;case"mousewheel":delta=event.wheelDelta/120;break;case"wheel":delta=event.deltaY;switch(event.deltaMode){case 0:delta/=100;break;case 1:delta/=3;break;case 2:delta*=80;break;default:throw"unrecognized mouse wheel delta mode: "+event.deltaMode}break;default:throw"unrecognized mouse wheel event: "+event.type}return delta},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function(event){if(Browser.pointerLock){if(event.type!="mousemove"&&"mozMovementX"in event){Browser.mouseMovementX=Browser.mouseMovementY=0}else{Browser.mouseMovementX=Browser.getMovementX(event);Browser.mouseMovementY=Browser.getMovementY(event)}if(typeof SDL!="undefined"){Browser.mouseX=SDL.mouseX+Browser.mouseMovementX;Browser.mouseY=SDL.mouseY+Browser.mouseMovementY}else{Browser.mouseX+=Browser.mouseMovementX;Browser.mouseY+=Browser.mouseMovementY}}else{var rect=Module["canvas"].getBoundingClientRect();var cw=Module["canvas"].width;var ch=Module["canvas"].height;var scrollX=typeof window.scrollX!=="undefined"?window.scrollX:window.pageXOffset;var scrollY=typeof window.scrollY!=="undefined"?window.scrollY:window.pageYOffset;if(event.type==="touchstart"||event.type==="touchend"||event.type==="touchmove"){var touch=event.touch;if(touch===undefined){return}var adjustedX=touch.pageX-(scrollX+rect.left);var adjustedY=touch.pageY-(scrollY+rect.top);adjustedX=adjustedX*(cw/rect.width);adjustedY=adjustedY*(ch/rect.height);var coords={x:adjustedX,y:adjustedY};if(event.type==="touchstart"){Browser.lastTouches[touch.identifier]=coords;Browser.touches[touch.identifier]=coords}else if(event.type==="touchend"||event.type==="touchmove"){var last=Browser.touches[touch.identifier];if(!last)last=coords;Browser.lastTouches[touch.identifier]=last;Browser.touches[touch.identifier]=coords}return}var x=event.pageX-(scrollX+rect.left);var y=event.pageY-(scrollY+rect.top);x=x*(cw/rect.width);y=y*(ch/rect.height);Browser.mouseMovementX=x-Browser.mouseX;Browser.mouseMovementY=y-Browser.mouseY;Browser.mouseX=x;Browser.mouseY=y}},asyncLoad:function(url,onload,onerror,noRunDep){var dep=!noRunDep?getUniqueRunDependency("al "+url):"";Module["readAsync"](url,function(arrayBuffer){assert(arrayBuffer,'Loading data file "'+url+'" failed (no arrayBuffer).');onload(new Uint8Array(arrayBuffer));if(dep)removeRunDependency(dep)},function(event){if(onerror){onerror()}else{throw'Loading data file "'+url+'" failed.'}});if(dep)addRunDependency(dep)},resizeListeners:[],updateResizeListeners:function(){var canvas=Module["canvas"];Browser.resizeListeners.forEach(function(listener){listener(canvas.width,canvas.height)})},setCanvasSize:function(width,height,noUpdates){var canvas=Module["canvas"];Browser.updateCanvasDimensions(canvas,width,height);if(!noUpdates)Browser.updateResizeListeners()},windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags|8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},setWindowedCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags&~8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},updateCanvasDimensions:function(canvas,wNative,hNative){if(wNative&&hNative){canvas.widthNative=wNative;canvas.heightNative=hNative}else{wNative=canvas.widthNative;hNative=canvas.heightNative}var w=wNative;var h=hNative;if(Module["forcedAspectRatio"]&&Module["forcedAspectRatio"]>0){if(w/h<Module["forcedAspectRatio"]){w=Math.round(h*Module["forcedAspectRatio"])}else{h=Math.round(w/Module["forcedAspectRatio"])}}if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvas.parentNode&&typeof screen!="undefined"){var factor=Math.min(screen.width/w,screen.height/h);w=Math.round(w*factor);h=Math.round(h*factor)}if(Browser.resizeCanvas){if(canvas.width!=w)canvas.width=w;if(canvas.height!=h)canvas.height=h;if(typeof canvas.style!="undefined"){canvas.style.removeProperty("width");canvas.style.removeProperty("height")}}else{if(canvas.width!=wNative)canvas.width=wNative;if(canvas.height!=hNative)canvas.height=hNative;if(typeof canvas.style!="undefined"){if(w!=wNative||h!=hNative){canvas.style.setProperty("width",w+"px","important");canvas.style.setProperty("height",h+"px","important")}else{canvas.style.removeProperty("width");canvas.style.removeProperty("height")}}}},wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function(){var handle=Browser.nextWgetRequestHandle;Browser.nextWgetRequestHandle++;return handle}};var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,contextAttributes:{alpha:false,depth:false,stencil:false,antialias:false},stringCache:{},setErrorCode:function(code){EGL.errorCode=code},chooseConfig:function(display,attribList,config,config_size,numConfigs){if(display!=62e3){EGL.setErrorCode(12296);return 0}if(attribList){for(;;){var param=HEAP32[attribList>>2];if(param==12321){var alphaSize=HEAP32[attribList+4>>2];EGL.contextAttributes.alpha=alphaSize>0}else if(param==12325){var depthSize=HEAP32[attribList+4>>2];EGL.contextAttributes.depth=depthSize>0}else if(param==12326){var stencilSize=HEAP32[attribList+4>>2];EGL.contextAttributes.stencil=stencilSize>0}else if(param==12337){var samples=HEAP32[attribList+4>>2];EGL.contextAttributes.antialias=samples>0}else if(param==12338){var samples=HEAP32[attribList+4>>2];EGL.contextAttributes.antialias=samples==1}else if(param==12544){var requestedPriority=HEAP32[attribList+4>>2];EGL.contextAttributes.lowLatency=requestedPriority!=12547}else if(param==12344){break}attribList+=8}}if((!config||!config_size)&&!numConfigs){EGL.setErrorCode(12300);return 0}if(numConfigs){HEAP32[numConfigs>>2]=1}if(config&&config_size>0){HEAP32[config>>2]=62002}EGL.setErrorCode(12288);return 1}};function _eglGetProcAddress(name_){return _emscripten_GetProcAddress(name_)}var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,removeAllEventListeners:function(){for(var i=JSEvents.eventHandlers.length-1;i>=0;--i){JSEvents._removeHandler(i)}JSEvents.eventHandlers=[];JSEvents.deferredCalls=[]},registerRemoveEventListeners:function(){if(!JSEvents.removeEventListenersRegistered){__ATEXIT__.push(JSEvents.removeAllEventListeners);JSEvents.removeEventListenersRegistered=true}},deferredCalls:[],deferCall:function(targetFunction,precedence,argsList){function arraysHaveEqualContent(arrA,arrB){if(arrA.length!=arrB.length)return false;for(var i in arrA){if(arrA[i]!=arrB[i])return false}return true}for(var i in JSEvents.deferredCalls){var call=JSEvents.deferredCalls[i];if(call.targetFunction==targetFunction&&arraysHaveEqualContent(call.argsList,argsList)){return}}JSEvents.deferredCalls.push({targetFunction:targetFunction,precedence:precedence,argsList:argsList});JSEvents.deferredCalls.sort(function(x,y){return x.precedence<y.precedence})},removeDeferredCalls:function(targetFunction){for(var i=0;i<JSEvents.deferredCalls.length;++i){if(JSEvents.deferredCalls[i].targetFunction==targetFunction){JSEvents.deferredCalls.splice(i,1);--i}}},canPerformEventHandlerRequests:function(){return JSEvents.inEventHandler&&JSEvents.currentEventHandler.allowsDeferredCalls},runDeferredCalls:function(){if(!JSEvents.canPerformEventHandlerRequests()){return}for(var i=0;i<JSEvents.deferredCalls.length;++i){var call=JSEvents.deferredCalls[i];JSEvents.deferredCalls.splice(i,1);--i;call.targetFunction.apply(this,call.argsList)}},inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function(){return navigator.userAgent.indexOf("MSIE")!==-1||navigator.appVersion.indexOf("Trident/")>0},removeAllHandlersOnTarget:function(target,eventTypeString){for(var i=0;i<JSEvents.eventHandlers.length;++i){if(JSEvents.eventHandlers[i].target==target&&(!eventTypeString||eventTypeString==JSEvents.eventHandlers[i].eventTypeString)){JSEvents._removeHandler(i--)}}},_removeHandler:function(i){var h=JSEvents.eventHandlers[i];h.target.removeEventListener(h.eventTypeString,h.eventListenerFunc,h.useCapture);JSEvents.eventHandlers.splice(i,1)},registerOrRemoveHandler:function(eventHandler){var jsEventHandler=function jsEventHandler(event){++JSEvents.inEventHandler;JSEvents.currentEventHandler=eventHandler;JSEvents.runDeferredCalls();eventHandler.handlerFunc(event);JSEvents.runDeferredCalls();--JSEvents.inEventHandler};if(eventHandler.callbackfunc){eventHandler.eventListenerFunc=jsEventHandler;eventHandler.target.addEventListener(eventHandler.eventTypeString,jsEventHandler,eventHandler.useCapture);JSEvents.eventHandlers.push(eventHandler);JSEvents.registerRemoveEventListeners()}else{for(var i=0;i<JSEvents.eventHandlers.length;++i){if(JSEvents.eventHandlers[i].target==eventHandler.target&&JSEvents.eventHandlers[i].eventTypeString==eventHandler.eventTypeString){JSEvents._removeHandler(i--)}}}},getBoundingClientRectOrZeros:function(target){return target.getBoundingClientRect?target.getBoundingClientRect():{left:0,top:0}},pageScrollPos:function(){if(window.pageXOffset>0||window.pageYOffset>0){return[window.pageXOffset,window.pageYOffset]}if(typeof document.documentElement.scrollLeft!=="undefined"||typeof document.documentElement.scrollTop!=="undefined"){return[document.documentElement.scrollLeft,document.documentElement.scrollTop]}return[document.body.scrollLeft|0,document.body.scrollTop|0]},getNodeNameForTarget:function(target){if(!target)return"";if(target==window)return"#window";if(target==screen)return"#screen";return target&&target.nodeName?target.nodeName:""},tick:function(){if(window["performance"]&&window["performance"]["now"])return window["performance"]["now"]();else return Date.now()},fullscreenEnabled:function(){return document.fullscreenEnabled||document.mozFullScreenEnabled||document.webkitFullscreenEnabled||document.msFullscreenEnabled}};function __setLetterbox(element,topBottom,leftRight){if(JSEvents.isInternetExplorer()){element.style.marginLeft=element.style.marginRight=leftRight+"px";element.style.marginTop=element.style.marginBottom=topBottom+"px"}else{element.style.paddingLeft=element.style.paddingRight=leftRight+"px";element.style.paddingTop=element.style.paddingBottom=topBottom+"px"}}function __hideEverythingExceptGivenElement(onlyVisibleElement){var child=onlyVisibleElement;var parent=child.parentNode;var hiddenElements=[];while(child!=document.body){var children=parent.children;for(var i=0;i<children.length;++i){if(children[i]!=child){hiddenElements.push({node:children[i],displayState:children[i].style.display});children[i].style.display="none"}}child=parent;parent=parent.parentNode}return hiddenElements}var __restoreOldWindowedStyle=null;var __specialEventTargets=[0,typeof document!=="undefined"?document:0,typeof window!=="undefined"?window:0];function __findEventTarget(target){try{if(!target)return window;if(typeof target==="number")target=__specialEventTargets[target]||UTF8ToString(target);if(target==="#window")return window;else if(target==="#document")return document;else if(target==="#screen")return screen;else if(target==="#canvas")return Module["canvas"];return typeof target==="string"?document.getElementById(target):target}catch(e){return null}}function __findCanvasEventTarget(target){if(typeof target==="number")target=UTF8ToString(target);if(!target||target==="#canvas"){if(typeof GL!=="undefined"&&GL.offscreenCanvases["canvas"])return GL.offscreenCanvases["canvas"];return Module["canvas"]}if(typeof GL!=="undefined"&&GL.offscreenCanvases[target])return GL.offscreenCanvases[target];return __findEventTarget(target)}function _emscripten_get_canvas_element_size(target,width,height){var canvas=__findCanvasEventTarget(target);if(!canvas)return-4;HEAP32[width>>2]=canvas.width;HEAP32[height>>2]=canvas.height}function __get_canvas_element_size(target){var stackTop=stackSave();var w=stackAlloc(8);var h=w+4;var targetInt=stackAlloc(target.id.length+1);stringToUTF8(target.id,targetInt,target.id.length+1);var ret=_emscripten_get_canvas_element_size(targetInt,w,h);var size=[HEAP32[w>>2],HEAP32[h>>2]];stackRestore(stackTop);return size}function _emscripten_set_canvas_element_size(target,width,height){var canvas=__findCanvasEventTarget(target);if(!canvas)return-4;canvas.width=width;canvas.height=height;return 0}function __set_canvas_element_size(target,width,height){if(!target.controlTransferredOffscreen){target.width=width;target.height=height}else{var stackTop=stackSave();var targetInt=stackAlloc(target.id.length+1);stringToUTF8(target.id,targetInt,target.id.length+1);_emscripten_set_canvas_element_size(targetInt,width,height);stackRestore(stackTop)}}function __registerRestoreOldStyle(canvas){var canvasSize=__get_canvas_element_size(canvas);var oldWidth=canvasSize[0];var oldHeight=canvasSize[1];var oldCssWidth=canvas.style.width;var oldCssHeight=canvas.style.height;var oldBackgroundColor=canvas.style.backgroundColor;var oldDocumentBackgroundColor=document.body.style.backgroundColor;var oldPaddingLeft=canvas.style.paddingLeft;var oldPaddingRight=canvas.style.paddingRight;var oldPaddingTop=canvas.style.paddingTop;var oldPaddingBottom=canvas.style.paddingBottom;var oldMarginLeft=canvas.style.marginLeft;var oldMarginRight=canvas.style.marginRight;var oldMarginTop=canvas.style.marginTop;var oldMarginBottom=canvas.style.marginBottom;var oldDocumentBodyMargin=document.body.style.margin;var oldDocumentOverflow=document.documentElement.style.overflow;var oldDocumentScroll=document.body.scroll;var oldImageRendering=canvas.style.imageRendering;function restoreOldStyle(){var fullscreenElement=document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement;if(!fullscreenElement){document.removeEventListener("fullscreenchange",restoreOldStyle);document.removeEventListener("mozfullscreenchange",restoreOldStyle);document.removeEventListener("webkitfullscreenchange",restoreOldStyle);document.removeEventListener("MSFullscreenChange",restoreOldStyle);__set_canvas_element_size(canvas,oldWidth,oldHeight);canvas.style.width=oldCssWidth;canvas.style.height=oldCssHeight;canvas.style.backgroundColor=oldBackgroundColor;if(!oldDocumentBackgroundColor)document.body.style.backgroundColor="white";document.body.style.backgroundColor=oldDocumentBackgroundColor;canvas.style.paddingLeft=oldPaddingLeft;canvas.style.paddingRight=oldPaddingRight;canvas.style.paddingTop=oldPaddingTop;canvas.style.paddingBottom=oldPaddingBottom;canvas.style.marginLeft=oldMarginLeft;canvas.style.marginRight=oldMarginRight;canvas.style.marginTop=oldMarginTop;canvas.style.marginBottom=oldMarginBottom;document.body.style.margin=oldDocumentBodyMargin;document.documentElement.style.overflow=oldDocumentOverflow;document.body.scroll=oldDocumentScroll;canvas.style.imageRendering=oldImageRendering;if(canvas.GLctxObject)canvas.GLctxObject.GLctx.viewport(0,0,oldWidth,oldHeight);if(__currentFullscreenStrategy.canvasResizedCallback){dynCall_iiii(__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData)}}}document.addEventListener("fullscreenchange",restoreOldStyle);document.addEventListener("mozfullscreenchange",restoreOldStyle);document.addEventListener("webkitfullscreenchange",restoreOldStyle);document.addEventListener("MSFullscreenChange",restoreOldStyle);return restoreOldStyle}function __restoreHiddenElements(hiddenElements){for(var i=0;i<hiddenElements.length;++i){hiddenElements[i].node.style.display=hiddenElements[i].displayState}}var __currentFullscreenStrategy={};function __softFullscreenResizeWebGLRenderTarget(){var inHiDPIFullscreenMode=__currentFullscreenStrategy.canvasResolutionScaleMode==2;var inAspectRatioFixedFullscreenMode=__currentFullscreenStrategy.scaleMode==2;var inPixelPerfectFullscreenMode=__currentFullscreenStrategy.canvasResolutionScaleMode!=0;var inCenteredWithoutScalingFullscreenMode=__currentFullscreenStrategy.scaleMode==3;var screenWidth=inHiDPIFullscreenMode?Math.round(window.innerWidth*window.devicePixelRatio):window.innerWidth;var screenHeight=inHiDPIFullscreenMode?Math.round(window.innerHeight*window.devicePixelRatio):window.innerHeight;var w=screenWidth;var h=screenHeight;var canvas=__currentFullscreenStrategy.target;var canvasSize=__get_canvas_element_size(canvas);var x=canvasSize[0];var y=canvasSize[1];var topMargin;if(inAspectRatioFixedFullscreenMode){if(w*y<x*h)h=w*y/x|0;else if(w*y>x*h)w=h*x/y|0;topMargin=(screenHeight-h)/2|0}if(inPixelPerfectFullscreenMode){__set_canvas_element_size(canvas,w,h);if(canvas.GLctxObject)canvas.GLctxObject.GLctx.viewport(0,0,w,h)}if(inHiDPIFullscreenMode){topMargin/=window.devicePixelRatio;w/=window.devicePixelRatio;h/=window.devicePixelRatio;w=Math.round(w*1e4)/1e4;h=Math.round(h*1e4)/1e4;topMargin=Math.round(topMargin*1e4)/1e4}if(inCenteredWithoutScalingFullscreenMode){var t=(window.innerHeight-parseInt(canvas.style.height))/2;var b=(window.innerWidth-parseInt(canvas.style.width))/2;__setLetterbox(canvas,t,b)}else{canvas.style.width=w+"px";canvas.style.height=h+"px";var b=(window.innerWidth-w)/2;__setLetterbox(canvas,topMargin,b)}if(!inCenteredWithoutScalingFullscreenMode&&__currentFullscreenStrategy.canvasResizedCallback){dynCall_iiii(__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData)}}function _JSEvents_resizeCanvasForFullscreen(target,strategy){var restoreOldStyle=__registerRestoreOldStyle(target);var cssWidth=strategy.softFullscreen?window.innerWidth:screen.width;var cssHeight=strategy.softFullscreen?window.innerHeight:screen.height;var rect=target.getBoundingClientRect();var windowedCssWidth=rect.right-rect.left;var windowedCssHeight=rect.bottom-rect.top;var canvasSize=__get_canvas_element_size(target);var windowedRttWidth=canvasSize[0];var windowedRttHeight=canvasSize[1];if(strategy.scaleMode==3){__setLetterbox(target,(cssHeight-windowedCssHeight)/2,(cssWidth-windowedCssWidth)/2);cssWidth=windowedCssWidth;cssHeight=windowedCssHeight}else if(strategy.scaleMode==2){if(cssWidth*windowedRttHeight<windowedRttWidth*cssHeight){var desiredCssHeight=windowedRttHeight*cssWidth/windowedRttWidth;__setLetterbox(target,(cssHeight-desiredCssHeight)/2,0);cssHeight=desiredCssHeight}else{var desiredCssWidth=windowedRttWidth*cssHeight/windowedRttHeight;__setLetterbox(target,0,(cssWidth-desiredCssWidth)/2);cssWidth=desiredCssWidth}}if(!target.style.backgroundColor)target.style.backgroundColor="black";if(!document.body.style.backgroundColor)document.body.style.backgroundColor="black";target.style.width=cssWidth+"px";target.style.height=cssHeight+"px";if(strategy.filteringMode==1){target.style.imageRendering="optimizeSpeed";target.style.imageRendering="-moz-crisp-edges";target.style.imageRendering="-o-crisp-edges";target.style.imageRendering="-webkit-optimize-contrast";target.style.imageRendering="optimize-contrast";target.style.imageRendering="crisp-edges";target.style.imageRendering="pixelated"}var dpiScale=strategy.canvasResolutionScaleMode==2?window.devicePixelRatio:1;if(strategy.canvasResolutionScaleMode!=0){var newWidth=cssWidth*dpiScale|0;var newHeight=cssHeight*dpiScale|0;__set_canvas_element_size(target,newWidth,newHeight);if(target.GLctxObject)target.GLctxObject.GLctx.viewport(0,0,newWidth,newHeight)}return restoreOldStyle}function _emscripten_enter_soft_fullscreen(target,fullscreenStrategy){if(!target)target="#canvas";target=__findEventTarget(target);if(!target)return-4;var strategy={};strategy.scaleMode=HEAP32[fullscreenStrategy>>2];strategy.canvasResolutionScaleMode=HEAP32[fullscreenStrategy+4>>2];strategy.filteringMode=HEAP32[fullscreenStrategy+8>>2];strategy.canvasResizedCallback=HEAP32[fullscreenStrategy+12>>2];strategy.canvasResizedCallbackUserData=HEAP32[fullscreenStrategy+16>>2];strategy.target=target;strategy.softFullscreen=true;var restoreOldStyle=_JSEvents_resizeCanvasForFullscreen(target,strategy);document.documentElement.style.overflow="hidden";document.body.scroll="no";document.body.style.margin="0px";var hiddenElements=__hideEverythingExceptGivenElement(target);function restoreWindowedState(){restoreOldStyle();__restoreHiddenElements(hiddenElements);window.removeEventListener("resize",__softFullscreenResizeWebGLRenderTarget);if(strategy.canvasResizedCallback){dynCall_iiii(strategy.canvasResizedCallback,37,0,strategy.canvasResizedCallbackUserData)}__currentFullscreenStrategy=0}__restoreOldWindowedStyle=restoreWindowedState;__currentFullscreenStrategy=strategy;window.addEventListener("resize",__softFullscreenResizeWebGLRenderTarget);if(strategy.canvasResizedCallback){dynCall_iiii(strategy.canvasResizedCallback,37,0,strategy.canvasResizedCallbackUserData)}return 0}function _JSEvents_requestFullscreen(target,strategy){if(strategy.scaleMode!=0||strategy.canvasResolutionScaleMode!=0){_JSEvents_resizeCanvasForFullscreen(target,strategy)}if(target.requestFullscreen){target.requestFullscreen()}else if(target.msRequestFullscreen){target.msRequestFullscreen()}else if(target.mozRequestFullScreen){target.mozRequestFullScreen()}else if(target.mozRequestFullscreen){target.mozRequestFullscreen()}else if(target.webkitRequestFullscreen){target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT)}else{if(typeof JSEvents.fullscreenEnabled()==="undefined"){return-1}else{return-3}}if(strategy.canvasResizedCallback){dynCall_iiii(strategy.canvasResizedCallback,37,0,strategy.canvasResizedCallbackUserData)}return 0}function _emscripten_exit_fullscreen(){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;JSEvents.removeDeferredCalls(_JSEvents_requestFullscreen);var d=__specialEventTargets[1];if(d.exitFullscreen){d.fullscreenElement&&d.exitFullscreen()}else if(d.msExitFullscreen){d.msFullscreenElement&&d.msExitFullscreen()}else if(d.mozCancelFullScreen){d.mozFullScreenElement&&d.mozCancelFullScreen()}else if(d.webkitExitFullscreen){d.webkitFullscreenElement&&d.webkitExitFullscreen()}else{return-1}if(__currentFullscreenStrategy.canvasResizedCallback){dynCall_iiii(__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData);__currentFullscreenStrategy=0}return 0}function __requestPointerLock(target){if(target.requestPointerLock){target.requestPointerLock()}else if(target.mozRequestPointerLock){target.mozRequestPointerLock()}else if(target.webkitRequestPointerLock){target.webkitRequestPointerLock()}else if(target.msRequestPointerLock){target.msRequestPointerLock()}else{if(document.body.requestPointerLock||document.body.mozRequestPointerLock||document.body.webkitRequestPointerLock||document.body.msRequestPointerLock){return-3}else{return-1}}return 0}function _emscripten_exit_pointerlock(){JSEvents.removeDeferredCalls(__requestPointerLock);if(document.exitPointerLock){document.exitPointerLock()}else if(document.msExitPointerLock){document.msExitPointerLock()}else if(document.mozExitPointerLock){document.mozExitPointerLock()}else if(document.webkitExitPointerLock){document.webkitExitPointerLock()}else{return-1}return 0}function _emscripten_exit_soft_fullscreen(){if(__restoreOldWindowedStyle)__restoreOldWindowedStyle();__restoreOldWindowedStyle=null;return 0}function __fillFullscreenChangeEventData(eventStruct,e){var fullscreenElement=document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement;var isFullscreen=!!fullscreenElement;HEAP32[eventStruct>>2]=isFullscreen;HEAP32[eventStruct+4>>2]=JSEvents.fullscreenEnabled();var reportedElement=isFullscreen?fullscreenElement:JSEvents.previousFullscreenElement;var nodeName=JSEvents.getNodeNameForTarget(reportedElement);var id=reportedElement&&reportedElement.id?reportedElement.id:"";stringToUTF8(nodeName,eventStruct+8,128);stringToUTF8(id,eventStruct+136,128);HEAP32[eventStruct+264>>2]=reportedElement?reportedElement.clientWidth:0;HEAP32[eventStruct+268>>2]=reportedElement?reportedElement.clientHeight:0;HEAP32[eventStruct+272>>2]=screen.width;HEAP32[eventStruct+276>>2]=screen.height;if(isFullscreen){JSEvents.previousFullscreenElement=fullscreenElement}}function _emscripten_get_fullscreen_status(fullscreenStatus){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;__fillFullscreenChangeEventData(fullscreenStatus);return 0}function __fillGamepadEventData(eventStruct,e){HEAPF64[eventStruct>>3]=e.timestamp;for(var i=0;i<e.axes.length;++i){HEAPF64[eventStruct+i*8+16>>3]=e.axes[i]}for(var i=0;i<e.buttons.length;++i){if(typeof e.buttons[i]==="object"){HEAPF64[eventStruct+i*8+528>>3]=e.buttons[i].value}else{HEAPF64[eventStruct+i*8+528>>3]=e.buttons[i]}}for(var i=0;i<e.buttons.length;++i){if(typeof e.buttons[i]==="object"){HEAP32[eventStruct+i*4+1040>>2]=e.buttons[i].pressed}else{HEAP32[eventStruct+i*4+1040>>2]=e.buttons[i]==1}}HEAP32[eventStruct+1296>>2]=e.connected;HEAP32[eventStruct+1300>>2]=e.index;HEAP32[eventStruct+8>>2]=e.axes.length;HEAP32[eventStruct+12>>2]=e.buttons.length;stringToUTF8(e.id,eventStruct+1304,64);stringToUTF8(e.mapping,eventStruct+1368,64)}function _emscripten_get_gamepad_status(index,gamepadState){if(index<0||index>=JSEvents.lastGamepadState.length)return-5;if(!JSEvents.lastGamepadState[index])return-7;__fillGamepadEventData(gamepadState,JSEvents.lastGamepadState[index]);return 0}function _emscripten_get_heap_size(){return HEAP8.length}function _emscripten_get_num_gamepads(){return JSEvents.lastGamepadState.length}function __fillPointerlockChangeEventData(eventStruct,e){var pointerLockElement=document.pointerLockElement||document.mozPointerLockElement||document.webkitPointerLockElement||document.msPointerLockElement;var isPointerlocked=!!pointerLockElement;HEAP32[eventStruct>>2]=isPointerlocked;var nodeName=JSEvents.getNodeNameForTarget(pointerLockElement);var id=pointerLockElement&&pointerLockElement.id?pointerLockElement.id:"";stringToUTF8(nodeName,eventStruct+4,128);stringToUTF8(id,eventStruct+132,128)}function _emscripten_get_pointerlock_status(pointerlockStatus){if(pointerlockStatus)__fillPointerlockChangeEventData(pointerlockStatus);if(!document.body||!document.body.requestPointerLock&&!document.body.mozRequestPointerLock&&!document.body.webkitRequestPointerLock&&!document.body.msRequestPointerLock){return-1}return 0}var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:{},currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],queries:[],samplers:[],transformFeedbacks:[],syncs:[],programInfos:{},stringCache:{},stringiCache:{},unpackAlignment:4,init:function(){GL.miniTempBuffer=new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);for(var i=0;i<GL.MINI_TEMP_BUFFER_SIZE;i++){GL.miniTempBufferViews[i]=GL.miniTempBuffer.subarray(0,i+1)}},recordError:function recordError(errorCode){if(!GL.lastError){GL.lastError=errorCode}},getNewId:function(table){var ret=GL.counter++;for(var i=table.length;i<ret;i++){table[i]=null}return ret},MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function(shader,count,string,length){var source="";for(var i=0;i<count;++i){var len=length?HEAP32[length+i*4>>2]:-1;source+=UTF8ToString(HEAP32[string+i*4>>2],len<0?undefined:len)}return source},createContext:function(canvas,webGLContextAttributes){var ctx=webGLContextAttributes.majorVersion>1?canvas.getContext("webgl2",webGLContextAttributes):canvas.getContext("webgl",webGLContextAttributes)||canvas.getContext("experimental-webgl",webGLContextAttributes);return ctx&&GL.registerContext(ctx,webGLContextAttributes)},registerContext:function(ctx,webGLContextAttributes){var handle=_malloc(8);var context={handle:handle,attributes:webGLContextAttributes,version:webGLContextAttributes.majorVersion,GLctx:ctx};function getChromeVersion(){var raw=navigator.userAgent.match(/Chrom(e|ium)\/([0-9]+)\./);return raw?parseInt(raw[2],10):false}context.supportsWebGL2EntryPoints=context.version>=2&&(getChromeVersion()===false||getChromeVersion()>=58);if(ctx.canvas)ctx.canvas.GLctxObject=context;GL.contexts[handle]=context;if(typeof webGLContextAttributes.enableExtensionsByDefault==="undefined"||webGLContextAttributes.enableExtensionsByDefault){GL.initExtensions(context)}return handle},makeContextCurrent:function(contextHandle){GL.currentContext=GL.contexts[contextHandle];Module.ctx=GLctx=GL.currentContext&&GL.currentContext.GLctx;return!(contextHandle&&!GLctx)},getContext:function(contextHandle){return GL.contexts[contextHandle]},deleteContext:function(contextHandle){if(GL.currentContext===GL.contexts[contextHandle])GL.currentContext=null;if(typeof JSEvents==="object")JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);if(GL.contexts[contextHandle]&&GL.contexts[contextHandle].GLctx.canvas)GL.contexts[contextHandle].GLctx.canvas.GLctxObject=undefined;_free(GL.contexts[contextHandle]);GL.contexts[contextHandle]=null},initExtensions:function(context){if(!context)context=GL.currentContext;if(context.initExtensionsDone)return;context.initExtensionsDone=true;var GLctx=context.GLctx;if(context.version<2){var instancedArraysExt=GLctx.getExtension("ANGLE_instanced_arrays");if(instancedArraysExt){GLctx["vertexAttribDivisor"]=function(index,divisor){instancedArraysExt["vertexAttribDivisorANGLE"](index,divisor)};GLctx["drawArraysInstanced"]=function(mode,first,count,primcount){instancedArraysExt["drawArraysInstancedANGLE"](mode,first,count,primcount)};GLctx["drawElementsInstanced"]=function(mode,count,type,indices,primcount){instancedArraysExt["drawElementsInstancedANGLE"](mode,count,type,indices,primcount)}}var vaoExt=GLctx.getExtension("OES_vertex_array_object");if(vaoExt){GLctx["createVertexArray"]=function(){return vaoExt["createVertexArrayOES"]()};GLctx["deleteVertexArray"]=function(vao){vaoExt["deleteVertexArrayOES"](vao)};GLctx["bindVertexArray"]=function(vao){vaoExt["bindVertexArrayOES"](vao)};GLctx["isVertexArray"]=function(vao){return vaoExt["isVertexArrayOES"](vao)}}var drawBuffersExt=GLctx.getExtension("WEBGL_draw_buffers");if(drawBuffersExt){GLctx["drawBuffers"]=function(n,bufs){drawBuffersExt["drawBuffersWEBGL"](n,bufs)}}}GLctx.disjointTimerQueryExt=GLctx.getExtension("EXT_disjoint_timer_query");var automaticallyEnabledExtensions=["OES_texture_float","OES_texture_half_float","OES_standard_derivatives","OES_vertex_array_object","WEBGL_compressed_texture_s3tc","WEBGL_depth_texture","OES_element_index_uint","EXT_texture_filter_anisotropic","EXT_frag_depth","WEBGL_draw_buffers","ANGLE_instanced_arrays","OES_texture_float_linear","OES_texture_half_float_linear","EXT_blend_minmax","EXT_shader_texture_lod","WEBGL_compressed_texture_pvrtc","EXT_color_buffer_half_float","WEBGL_color_buffer_float","EXT_sRGB","WEBGL_compressed_texture_etc1","EXT_disjoint_timer_query","WEBGL_compressed_texture_etc","WEBGL_compressed_texture_astc","EXT_color_buffer_float","WEBGL_compressed_texture_s3tc_srgb","EXT_disjoint_timer_query_webgl2"];var exts=GLctx.getSupportedExtensions();if(exts&&exts.length>0){GLctx.getSupportedExtensions().forEach(function(ext){if(automaticallyEnabledExtensions.indexOf(ext)!=-1){GLctx.getExtension(ext)}})}},populateUniformTable:function(program){var p=GL.programs[program];var ptable=GL.programInfos[program]={uniforms:{},maxUniformLength:0,maxAttributeLength:-1,maxUniformBlockNameLength:-1};var utable=ptable.uniforms;var numUniforms=GLctx.getProgramParameter(p,35718);for(var i=0;i<numUniforms;++i){var u=GLctx.getActiveUniform(p,i);var name=u.name;ptable.maxUniformLength=Math.max(ptable.maxUniformLength,name.length+1);if(name.slice(-1)=="]"){name=name.slice(0,name.lastIndexOf("["))}var loc=GLctx.getUniformLocation(p,name);if(loc){var id=GL.getNewId(GL.uniforms);utable[name]=[u.size,id];GL.uniforms[id]=loc;for(var j=1;j<u.size;++j){var n=name+"["+j+"]";loc=GLctx.getUniformLocation(p,n);id=GL.getNewId(GL.uniforms);GL.uniforms[id]=loc}}}}};function _emscripten_glActiveTexture(x0){GLctx["activeTexture"](x0)}function _emscripten_glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glBeginQuery(target,id){GLctx["beginQuery"](target,GL.queries[id])}function _emscripten_glBeginQueryEXT(target,id){GLctx.disjointTimerQueryExt["beginQueryEXT"](target,GL.timerQueriesEXT[id])}function _emscripten_glBeginTransformFeedback(x0){GLctx["beginTransformFeedback"](x0)}function _emscripten_glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _emscripten_glBindBuffer(target,buffer){if(target==35051){GLctx.currentPixelPackBufferBinding=buffer}else if(target==35052){GLctx.currentPixelUnpackBufferBinding=buffer}GLctx.bindBuffer(target,GL.buffers[buffer])}function _emscripten_glBindBufferBase(target,index,buffer){GLctx["bindBufferBase"](target,index,GL.buffers[buffer])}function _emscripten_glBindBufferRange(target,index,buffer,offset,ptrsize){GLctx["bindBufferRange"](target,index,GL.buffers[buffer],offset,ptrsize)}function _emscripten_glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,GL.framebuffers[framebuffer])}function _emscripten_glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,GL.renderbuffers[renderbuffer])}function _emscripten_glBindSampler(unit,sampler){GLctx["bindSampler"](unit,GL.samplers[sampler])}function _emscripten_glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _emscripten_glBindTransformFeedback(target,id){GLctx["bindTransformFeedback"](target,GL.transformFeedbacks[id])}function _emscripten_glBindVertexArray(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _emscripten_glBindVertexArrayOES(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _emscripten_glBlendColor(x0,x1,x2,x3){GLctx["blendColor"](x0,x1,x2,x3)}function _emscripten_glBlendEquation(x0){GLctx["blendEquation"](x0)}function _emscripten_glBlendEquationSeparate(x0,x1){GLctx["blendEquationSeparate"](x0,x1)}function _emscripten_glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _emscripten_glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glBlitFramebuffer(x0,x1,x2,x3,x4,x5,x6,x7,x8,x9){GLctx["blitFramebuffer"](x0,x1,x2,x3,x4,x5,x6,x7,x8,x9)}function _emscripten_glBufferData(target,size,data,usage){if(GL.currentContext.supportsWebGL2EntryPoints){if(data){GLctx.bufferData(target,HEAPU8,usage,data,size)}else{GLctx.bufferData(target,size,usage)}}else{GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}}function _emscripten_glBufferSubData(target,offset,size,data){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.bufferSubData(target,offset,HEAPU8,data,size);return}GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _emscripten_glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _emscripten_glClear(x0){GLctx["clear"](x0)}function _emscripten_glClearBufferfi(x0,x1,x2,x3){GLctx["clearBufferfi"](x0,x1,x2,x3)}function _emscripten_glClearBufferfv(buffer,drawbuffer,value){GLctx["clearBufferfv"](buffer,drawbuffer,HEAPF32,value>>2)}function _emscripten_glClearBufferiv(buffer,drawbuffer,value){GLctx["clearBufferiv"](buffer,drawbuffer,HEAP32,value>>2)}function _emscripten_glClearBufferuiv(buffer,drawbuffer,value){GLctx["clearBufferuiv"](buffer,drawbuffer,HEAPU32,value>>2)}function _emscripten_glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _emscripten_glClearDepthf(x0){GLctx["clearDepth"](x0)}function _emscripten_glClearStencil(x0){GLctx["clearStencil"](x0)}function _emscripten_glClientWaitSync(sync,flags,timeoutLo,timeoutHi){timeoutLo=timeoutLo>>>0;timeoutHi=timeoutHi>>>0;var timeout=timeoutLo==4294967295&&timeoutHi==4294967295?-1:makeBigInt(timeoutLo,timeoutHi,true);return GLctx.clientWaitSync(GL.syncs[sync],flags,timeout)}function _emscripten_glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}function _emscripten_glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _emscripten_glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,imageSize,data)}else{GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,HEAPU8,data,imageSize)}return}GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCompressedTexImage3D(target,level,internalFormat,width,height,depth,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,imageSize,data)}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,HEAPU8,data,imageSize)}}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,data?HEAPU8.subarray(data,data+imageSize):null)}}function _emscripten_glCompressedTexSubImage2D(target,level,xoffset,yoffset,width,height,format,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,imageSize,data)}else{GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,HEAPU8,data,imageSize)}return}GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCompressedTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data)}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,HEAPU8,data,imageSize)}}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,data?HEAPU8.subarray(data,data+imageSize):null)}}function _emscripten_glCopyBufferSubData(x0,x1,x2,x3,x4){GLctx["copyBufferSubData"](x0,x1,x2,x3,x4)}function _emscripten_glCopyTexImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCopyTexSubImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexSubImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCopyTexSubImage3D(x0,x1,x2,x3,x4,x5,x6,x7,x8){GLctx["copyTexSubImage3D"](x0,x1,x2,x3,x4,x5,x6,x7,x8)}function _emscripten_glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;GL.programs[id]=program;return id}function _emscripten_glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _emscripten_glCullFace(x0){GLctx["cullFace"](x0)}function _emscripten_glDeleteBuffers(n,buffers){for(var i=0;i<n;i++){var id=HEAP32[buffers+i*4>>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GL.currArrayBuffer)GL.currArrayBuffer=0;if(id==GL.currElementArrayBuffer)GL.currElementArrayBuffer=0;if(id==GLctx.currentPixelPackBufferBinding)GLctx.currentPixelPackBufferBinding=0;if(id==GLctx.currentPixelUnpackBufferBinding)GLctx.currentPixelUnpackBufferBinding=0}}function _emscripten_glDeleteFramebuffers(n,framebuffers){for(var i=0;i<n;++i){var id=HEAP32[framebuffers+i*4>>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _emscripten_glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null;GL.programInfos[id]=null}function _emscripten_glDeleteQueries(n,ids){for(var i=0;i<n;i++){var id=HEAP32[ids+i*4>>2];var query=GL.queries[id];if(!query)continue;GLctx["deleteQuery"](query);GL.queries[id]=null}}function _emscripten_glDeleteQueriesEXT(n,ids){for(var i=0;i<n;i++){var id=HEAP32[ids+i*4>>2];var query=GL.timerQueriesEXT[id];if(!query)continue;GLctx.disjointTimerQueryExt["deleteQueryEXT"](query);GL.timerQueriesEXT[id]=null}}function _emscripten_glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i<n;i++){var id=HEAP32[renderbuffers+i*4>>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _emscripten_glDeleteSamplers(n,samplers){for(var i=0;i<n;i++){var id=HEAP32[samplers+i*4>>2];var sampler=GL.samplers[id];if(!sampler)continue;GLctx["deleteSampler"](sampler);sampler.name=0;GL.samplers[id]=null}}function _emscripten_glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _emscripten_glDeleteSync(id){if(!id)return;var sync=GL.syncs[id];if(!sync){GL.recordError(1281);return}GLctx.deleteSync(sync);sync.name=0;GL.syncs[id]=null}function _emscripten_glDeleteTextures(n,textures){for(var i=0;i<n;i++){var id=HEAP32[textures+i*4>>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _emscripten_glDeleteTransformFeedbacks(n,ids){for(var i=0;i<n;i++){var id=HEAP32[ids+i*4>>2];var transformFeedback=GL.transformFeedbacks[id];if(!transformFeedback)continue;GLctx["deleteTransformFeedback"](transformFeedback);transformFeedback.name=0;GL.transformFeedbacks[id]=null}}function _emscripten_glDeleteVertexArrays(n,vaos){for(var i=0;i<n;i++){var id=HEAP32[vaos+i*4>>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _emscripten_glDeleteVertexArraysOES(n,vaos){for(var i=0;i<n;i++){var id=HEAP32[vaos+i*4>>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _emscripten_glDepthFunc(x0){GLctx["depthFunc"](x0)}function _emscripten_glDepthMask(flag){GLctx.depthMask(!!flag)}function _emscripten_glDepthRangef(x0,x1){GLctx["depthRange"](x0,x1)}function _emscripten_glDetachShader(program,shader){GLctx.detachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glDisable(x0){GLctx["disable"](x0)}function _emscripten_glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _emscripten_glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _emscripten_glDrawArraysInstanced(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedANGLE(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedARB(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedEXT(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _emscripten_glDrawArraysInstancedNV(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}var __tempFixedLengthArray=[];function _emscripten_glDrawBuffers(n,bufs){var bufArray=__tempFixedLengthArray[n];for(var i=0;i<n;i++){bufArray[i]=HEAP32[bufs+i*4>>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawBuffersEXT(n,bufs){var bufArray=__tempFixedLengthArray[n];for(var i=0;i<n;i++){bufArray[i]=HEAP32[bufs+i*4>>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawBuffersWEBGL(n,bufs){var bufArray=__tempFixedLengthArray[n];for(var i=0;i<n;i++){bufArray[i]=HEAP32[bufs+i*4>>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _emscripten_glDrawElementsInstanced(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedANGLE(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedARB(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedEXT(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glDrawElementsInstancedNV(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _emscripten_glDrawRangeElements(mode,start,end,count,type,indices){_glDrawElements(mode,count,type,indices)}function _emscripten_glEnable(x0){GLctx["enable"](x0)}function _emscripten_glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _emscripten_glEndQuery(x0){GLctx["endQuery"](x0)}function _emscripten_glEndQueryEXT(target){GLctx.disjointTimerQueryExt["endQueryEXT"](target)}function _emscripten_glEndTransformFeedback(){GLctx["endTransformFeedback"]()}function _emscripten_glFenceSync(condition,flags){var sync=GLctx.fenceSync(condition,flags);if(sync){var id=GL.getNewId(GL.syncs);sync.name=id;GL.syncs[id]=sync;return id}else{return 0}}function _emscripten_glFinish(){GLctx["finish"]()}function _emscripten_glFlush(){GLctx["flush"]()}function _emscripten_glFlushMappedBufferRange(){err("missing function: emscripten_glFlushMappedBufferRange");abort(-1)}function _emscripten_glFramebufferRenderbuffer(target,attachment,renderbuffertarget,renderbuffer){GLctx.framebufferRenderbuffer(target,attachment,renderbuffertarget,GL.renderbuffers[renderbuffer])}function _emscripten_glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _emscripten_glFramebufferTextureLayer(target,attachment,texture,level,layer){GLctx.framebufferTextureLayer(target,attachment,GL.textures[texture],level,layer)}function _emscripten_glFrontFace(x0){GLctx["frontFace"](x0)}function __glGenObject(n,buffers,createFunction,objectTable){for(var i=0;i<n;i++){var buffer=GLctx[createFunction]();var id=buffer&&GL.getNewId(objectTable);if(buffer){buffer.name=id;objectTable[id]=buffer}else{GL.recordError(1282)}HEAP32[buffers+i*4>>2]=id}}function _emscripten_glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _emscripten_glGenFramebuffers(n,ids){__glGenObject(n,ids,"createFramebuffer",GL.framebuffers)}function _emscripten_glGenQueries(n,ids){__glGenObject(n,ids,"createQuery",GL.queries)}function _emscripten_glGenQueriesEXT(n,ids){for(var i=0;i<n;i++){var query=GLctx.disjointTimerQueryExt["createQueryEXT"]();if(!query){GL.recordError(1282);while(i<n)HEAP32[ids+i++*4>>2]=0;return}var id=GL.getNewId(GL.timerQueriesEXT);query.name=id;GL.timerQueriesEXT[id]=query;HEAP32[ids+i*4>>2]=id}}function _emscripten_glGenRenderbuffers(n,renderbuffers){__glGenObject(n,renderbuffers,"createRenderbuffer",GL.renderbuffers)}function _emscripten_glGenSamplers(n,samplers){__glGenObject(n,samplers,"createSampler",GL.samplers)}function _emscripten_glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _emscripten_glGenTransformFeedbacks(n,ids){__glGenObject(n,ids,"createTransformFeedback",GL.transformFeedbacks)}function _emscripten_glGenVertexArrays(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _emscripten_glGenVertexArraysOES(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _emscripten_glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function _emscripten_glGetActiveAttrib(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx.getActiveAttrib(program,index);if(!info)return;if(bufSize>0&&name){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetActiveUniform(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx.getActiveUniform(program,index);if(!info)return;if(bufSize>0&&name){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetActiveUniformBlockName(program,uniformBlockIndex,bufSize,length,uniformBlockName){program=GL.programs[program];var result=GLctx["getActiveUniformBlockName"](program,uniformBlockIndex);if(!result)return;if(uniformBlockName&&bufSize>0){var numBytesWrittenExclNull=stringToUTF8(result,uniformBlockName,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetActiveUniformBlockiv(program,uniformBlockIndex,pname,params){if(!params){GL.recordError(1281);return}program=GL.programs[program];switch(pname){case 35393:var name=GLctx["getActiveUniformBlockName"](program,uniformBlockIndex);HEAP32[params>>2]=name.length+1;return;default:var result=GLctx["getActiveUniformBlockParameter"](program,uniformBlockIndex,pname);if(!result)return;if(typeof result=="number"){HEAP32[params>>2]=result}else{for(var i=0;i<result.length;i++){HEAP32[params+i*4>>2]=result[i]}}}}function _emscripten_glGetActiveUniformsiv(program,uniformCount,uniformIndices,pname,params){if(!params){GL.recordError(1281);return}if(uniformCount>0&&uniformIndices==0){GL.recordError(1281);return}program=GL.programs[program];var ids=[];for(var i=0;i<uniformCount;i++){ids.push(HEAP32[uniformIndices+i*4>>2])}var result=GLctx["getActiveUniforms"](program,ids,pname);if(!result)return;var len=result.length;for(var i=0;i<len;i++){HEAP32[params+i*4>>2]=result[i]}}function _emscripten_glGetAttachedShaders(program,maxCount,count,shaders){var result=GLctx.getAttachedShaders(GL.programs[program]);var len=result.length;if(len>maxCount){len=maxCount}HEAP32[count>>2]=len;for(var i=0;i<len;++i){var id=GL.shaders.indexOf(result[i]);HEAP32[shaders+i*4>>2]=id}}function _emscripten_glGetAttribLocation(program,name){return GLctx.getAttribLocation(GL.programs[program],UTF8ToString(name))}function emscriptenWebGLGet(name_,p,type){if(!p){GL.recordError(1281);return}var ret=undefined;switch(name_){case 36346:ret=1;break;case 36344:if(type!=="Integer"&&type!=="Integer64"){GL.recordError(1280)}return;case 34814:case 36345:ret=0;break;case 34466:var formats=GLctx.getParameter(34467);ret=formats?formats.length:0;break;case 33309:if(GL.currentContext.version<2){GL.recordError(1282);return}var exts=GLctx.getSupportedExtensions();ret=2*exts.length;break;case 33307:case 33308:if(GL.currentContext.version<2){GL.recordError(1280);return}ret=name_==33307?3:0;break}if(ret===undefined){var result=GLctx.getParameter(name_);switch(typeof result){case"number":ret=result;break;case"boolean":ret=result?1:0;break;case"string":GL.recordError(1280);return;case"object":if(result===null){switch(name_){case 34964:case 35725:case 34965:case 36006:case 36007:case 32873:case 34229:case 35097:case 36389:case 34068:{ret=0;break}default:{GL.recordError(1280);return}}}else if(result instanceof Float32Array||result instanceof Uint32Array||result instanceof Int32Array||result instanceof Array){for(var i=0;i<result.length;++i){switch(type){case"Integer":HEAP32[p+i*4>>2]=result[i];break;case"Float":HEAPF32[p+i*4>>2]=result[i];break;case"Boolean":HEAP8[p+i>>0]=result[i]?1:0;break;default:throw"internal glGet error, bad type: "+type}}return}else{try{ret=result.name|0}catch(e){GL.recordError(1280);err("GL_INVALID_ENUM in glGet"+type+"v: Unknown object returned from WebGL getParameter("+name_+")! (error: "+e+")");return}}break;default:GL.recordError(1280);return}}switch(type){case"Integer64":tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[p>>2]=tempI64[0],HEAP32[p+4>>2]=tempI64[1];break;case"Integer":HEAP32[p>>2]=ret;break;case"Float":HEAPF32[p>>2]=ret;break;case"Boolean":HEAP8[p>>0]=ret?1:0;break;default:throw"internal glGet error, bad type: "+type}}function _emscripten_glGetBooleanv(name_,p){emscriptenWebGLGet(name_,p,"Boolean")}function _emscripten_glGetBufferParameteri64v(target,value,data){if(!data){GL.recordError(1281);return}tempI64=[GLctx.getBufferParameter(target,value)>>>0,(tempDouble=GLctx.getBufferParameter(target,value),+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[data>>2]=tempI64[0],HEAP32[data+4>>2]=tempI64[1]}function _emscripten_glGetBufferParameteriv(target,value,data){if(!data){GL.recordError(1281);return}HEAP32[data>>2]=GLctx.getBufferParameter(target,value)}function _emscripten_glGetBufferPointerv(){err("missing function: emscripten_glGetBufferPointerv");abort(-1)}function _emscripten_glGetError(){if(GL.lastError){var error=GL.lastError;GL.lastError=0;return error}else{return GLctx.getError()}}function _emscripten_glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,"Float")}function _emscripten_glGetFragDataLocation(program,name){return GLctx["getFragDataLocation"](GL.programs[program],UTF8ToString(name))}function _emscripten_glGetFramebufferAttachmentParameteriv(target,attachment,pname,params){var result=GLctx.getFramebufferAttachmentParameter(target,attachment,pname);if(result instanceof WebGLRenderbuffer||result instanceof WebGLTexture){result=result.name|0}HEAP32[params>>2]=result}function emscriptenWebGLGetIndexed(target,index,data,type){if(!data){GL.recordError(1281);return}var result=GLctx["getIndexedParameter"](target,index);var ret;switch(typeof result){case"boolean":ret=result?1:0;break;case"number":ret=result;break;case"object":if(result===null){switch(target){case 35983:case 35368:ret=0;break;default:{GL.recordError(1280);return}}}else if(result instanceof WebGLBuffer){ret=result.name|0}else{GL.recordError(1280);return}break;default:GL.recordError(1280);return}switch(type){case"Integer64":tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[data>>2]=tempI64[0],HEAP32[data+4>>2]=tempI64[1];break;case"Integer":HEAP32[data>>2]=ret;break;case"Float":HEAPF32[data>>2]=ret;break;case"Boolean":HEAP8[data>>0]=ret?1:0;break;default:throw"internal emscriptenWebGLGetIndexed() error, bad type: "+type}}function _emscripten_glGetInteger64i_v(target,index,data){emscriptenWebGLGetIndexed(target,index,data,"Integer64")}function _emscripten_glGetInteger64v(name_,p){emscriptenWebGLGet(name_,p,"Integer64")}function _emscripten_glGetIntegeri_v(target,index,data){emscriptenWebGLGetIndexed(target,index,data,"Integer")}function _emscripten_glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,"Integer")}function _emscripten_glGetInternalformativ(){err("missing function: emscripten_glGetInternalformativ");abort(-1)}function _emscripten_glGetProgramBinary(program,bufSize,length,binaryFormat,binary){GL.recordError(1282)}function _emscripten_glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}var ptable=GL.programInfos[program];if(!ptable){GL.recordError(1282);return}if(pname==35716){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){HEAP32[p>>2]=ptable.maxUniformLength}else if(pname==35722){if(ptable.maxAttributeLength==-1){program=GL.programs[program];var numAttribs=GLctx.getProgramParameter(program,35721);ptable.maxAttributeLength=0;for(var i=0;i<numAttribs;++i){var activeAttrib=GLctx.getActiveAttrib(program,i);ptable.maxAttributeLength=Math.max(ptable.maxAttributeLength,activeAttrib.name.length+1)}}HEAP32[p>>2]=ptable.maxAttributeLength}else if(pname==35381){if(ptable.maxUniformBlockNameLength==-1){program=GL.programs[program];var numBlocks=GLctx.getProgramParameter(program,35382);ptable.maxUniformBlockNameLength=0;for(var i=0;i<numBlocks;++i){var activeBlockName=GLctx.getActiveUniformBlockName(program,i);ptable.maxUniformBlockNameLength=Math.max(ptable.maxUniformBlockNameLength,activeBlockName.length+1)}}HEAP32[p>>2]=ptable.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(GL.programs[program],pname)}}function _emscripten_glGetQueryObjecti64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[params>>2]=tempI64[0],HEAP32[params+4>>2]=tempI64[1]}function _emscripten_glGetQueryObjectivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryObjectui64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[params>>2]=tempI64[0],HEAP32[params+4>>2]=tempI64[1]}function _emscripten_glGetQueryObjectuiv(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.queries[id];var param=GLctx["getQueryParameter"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryObjectuivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryiv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx["getQuery"](target,pname)}function _emscripten_glGetQueryivEXT(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.disjointTimerQueryExt["getQueryEXT"](target,pname)}function _emscripten_glGetRenderbufferParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getRenderbufferParameter(target,pname)}function _emscripten_glGetSamplerParameterfv(sampler,pname,params){if(!params){GL.recordError(1281);return}sampler=GL.samplers[sampler];HEAPF32[params>>2]=GLctx["getSamplerParameter"](sampler,pname)}function _emscripten_glGetSamplerParameteriv(sampler,pname,params){if(!params){GL.recordError(1281);return}sampler=GL.samplers[sampler];HEAP32[params>>2]=GLctx["getSamplerParameter"](sampler,pname)}function _emscripten_glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetShaderPrecisionFormat(shaderType,precisionType,range,precision){var result=GLctx.getShaderPrecisionFormat(shaderType,precisionType);HEAP32[range>>2]=result.rangeMin;HEAP32[range+4>>2]=result.rangeMax;HEAP32[precision>>2]=result.precision}function _emscripten_glGetShaderSource(shader,bufSize,length,source){var result=GLctx.getShaderSource(GL.shaders[shader]);if(!result)return;if(bufSize>0&&source){var numBytesWrittenExclNull=stringToUTF8(result,source,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source===null||source.length==0?0:source.length+1;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function stringToNewUTF8(jsString){var length=lengthBytesUTF8(jsString)+1;var cString=_malloc(length);stringToUTF8(jsString,cString,length);return cString}function _emscripten_glGetString(name_){if(GL.stringCache[name_])return GL.stringCache[name_];var ret;switch(name_){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(exts[i]);gl_exts.push("GL_"+exts[i])}ret=stringToNewUTF8(gl_exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(GLctx.VERSION);if(GL.currentContext.version>=2)glVersion="OpenGL ES 3.0 ("+glVersion+")";else{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280);return 0}GL.stringCache[name_]=ret;return ret}function _emscripten_glGetStringi(name,index){if(GL.currentContext.version<2){GL.recordError(1282);return 0}var stringiCache=GL.stringiCache[name];if(stringiCache){if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index]}switch(name){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(stringToNewUTF8(exts[i]));gl_exts.push(stringToNewUTF8("GL_"+exts[i]))}stringiCache=GL.stringiCache[name]=gl_exts;if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index];default:GL.recordError(1280);return 0}}function _emscripten_glGetSynciv(sync,pname,bufSize,length,values){if(bufSize<0){GL.recordError(1281);return}if(!values){GL.recordError(1281);return}var ret=GLctx.getSyncParameter(GL.syncs[sync],pname);HEAP32[length>>2]=ret;if(ret!==null&&length)HEAP32[length>>2]=1}function _emscripten_glGetTexParameterfv(target,pname,params){if(!params){GL.recordError(1281);return}HEAPF32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetTexParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetTransformFeedbackVarying(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx["getTransformFeedbackVarying"](program,index);if(!info)return;if(name&&bufSize>0){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetUniformBlockIndex(program,uniformBlockName){return GLctx["getUniformBlockIndex"](GL.programs[program],UTF8ToString(uniformBlockName))}function _emscripten_glGetUniformIndices(program,uniformCount,uniformNames,uniformIndices){if(!uniformIndices){GL.recordError(1281);return}if(uniformCount>0&&(uniformNames==0||uniformIndices==0)){GL.recordError(1281);return}program=GL.programs[program];var names=[];for(var i=0;i<uniformCount;i++)names.push(UTF8ToString(HEAP32[uniformNames+i*4>>2]));var result=GLctx["getUniformIndices"](program,names);if(!result)return;var len=result.length;for(var i=0;i<len;i++){HEAP32[uniformIndices+i*4>>2]=result[i]}}function _emscripten_glGetUniformLocation(program,name){name=UTF8ToString(name);var arrayIndex=0;if(name[name.length-1]=="]"){var leftBrace=name.lastIndexOf("[");arrayIndex=name[leftBrace+1]!="]"?parseInt(name.slice(leftBrace+1)):0;name=name.slice(0,leftBrace)}var uniformInfo=GL.programInfos[program]&&GL.programInfos[program].uniforms[name];if(uniformInfo&&arrayIndex>=0&&arrayIndex<uniformInfo[0]){return uniformInfo[1]+arrayIndex}else{return-1}}function emscriptenWebGLGetUniform(program,location,params,type){if(!params){GL.recordError(1281);return}var data=GLctx.getUniform(GL.programs[program],GL.uniforms[location]);if(typeof data=="number"||typeof data=="boolean"){switch(type){case"Integer":HEAP32[params>>2]=data;break;case"Float":HEAPF32[params>>2]=data;break;default:throw"internal emscriptenWebGLGetUniform() error, bad type: "+type}}else{for(var i=0;i<data.length;i++){switch(type){case"Integer":HEAP32[params+i*4>>2]=data[i];break;case"Float":HEAPF32[params+i*4>>2]=data[i];break;default:throw"internal emscriptenWebGLGetUniform() error, bad type: "+type}}}}function _emscripten_glGetUniformfv(program,location,params){emscriptenWebGLGetUniform(program,location,params,"Float")}function _emscripten_glGetUniformiv(program,location,params){emscriptenWebGLGetUniform(program,location,params,"Integer")}function _emscripten_glGetUniformuiv(program,location,params){emscriptenWebGLGetUniform(program,location,params,"Integer")}function emscriptenWebGLGetVertexAttrib(index,pname,params,type){if(!params){GL.recordError(1281);return}var data=GLctx.getVertexAttrib(index,pname);if(pname==34975){HEAP32[params>>2]=data["name"]}else if(typeof data=="number"||typeof data=="boolean"){switch(type){case"Integer":HEAP32[params>>2]=data;break;case"Float":HEAPF32[params>>2]=data;break;case"FloatToInteger":HEAP32[params>>2]=Math.fround(data);break;default:throw"internal emscriptenWebGLGetVertexAttrib() error, bad type: "+type}}else{for(var i=0;i<data.length;i++){switch(type){case"Integer":HEAP32[params+i*4>>2]=data[i];break;case"Float":HEAPF32[params+i*4>>2]=data[i];break;case"FloatToInteger":HEAP32[params+i*4>>2]=Math.fround(data[i]);break;default:throw"internal emscriptenWebGLGetVertexAttrib() error, bad type: "+type}}}}function _emscripten_glGetVertexAttribIiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"Integer")}function _emscripten_glGetVertexAttribIuiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"Integer")}function _emscripten_glGetVertexAttribPointerv(index,pname,pointer){if(!pointer){GL.recordError(1281);return}HEAP32[pointer>>2]=GLctx.getVertexAttribOffset(index,pname)}function _emscripten_glGetVertexAttribfv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"Float")}function _emscripten_glGetVertexAttribiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"FloatToInteger")}function _emscripten_glHint(x0,x1){GLctx["hint"](x0,x1)}function _emscripten_glInvalidateFramebuffer(target,numAttachments,attachments){var list=__tempFixedLengthArray[numAttachments];for(var i=0;i<numAttachments;i++){list[i]=HEAP32[attachments+i*4>>2]}GLctx["invalidateFramebuffer"](target,list)}function _emscripten_glInvalidateSubFramebuffer(target,numAttachments,attachments,x,y,width,height){var list=__tempFixedLengthArray[numAttachments];for(var i=0;i<numAttachments;i++){list[i]=HEAP32[attachments+i*4>>2]}GLctx["invalidateSubFramebuffer"](target,list,x,y,width,height)}function _emscripten_glIsBuffer(buffer){var b=GL.buffers[buffer];if(!b)return 0;return GLctx.isBuffer(b)}function _emscripten_glIsEnabled(x0){return GLctx["isEnabled"](x0)}function _emscripten_glIsFramebuffer(framebuffer){var fb=GL.framebuffers[framebuffer];if(!fb)return 0;return GLctx.isFramebuffer(fb)}function _emscripten_glIsProgram(program){program=GL.programs[program];if(!program)return 0;return GLctx.isProgram(program)}function _emscripten_glIsQuery(id){var query=GL.queries[id];if(!query)return 0;return GLctx["isQuery"](query)}function _emscripten_glIsQueryEXT(id){var query=GL.timerQueriesEXT[id];if(!query)return 0;return GLctx.disjointTimerQueryExt["isQueryEXT"](query)}function _emscripten_glIsRenderbuffer(renderbuffer){var rb=GL.renderbuffers[renderbuffer];if(!rb)return 0;return GLctx.isRenderbuffer(rb)}function _emscripten_glIsSampler(id){var sampler=GL.samplers[id];if(!sampler)return 0;return GLctx["isSampler"](sampler)}function _emscripten_glIsShader(shader){var s=GL.shaders[shader];if(!s)return 0;return GLctx.isShader(s)}function _emscripten_glIsSync(sync){var sync=GL.syncs[sync];if(!sync)return 0;return GLctx.isSync(sync)}function _emscripten_glIsTexture(id){var texture=GL.textures[id];if(!texture)return 0;return GLctx.isTexture(texture)}function _emscripten_glIsTransformFeedback(id){return GLctx["isTransformFeedback"](GL.transformFeedbacks[id])}function _emscripten_glIsVertexArray(array){var vao=GL.vaos[array];if(!vao)return 0;return GLctx["isVertexArray"](vao)}function _emscripten_glIsVertexArrayOES(array){var vao=GL.vaos[array];if(!vao)return 0;return GLctx["isVertexArray"](vao)}function _emscripten_glLineWidth(x0){GLctx["lineWidth"](x0)}function _emscripten_glLinkProgram(program){GLctx.linkProgram(GL.programs[program]);GL.populateUniformTable(program)}function _emscripten_glMapBufferRange(){err("missing function: emscripten_glMapBufferRange");abort(-1)}function _emscripten_glPauseTransformFeedback(){GLctx["pauseTransformFeedback"]()}function _emscripten_glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _emscripten_glPolygonOffset(x0,x1){GLctx["polygonOffset"](x0,x1)}function _emscripten_glProgramBinary(program,binaryFormat,binary,length){GL.recordError(1280)}function _emscripten_glProgramParameteri(program,pname,value){GL.recordError(1280)}function _emscripten_glQueryCounterEXT(id,target){GLctx.disjointTimerQueryExt["queryCounterEXT"](GL.timerQueriesEXT[id],target)}function _emscripten_glReadBuffer(x0){GLctx["readBuffer"](x0)}function __computeUnpackAlignedImageSize(width,height,sizePerPixel,alignment){function roundedToNextMultipleOf(x,y){return x+y-1&-y}var plainRowSize=width*sizePerPixel;var alignedRowSize=roundedToNextMultipleOf(plainRowSize,alignment);return height*alignedRowSize}var __colorChannelsInGlTextureFormat={6402:1,6403:1,6406:1,6407:3,6408:4,6409:1,6410:2,33319:2,33320:2,35904:3,35906:4,36244:1,36248:3,36249:4};var __sizeOfGlTextureElementType={5120:1,5121:1,5122:2,5123:2,5124:4,5125:4,5126:4,5131:2,32819:2,32820:2,33635:2,33640:4,34042:4,35899:4,35902:4,36193:2};function emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat){var sizePerPixel=__colorChannelsInGlTextureFormat[format]*__sizeOfGlTextureElementType[type];if(!sizePerPixel){GL.recordError(1280);return}var bytes=__computeUnpackAlignedImageSize(width,height,sizePerPixel,GL.unpackAlignment);var end=pixels+bytes;switch(type){case 5120:return HEAP8.subarray(pixels,end);case 5121:return HEAPU8.subarray(pixels,end);case 5122:return HEAP16.subarray(pixels>>1,end>>1);case 5124:return HEAP32.subarray(pixels>>2,end>>2);case 5126:return HEAPF32.subarray(pixels>>2,end>>2);case 5125:case 34042:case 35902:case 33640:case 35899:case 34042:return HEAPU32.subarray(pixels>>2,end>>2);case 5123:case 33635:case 32819:case 32820:case 36193:case 5131:return HEAPU16.subarray(pixels>>1,end>>1);default:GL.recordError(1280)}}function __heapObjectForWebGLType(type){switch(type){case 5120:return HEAP8;case 5121:return HEAPU8;case 5122:return HEAP16;case 5123:case 33635:case 32819:case 32820:case 36193:case 5131:return HEAPU16;case 5124:return HEAP32;case 5125:case 34042:case 35902:case 33640:case 35899:case 34042:return HEAPU32;case 5126:return HEAPF32}}var __heapAccessShiftForWebGLType={5122:1,5123:1,5124:2,5125:2,5126:2,5131:1,32819:1,32820:1,33635:1,33640:2,34042:2,35899:2,35902:2,36193:1};function _emscripten_glReadPixels(x,y,width,height,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelPackBufferBinding){GLctx.readPixels(x,y,width,height,format,type,pixels)}else{GLctx.readPixels(x,y,width,height,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}return}var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _emscripten_glReleaseShaderCompiler(){}function _emscripten_glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _emscripten_glRenderbufferStorageMultisample(x0,x1,x2,x3,x4){GLctx["renderbufferStorageMultisample"](x0,x1,x2,x3,x4)}function _emscripten_glResumeTransformFeedback(){GLctx["resumeTransformFeedback"]()}function _emscripten_glSampleCoverage(value,invert){GLctx.sampleCoverage(value,!!invert)}function _emscripten_glSamplerParameterf(sampler,pname,param){GLctx["samplerParameterf"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameterfv(sampler,pname,params){var param=HEAPF32[params>>2];GLctx["samplerParameterf"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameteri(sampler,pname,param){GLctx["samplerParameteri"](GL.samplers[sampler],pname,param)}function _emscripten_glSamplerParameteriv(sampler,pname,params){var param=HEAP32[params>>2];GLctx["samplerParameteri"](GL.samplers[sampler],pname,param)}function _emscripten_glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _emscripten_glShaderBinary(){GL.recordError(1280)}function _emscripten_glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _emscripten_glStencilFunc(x0,x1,x2){GLctx["stencilFunc"](x0,x1,x2)}function _emscripten_glStencilFuncSeparate(x0,x1,x2,x3){GLctx["stencilFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glStencilMask(x0){GLctx["stencilMask"](x0)}function _emscripten_glStencilMaskSeparate(x0,x1){GLctx["stencilMaskSeparate"](x0,x1)}function _emscripten_glStencilOp(x0,x1,x2){GLctx["stencilOp"](x0,x1,x2)}function _emscripten_glStencilOpSeparate(x0,x1,x2,x3){GLctx["stencilOpSeparate"](x0,x1,x2,x3)}function _emscripten_glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels!=0){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,null)}return}GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _emscripten_glTexImage3D(target,level,internalFormat,width,height,depth,border,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,pixels)}else if(pixels!=0){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,null)}}function _emscripten_glTexParameterf(x0,x1,x2){GLctx["texParameterf"](x0,x1,x2)}function _emscripten_glTexParameterfv(target,pname,params){var param=HEAPF32[params>>2];GLctx.texParameterf(target,pname,param)}function _emscripten_glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _emscripten_glTexParameteriv(target,pname,params){var param=HEAP32[params>>2];GLctx.texParameteri(target,pname,param)}function _emscripten_glTexStorage2D(x0,x1,x2,x3,x4){GLctx["texStorage2D"](x0,x1,x2,x3,x4)}function _emscripten_glTexStorage3D(x0,x1,x2,x3,x4,x5){GLctx["texStorage3D"](x0,x1,x2,x3,x4,x5)}function _emscripten_glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels)}else if(pixels!=0){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _emscripten_glTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels)}else if(pixels!=0){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,null)}}function _emscripten_glTransformFeedbackVaryings(program,count,varyings,bufferMode){program=GL.programs[program];var vars=[];for(var i=0;i<count;i++)vars.push(UTF8ToString(HEAP32[varyings+i*4>>2]));GLctx["transformFeedbackVaryings"](program,vars,bufferMode)}function _emscripten_glUniform1f(location,v0){GLctx.uniform1f(GL.uniforms[location],v0)}function _emscripten_glUniform1fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform1fv(GL.uniforms[location],HEAPF32,value>>2,count);return}if(count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[count-1];for(var i=0;i<count;++i){view[i]=HEAPF32[value+4*i>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*4>>2)}GLctx.uniform1fv(GL.uniforms[location],view)}function _emscripten_glUniform1i(location,v0){GLctx.uniform1i(GL.uniforms[location],v0)}function _emscripten_glUniform1iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform1iv(GL.uniforms[location],HEAP32,value>>2,count);return}GLctx.uniform1iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*4>>2))}function _emscripten_glUniform1ui(location,v0){GLctx.uniform1ui(GL.uniforms[location],v0)}function _emscripten_glUniform1uiv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform1uiv(GL.uniforms[location],HEAPU32,value>>2,count)}else{GLctx.uniform1uiv(GL.uniforms[location],HEAPU32.subarray(value>>2,value+count*4>>2))}}function _emscripten_glUniform2f(location,v0,v1){GLctx.uniform2f(GL.uniforms[location],v0,v1)}function _emscripten_glUniform2fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2fv(GL.uniforms[location],HEAPF32,value>>2,count*2);return}if(2*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(GL.uniforms[location],view)}function _emscripten_glUniform2i(location,v0,v1){GLctx.uniform2i(GL.uniforms[location],v0,v1)}function _emscripten_glUniform2iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2iv(GL.uniforms[location],HEAP32,value>>2,count*2);return}GLctx.uniform2iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*8>>2))}function _emscripten_glUniform2ui(location,v0,v1){GLctx.uniform2ui(GL.uniforms[location],v0,v1)}function _emscripten_glUniform2uiv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2uiv(GL.uniforms[location],HEAPU32,value>>2,count*2)}else{GLctx.uniform2uiv(GL.uniforms[location],HEAPU32.subarray(value>>2,value+count*8>>2))}}function _emscripten_glUniform3f(location,v0,v1,v2){GLctx.uniform3f(GL.uniforms[location],v0,v1,v2)}function _emscripten_glUniform3fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform3fv(GL.uniforms[location],HEAPF32,value>>2,count*3);return}if(3*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(GL.uniforms[location],view)}function _emscripten_glUniform3i(location,v0,v1,v2){GLctx.uniform3i(GL.uniforms[location],v0,v1,v2)}function _emscripten_glUniform3iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform3iv(GL.uniforms[location],HEAP32,value>>2,count*3);return}GLctx.uniform3iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*12>>2))}function _emscripten_glUniform3ui(location,v0,v1,v2){GLctx.uniform3ui(GL.uniforms[location],v0,v1,v2)}function _emscripten_glUniform3uiv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform3uiv(GL.uniforms[location],HEAPU32,value>>2,count*3)}else{GLctx.uniform3uiv(GL.uniforms[location],HEAPU32.subarray(value>>2,value+count*12>>2))}}function _emscripten_glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(GL.uniforms[location],v0,v1,v2,v3)}function _emscripten_glUniform4fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform4fv(GL.uniforms[location],HEAPF32,value>>2,count*4);return}if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(GL.uniforms[location],view)}function _emscripten_glUniform4i(location,v0,v1,v2,v3){GLctx.uniform4i(GL.uniforms[location],v0,v1,v2,v3)}function _emscripten_glUniform4iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform4iv(GL.uniforms[location],HEAP32,value>>2,count*4);return}GLctx.uniform4iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*16>>2))}function _emscripten_glUniform4ui(location,v0,v1,v2,v3){GLctx.uniform4ui(GL.uniforms[location],v0,v1,v2,v3)}function _emscripten_glUniform4uiv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform4uiv(GL.uniforms[location],HEAPU32,value>>2,count*4)}else{GLctx.uniform4uiv(GL.uniforms[location],HEAPU32.subarray(value>>2,value+count*16>>2))}}function _emscripten_glUniformBlockBinding(program,uniformBlockIndex,uniformBlockBinding){program=GL.programs[program];GLctx["uniformBlockBinding"](program,uniformBlockIndex,uniformBlockBinding)}function _emscripten_glUniformMatrix2fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix2fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*4);return}if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniformMatrix2fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUniformMatrix2x3fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix2x3fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*6)}else{GLctx.uniformMatrix2x3fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*24>>2))}}function _emscripten_glUniformMatrix2x4fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix2x4fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*8)}else{GLctx.uniformMatrix2x4fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*32>>2))}}function _emscripten_glUniformMatrix3fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix3fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*9);return}if(9*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[9*count-1];for(var i=0;i<9*count;i+=9){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*36>>2)}GLctx.uniformMatrix3fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUniformMatrix3x2fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix3x2fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*6)}else{GLctx.uniformMatrix3x2fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*24>>2))}}function _emscripten_glUniformMatrix3x4fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix3x4fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*12)}else{GLctx.uniformMatrix3x4fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*48>>2))}}function _emscripten_glUniformMatrix4fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*16);return}if(16*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[16*count-1];for(var i=0;i<16*count;i+=16){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2];view[i+9]=HEAPF32[value+(4*i+36)>>2];view[i+10]=HEAPF32[value+(4*i+40)>>2];view[i+11]=HEAPF32[value+(4*i+44)>>2];view[i+12]=HEAPF32[value+(4*i+48)>>2];view[i+13]=HEAPF32[value+(4*i+52)>>2];view[i+14]=HEAPF32[value+(4*i+56)>>2];view[i+15]=HEAPF32[value+(4*i+60)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUniformMatrix4x2fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix4x2fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*8)}else{GLctx.uniformMatrix4x2fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*32>>2))}}function _emscripten_glUniformMatrix4x3fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix4x3fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*12)}else{GLctx.uniformMatrix4x3fv(GL.uniforms[location],!!transpose,HEAPF32.subarray(value>>2,value+count*48>>2))}}function _emscripten_glUnmapBuffer(){err("missing function: emscripten_glUnmapBuffer");abort(-1)}function _emscripten_glUseProgram(program){GLctx.useProgram(GL.programs[program])}function _emscripten_glValidateProgram(program){GLctx.validateProgram(GL.programs[program])}function _emscripten_glVertexAttrib1f(x0,x1){GLctx["vertexAttrib1f"](x0,x1)}function _emscripten_glVertexAttrib1fv(index,v){GLctx.vertexAttrib1f(index,HEAPF32[v>>2])}function _emscripten_glVertexAttrib2f(x0,x1,x2){GLctx["vertexAttrib2f"](x0,x1,x2)}function _emscripten_glVertexAttrib2fv(index,v){GLctx.vertexAttrib2f(index,HEAPF32[v>>2],HEAPF32[v+4>>2])}function _emscripten_glVertexAttrib3f(x0,x1,x2,x3){GLctx["vertexAttrib3f"](x0,x1,x2,x3)}function _emscripten_glVertexAttrib3fv(index,v){GLctx.vertexAttrib3f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2])}function _emscripten_glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttrib4fv(index,v){GLctx.vertexAttrib4f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2],HEAPF32[v+12>>2])}function _emscripten_glVertexAttribDivisor(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorANGLE(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorARB(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorEXT(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribDivisorNV(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribI4i(x0,x1,x2,x3,x4){GLctx["vertexAttribI4i"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttribI4iv(index,v){GLctx.vertexAttribI4i(index,HEAP32[v>>2],HEAP32[v+4>>2],HEAP32[v+8>>2],HEAP32[v+12>>2])}function _emscripten_glVertexAttribI4ui(x0,x1,x2,x3,x4){GLctx["vertexAttribI4ui"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttribI4uiv(index,v){GLctx.vertexAttribI4ui(index,HEAPU32[v>>2],HEAPU32[v+4>>2],HEAPU32[v+8>>2],HEAPU32[v+12>>2])}function _emscripten_glVertexAttribIPointer(index,size,type,stride,ptr){GLctx["vertexAttribIPointer"](index,size,type,stride,ptr)}function _emscripten_glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _emscripten_glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}function _emscripten_glWaitSync(sync,flags,timeoutLo,timeoutHi){timeoutLo=timeoutLo>>>0;timeoutHi=timeoutHi>>>0;var timeout=timeoutLo==4294967295&&timeoutHi==4294967295?-1:makeBigInt(timeoutLo,timeoutHi,true);GLctx.waitSync(GL.syncs[sync],flags,timeout)}function _longjmp(env,value){_setThrew(env,value||1);throw"longjmp"}function _emscripten_longjmp(env,value){_longjmp(env,value)}function __emscripten_do_request_fullscreen(target,strategy){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;if(!JSEvents.fullscreenEnabled())return-3;if(!target)target="#canvas";target=__findEventTarget(target);if(!target)return-4;if(!target.requestFullscreen&&!target.msRequestFullscreen&&!target.mozRequestFullScreen&&!target.mozRequestFullscreen&&!target.webkitRequestFullscreen){return-3}var canPerformRequests=JSEvents.canPerformEventHandlerRequests();if(!canPerformRequests){if(strategy.deferUntilInEventHandler){JSEvents.deferCall(_JSEvents_requestFullscreen,1,[target,strategy]);return 1}else{return-2}}return _JSEvents_requestFullscreen(target,strategy)}function _emscripten_request_fullscreen_strategy(target,deferUntilInEventHandler,fullscreenStrategy){var strategy={};strategy.scaleMode=HEAP32[fullscreenStrategy>>2];strategy.canvasResolutionScaleMode=HEAP32[fullscreenStrategy+4>>2];strategy.filteringMode=HEAP32[fullscreenStrategy+8>>2];strategy.deferUntilInEventHandler=deferUntilInEventHandler;strategy.canvasResizedCallback=HEAP32[fullscreenStrategy+12>>2];strategy.canvasResizedCallbackUserData=HEAP32[fullscreenStrategy+16>>2];__currentFullscreenStrategy=strategy;return __emscripten_do_request_fullscreen(target,strategy)}function _emscripten_request_pointerlock(target,deferUntilInEventHandler){if(!target)target="#canvas";target=__findEventTarget(target);if(!target)return-4;if(!target.requestPointerLock&&!target.mozRequestPointerLock&&!target.webkitRequestPointerLock&&!target.msRequestPointerLock){return-1}var canPerformRequests=JSEvents.canPerformEventHandlerRequests();if(!canPerformRequests){if(deferUntilInEventHandler){JSEvents.deferCall(__requestPointerLock,2,[target]);return 1}else{return-2}}return __requestPointerLock(target)}function abortOnCannotGrowMemory(requestedSize){abort("OOM")}function emscripten_realloc_buffer(size){var PAGE_MULTIPLE=65536;size=alignUp(size,PAGE_MULTIPLE);var oldSize=buffer.byteLength;try{var result=wasmMemory.grow((size-oldSize)/65536);if(result!==(-1|0)){return buffer=wasmMemory.buffer}else{return null}}catch(e){return null}}function _emscripten_resize_heap(requestedSize){var oldSize=_emscripten_get_heap_size();var PAGE_MULTIPLE=65536;var LIMIT=2147483648-PAGE_MULTIPLE;if(requestedSize>LIMIT){return false}var MIN_TOTAL_MEMORY=16777216;var newSize=Math.max(oldSize,MIN_TOTAL_MEMORY);while(newSize<requestedSize){if(newSize<=536870912){newSize=alignUp(2*newSize,PAGE_MULTIPLE)}else{newSize=Math.min(alignUp((3*newSize+2147483648)/4,PAGE_MULTIPLE),LIMIT)}}var replacement=emscripten_realloc_buffer(newSize);if(!replacement||replacement.byteLength!=newSize){return false}updateGlobalBufferViews();return true}function _emscripten_sample_gamepad_data(){return(JSEvents.lastGamepadState=navigator.getGamepads?navigator.getGamepads():navigator.webkitGetGamepads?navigator.webkitGetGamepads():null)?0:-1}function __registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.fullscreenChangeEvent)JSEvents.fullscreenChangeEvent=_malloc(280);var fullscreenChangeEventhandlerFunc=function(event){var e=event||window.event;var fullscreenChangeEvent=JSEvents.fullscreenChangeEvent;__fillFullscreenChangeEventData(fullscreenChangeEvent,e);if(dynCall_iiii(callbackfunc,eventTypeId,fullscreenChangeEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:fullscreenChangeEventhandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_fullscreenchange_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;target=target?__findEventTarget(target):__specialEventTargets[1];if(!target)return-4;__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"fullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"mozfullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"webkitfullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"msfullscreenchange",targetThread);return 0}function __registerGamepadEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.gamepadEvent)JSEvents.gamepadEvent=_malloc(1432);var gamepadEventHandlerFunc=function(event){var e=event||window.event;var gamepadEvent=JSEvents.gamepadEvent;__fillGamepadEventData(gamepadEvent,e.gamepad);if(dynCall_iiii(callbackfunc,eventTypeId,gamepadEvent,userData))e.preventDefault()};var eventHandler={target:__findEventTarget(target),allowsDeferredCalls:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:gamepadEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_gamepadconnected_callback_on_thread(userData,useCapture,callbackfunc,targetThread){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;__registerGamepadEventCallback(2,userData,useCapture,callbackfunc,26,"gamepadconnected",targetThread);return 0}function _emscripten_set_gamepaddisconnected_callback_on_thread(userData,useCapture,callbackfunc,targetThread){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;__registerGamepadEventCallback(2,userData,useCapture,callbackfunc,27,"gamepaddisconnected",targetThread);return 0}function __registerKeyEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.keyEvent)JSEvents.keyEvent=_malloc(164);var keyEventHandlerFunc=function(event){var e=event||window.event;var keyEventData=JSEvents.keyEvent;stringToUTF8(e.key?e.key:"",keyEventData+0,32);stringToUTF8(e.code?e.code:"",keyEventData+32,32);HEAP32[keyEventData+64>>2]=e.location;HEAP32[keyEventData+68>>2]=e.ctrlKey;HEAP32[keyEventData+72>>2]=e.shiftKey;HEAP32[keyEventData+76>>2]=e.altKey;HEAP32[keyEventData+80>>2]=e.metaKey;HEAP32[keyEventData+84>>2]=e.repeat;stringToUTF8(e.locale?e.locale:"",keyEventData+88,32);stringToUTF8(e.char?e.char:"",keyEventData+120,32);HEAP32[keyEventData+152>>2]=e.charCode;HEAP32[keyEventData+156>>2]=e.keyCode;HEAP32[keyEventData+160>>2]=e.which;if(dynCall_iiii(callbackfunc,eventTypeId,keyEventData,userData))e.preventDefault()};var eventHandler={target:__findEventTarget(target),allowsDeferredCalls:JSEvents.isInternetExplorer()?false:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:keyEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_keydown_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerKeyEventCallback(target,userData,useCapture,callbackfunc,2,"keydown",targetThread);return 0}function _emscripten_set_keypress_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerKeyEventCallback(target,userData,useCapture,callbackfunc,1,"keypress",targetThread);return 0}function _emscripten_set_keyup_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerKeyEventCallback(target,userData,useCapture,callbackfunc,3,"keyup",targetThread);return 0}function __fillMouseEventData(eventStruct,e,target){HEAPF64[eventStruct>>3]=JSEvents.tick();HEAP32[eventStruct+8>>2]=e.screenX;HEAP32[eventStruct+12>>2]=e.screenY;HEAP32[eventStruct+16>>2]=e.clientX;HEAP32[eventStruct+20>>2]=e.clientY;HEAP32[eventStruct+24>>2]=e.ctrlKey;HEAP32[eventStruct+28>>2]=e.shiftKey;HEAP32[eventStruct+32>>2]=e.altKey;HEAP32[eventStruct+36>>2]=e.metaKey;HEAP16[eventStruct+40>>1]=e.button;HEAP16[eventStruct+42>>1]=e.buttons;HEAP32[eventStruct+44>>2]=e["movementX"]||e["mozMovementX"]||e["webkitMovementX"]||e.screenX-JSEvents.previousScreenX;HEAP32[eventStruct+48>>2]=e["movementY"]||e["mozMovementY"]||e["webkitMovementY"]||e.screenY-JSEvents.previousScreenY;if(Module["canvas"]){var rect=Module["canvas"].getBoundingClientRect();HEAP32[eventStruct+60>>2]=e.clientX-rect.left;HEAP32[eventStruct+64>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+60>>2]=0;HEAP32[eventStruct+64>>2]=0}if(target){var rect=JSEvents.getBoundingClientRectOrZeros(target);HEAP32[eventStruct+52>>2]=e.clientX-rect.left;HEAP32[eventStruct+56>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+52>>2]=0;HEAP32[eventStruct+56>>2]=0}if(e.type!=="wheel"&&e.type!=="mousewheel"){JSEvents.previousScreenX=e.screenX;JSEvents.previousScreenY=e.screenY}}function __registerMouseEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.mouseEvent)JSEvents.mouseEvent=_malloc(72);target=__findEventTarget(target);var mouseEventHandlerFunc=function(event){var e=event||window.event;__fillMouseEventData(JSEvents.mouseEvent,e,target);if(dynCall_iiii(callbackfunc,eventTypeId,JSEvents.mouseEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:eventTypeString!="mousemove"&&eventTypeString!="mouseenter"&&eventTypeString!="mouseleave",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:mouseEventHandlerFunc,useCapture:useCapture};if(JSEvents.isInternetExplorer()&&eventTypeString=="mousedown")eventHandler.allowsDeferredCalls=false;JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_mousedown_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerMouseEventCallback(target,userData,useCapture,callbackfunc,5,"mousedown",targetThread);return 0}function _emscripten_set_mousemove_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerMouseEventCallback(target,userData,useCapture,callbackfunc,8,"mousemove",targetThread);return 0}function _emscripten_set_mouseup_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerMouseEventCallback(target,userData,useCapture,callbackfunc,6,"mouseup",targetThread);return 0}function __registerTouchEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.touchEvent)JSEvents.touchEvent=_malloc(1684);target=__findEventTarget(target);var touchEventHandlerFunc=function(event){var e=event||window.event;var touches={};for(var i=0;i<e.touches.length;++i){var touch=e.touches[i];touches[touch.identifier]=touch}for(var i=0;i<e.changedTouches.length;++i){var touch=e.changedTouches[i];touches[touch.identifier]=touch;touch.changed=true}for(var i=0;i<e.targetTouches.length;++i){var touch=e.targetTouches[i];touches[touch.identifier].onTarget=true}var touchEvent=JSEvents.touchEvent;var ptr=touchEvent;HEAP32[ptr+4>>2]=e.ctrlKey;HEAP32[ptr+8>>2]=e.shiftKey;HEAP32[ptr+12>>2]=e.altKey;HEAP32[ptr+16>>2]=e.metaKey;ptr+=20;var canvasRect=Module["canvas"]?Module["canvas"].getBoundingClientRect():undefined;var targetRect=JSEvents.getBoundingClientRectOrZeros(target);var numTouches=0;for(var i in touches){var t=touches[i];HEAP32[ptr>>2]=t.identifier;HEAP32[ptr+4>>2]=t.screenX;HEAP32[ptr+8>>2]=t.screenY;HEAP32[ptr+12>>2]=t.clientX;HEAP32[ptr+16>>2]=t.clientY;HEAP32[ptr+20>>2]=t.pageX;HEAP32[ptr+24>>2]=t.pageY;HEAP32[ptr+28>>2]=t.changed;HEAP32[ptr+32>>2]=t.onTarget;if(canvasRect){HEAP32[ptr+44>>2]=t.clientX-canvasRect.left;HEAP32[ptr+48>>2]=t.clientY-canvasRect.top}else{HEAP32[ptr+44>>2]=0;HEAP32[ptr+48>>2]=0}HEAP32[ptr+36>>2]=t.clientX-targetRect.left;HEAP32[ptr+40>>2]=t.clientY-targetRect.top;ptr+=52;if(++numTouches>=32){break}}HEAP32[touchEvent>>2]=numTouches;if(dynCall_iiii(callbackfunc,eventTypeId,touchEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:eventTypeString=="touchstart"||eventTypeString=="touchend",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:touchEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_touchcancel_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,25,"touchcancel",targetThread);return 0}function _emscripten_set_touchend_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,23,"touchend",targetThread);return 0}function _emscripten_set_touchmove_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,24,"touchmove",targetThread);return 0}function _emscripten_set_touchstart_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,22,"touchstart",targetThread);return 0}function __registerWheelEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.wheelEvent)JSEvents.wheelEvent=_malloc(104);var wheelHandlerFunc=function(event){var e=event||window.event;var wheelEvent=JSEvents.wheelEvent;__fillMouseEventData(wheelEvent,e,target);HEAPF64[wheelEvent+72>>3]=e["deltaX"];HEAPF64[wheelEvent+80>>3]=e["deltaY"];HEAPF64[wheelEvent+88>>3]=e["deltaZ"];HEAP32[wheelEvent+96>>2]=e["deltaMode"];if(dynCall_iiii(callbackfunc,eventTypeId,wheelEvent,userData))e.preventDefault()};var mouseWheelHandlerFunc=function(event){var e=event||window.event;__fillMouseEventData(JSEvents.wheelEvent,e,target);HEAPF64[JSEvents.wheelEvent+72>>3]=e["wheelDeltaX"]||0;HEAPF64[JSEvents.wheelEvent+80>>3]=-(e["wheelDeltaY"]?e["wheelDeltaY"]:e["wheelDelta"]);HEAPF64[JSEvents.wheelEvent+88>>3]=0;HEAP32[JSEvents.wheelEvent+96>>2]=0;var shouldCancel=dynCall_iiii(callbackfunc,eventTypeId,JSEvents.wheelEvent,userData);if(shouldCancel){e.preventDefault()}};var eventHandler={target:target,allowsDeferredCalls:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:eventTypeString=="wheel"?wheelHandlerFunc:mouseWheelHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_wheel_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){target=__findEventTarget(target);if(typeof target.onwheel!=="undefined"){__registerWheelEventCallback(target,userData,useCapture,callbackfunc,9,"wheel",targetThread);return 0}else if(typeof target.onmousewheel!=="undefined"){__registerWheelEventCallback(target,userData,useCapture,callbackfunc,9,"mousewheel",targetThread);return 0}else{return-1}}var __emscripten_webgl_power_preferences=["default","low-power","high-performance"];function _emscripten_webgl_do_create_context(target,attributes){var contextAttributes={};var a=attributes>>2;contextAttributes["alpha"]=!!HEAP32[a+(0>>2)];contextAttributes["depth"]=!!HEAP32[a+(4>>2)];contextAttributes["stencil"]=!!HEAP32[a+(8>>2)];contextAttributes["antialias"]=!!HEAP32[a+(12>>2)];contextAttributes["premultipliedAlpha"]=!!HEAP32[a+(16>>2)];contextAttributes["preserveDrawingBuffer"]=!!HEAP32[a+(20>>2)];var powerPreference=HEAP32[a+(24>>2)];contextAttributes["powerPreference"]=__emscripten_webgl_power_preferences[powerPreference];contextAttributes["failIfMajorPerformanceCaveat"]=!!HEAP32[a+(28>>2)];contextAttributes.majorVersion=HEAP32[a+(32>>2)];contextAttributes.minorVersion=HEAP32[a+(36>>2)];contextAttributes.enableExtensionsByDefault=HEAP32[a+(40>>2)];contextAttributes.explicitSwapControl=HEAP32[a+(44>>2)];contextAttributes.proxyContextToMainThread=HEAP32[a+(48>>2)];contextAttributes.renderViaOffscreenBackBuffer=HEAP32[a+(52>>2)];var canvas=__findCanvasEventTarget(target);if(!canvas){return 0}if(contextAttributes.explicitSwapControl){return 0}var contextHandle=GL.createContext(canvas,contextAttributes);return contextHandle}function _emscripten_webgl_create_context(a0,a1){return _emscripten_webgl_do_create_context(a0,a1)}function _emscripten_webgl_init_context_attributes(attributes){var a=attributes>>2;for(var i=0;i<56>>2;++i){HEAP32[a+i]=0}HEAP32[a+(0>>2)]=HEAP32[a+(4>>2)]=HEAP32[a+(12>>2)]=HEAP32[a+(16>>2)]=HEAP32[a+(32>>2)]=HEAP32[a+(40>>2)]=1}function _emscripten_webgl_make_context_current(contextHandle){var success=GL.makeContextCurrent(contextHandle);return success?0:-5}function _exit(status){exit(status)}var GAI_ERRNO_MESSAGES={};function _gai_strerror(val){var buflen=256;if(!_gai_strerror.buffer){_gai_strerror.buffer=_malloc(buflen);GAI_ERRNO_MESSAGES["0"]="Success";GAI_ERRNO_MESSAGES[""+-1]="Invalid value for 'ai_flags' field";GAI_ERRNO_MESSAGES[""+-2]="NAME or SERVICE is unknown";GAI_ERRNO_MESSAGES[""+-3]="Temporary failure in name resolution";GAI_ERRNO_MESSAGES[""+-4]="Non-recoverable failure in name res";GAI_ERRNO_MESSAGES[""+-6]="'ai_family' not supported";GAI_ERRNO_MESSAGES[""+-7]="'ai_socktype' not supported";GAI_ERRNO_MESSAGES[""+-8]="SERVICE not supported for 'ai_socktype'";GAI_ERRNO_MESSAGES[""+-10]="Memory allocation failure";GAI_ERRNO_MESSAGES[""+-11]="System error returned in 'errno'";GAI_ERRNO_MESSAGES[""+-12]="Argument buffer overflow"}var msg="Unknown error";if(val in GAI_ERRNO_MESSAGES){if(GAI_ERRNO_MESSAGES[val].length>buflen-1){msg="Message too long"}else{msg=GAI_ERRNO_MESSAGES[val]}}writeAsciiToMemory(msg,_gai_strerror.buffer);return _gai_strerror.buffer}function _getaddrinfo(node,service,hint,out){var addr=0;var port=0;var flags=0;var family=0;var type=0;var proto=0;var ai;function allocaddrinfo(family,type,proto,canon,addr,port){var sa,salen,ai;var res;salen=family===10?28:16;addr=family===10?__inet_ntop6_raw(addr):__inet_ntop4_raw(addr);sa=_malloc(salen);res=__write_sockaddr(sa,family,addr,port);assert(!res.errno);ai=_malloc(32);HEAP32[ai+4>>2]=family;HEAP32[ai+8>>2]=type;HEAP32[ai+12>>2]=proto;HEAP32[ai+24>>2]=canon;HEAP32[ai+20>>2]=sa;if(family===10){HEAP32[ai+16>>2]=28}else{HEAP32[ai+16>>2]=16}HEAP32[ai+28>>2]=0;return ai}if(hint){flags=HEAP32[hint>>2];family=HEAP32[hint+4>>2];type=HEAP32[hint+8>>2];proto=HEAP32[hint+12>>2]}if(type&&!proto){proto=type===2?17:6}if(!type&&proto){type=proto===17?2:1}if(proto===0){proto=6}if(type===0){type=1}if(!node&&!service){return-2}if(flags&~(1|2|4|1024|8|16|32)){return-1}if(hint!==0&&HEAP32[hint>>2]&2&&!node){return-1}if(flags&32){return-2}if(type!==0&&type!==1&&type!==2){return-7}if(family!==0&&family!==2&&family!==10){return-6}if(service){service=UTF8ToString(service);port=parseInt(service,10);if(isNaN(port)){if(flags&1024){return-2}return-8}}if(!node){if(family===0){family=2}if((flags&1)===0){if(family===2){addr=_htonl(2130706433)}else{addr=[0,0,0,1]}}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAP32[out>>2]=ai;return 0}node=UTF8ToString(node);addr=__inet_pton4_raw(node);if(addr!==null){if(family===0||family===2){family=2}else if(family===10&&flags&8){addr=[0,0,_htonl(65535),addr];family=10}else{return-2}}else{addr=__inet_pton6_raw(node);if(addr!==null){if(family===0||family===10){family=10}else{return-2}}}if(addr!=null){ai=allocaddrinfo(family,type,proto,node,addr,port);HEAP32[out>>2]=ai;return 0}if(flags&4){return-2}node=DNS.lookup_name(node);addr=__inet_pton4_raw(node);if(family===0){family=2}else if(family===10){addr=[0,0,_htonl(65535),addr]}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAP32[out>>2]=ai;return 0}function _getenv(name){if(name===0)return 0;name=UTF8ToString(name);if(!ENV.hasOwnProperty(name))return 0;if(_getenv.ret)_free(_getenv.ret);_getenv.ret=allocateUTF8(ENV[name]);return _getenv.ret}function _getnameinfo(sa,salen,node,nodelen,serv,servlen,flags){var info=__read_sockaddr(sa,salen);if(info.errno){return-6}var port=info.port;var addr=info.addr;var overflowed=false;if(node&&nodelen){var lookup;if(flags&1||!(lookup=DNS.lookup_addr(addr))){if(flags&8){return-2}}else{addr=lookup}var numBytesWrittenExclNull=stringToUTF8(addr,node,nodelen);if(numBytesWrittenExclNull+1>=nodelen){overflowed=true}}if(serv&&servlen){port=""+port;var numBytesWrittenExclNull=stringToUTF8(port,serv,servlen);if(numBytesWrittenExclNull+1>=servlen){overflowed=true}}if(overflowed){return-12}return 0}function _gettimeofday(ptr){var now=Date.now();HEAP32[ptr>>2]=now/1e3|0;HEAP32[ptr+4>>2]=now%1e3*1e3|0;return 0}function _glActiveTexture(x0){GLctx["activeTexture"](x0)}function _glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _glBeginTransformFeedback(x0){GLctx["beginTransformFeedback"](x0)}function _glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _glBindBuffer(target,buffer){if(target==35051){GLctx.currentPixelPackBufferBinding=buffer}else if(target==35052){GLctx.currentPixelUnpackBufferBinding=buffer}GLctx.bindBuffer(target,GL.buffers[buffer])}function _glBindBufferBase(target,index,buffer){GLctx["bindBufferBase"](target,index,GL.buffers[buffer])}function _glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,GL.framebuffers[framebuffer])}function _glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,GL.renderbuffers[renderbuffer])}function _glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _glBindVertexArray(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _glBlendEquation(x0){GLctx["blendEquation"](x0)}function _glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _glBlitFramebuffer(x0,x1,x2,x3,x4,x5,x6,x7,x8,x9){GLctx["blitFramebuffer"](x0,x1,x2,x3,x4,x5,x6,x7,x8,x9)}function _glBufferData(target,size,data,usage){if(GL.currentContext.supportsWebGL2EntryPoints){if(data){GLctx.bufferData(target,HEAPU8,usage,data,size)}else{GLctx.bufferData(target,size,usage)}}else{GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}}function _glBufferSubData(target,offset,size,data){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.bufferSubData(target,offset,HEAPU8,data,size);return}GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _glClear(x0){GLctx["clear"](x0)}function _glClearBufferfv(buffer,drawbuffer,value){GLctx["clearBufferfv"](buffer,drawbuffer,HEAPF32,value>>2)}function _glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _glClearDepthf(x0){GLctx["clearDepth"](x0)}function _glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}function _glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,imageSize,data)}else{GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,HEAPU8,data,imageSize)}return}GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _glCompressedTexImage3D(target,level,internalFormat,width,height,depth,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,imageSize,data)}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,HEAPU8,data,imageSize)}}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,data?HEAPU8.subarray(data,data+imageSize):null)}}function _glCompressedTexSubImage2D(target,level,xoffset,yoffset,width,height,format,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,imageSize,data)}else{GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,HEAPU8,data,imageSize)}return}GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,data?HEAPU8.subarray(data,data+imageSize):null)}function _glCompressedTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,imageSize,data)}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,HEAPU8,data,imageSize)}}else{GLctx["compressedTexSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,data?HEAPU8.subarray(data,data+imageSize):null)}}function _glCopyBufferSubData(x0,x1,x2,x3,x4){GLctx["copyBufferSubData"](x0,x1,x2,x3,x4)}function _glCopyTexSubImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexSubImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;GL.programs[id]=program;return id}function _glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _glCullFace(x0){GLctx["cullFace"](x0)}function _glDeleteBuffers(n,buffers){for(var i=0;i<n;i++){var id=HEAP32[buffers+i*4>>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GL.currArrayBuffer)GL.currArrayBuffer=0;if(id==GL.currElementArrayBuffer)GL.currElementArrayBuffer=0;if(id==GLctx.currentPixelPackBufferBinding)GLctx.currentPixelPackBufferBinding=0;if(id==GLctx.currentPixelUnpackBufferBinding)GLctx.currentPixelUnpackBufferBinding=0}}function _glDeleteFramebuffers(n,framebuffers){for(var i=0;i<n;++i){var id=HEAP32[framebuffers+i*4>>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null;GL.programInfos[id]=null}function _glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i<n;i++){var id=HEAP32[renderbuffers+i*4>>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _glDeleteTextures(n,textures){for(var i=0;i<n;i++){var id=HEAP32[textures+i*4>>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _glDeleteVertexArrays(n,vaos){for(var i=0;i<n;i++){var id=HEAP32[vaos+i*4>>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _glDepthFunc(x0){GLctx["depthFunc"](x0)}function _glDepthMask(flag){GLctx.depthMask(!!flag)}function _glDisable(x0){GLctx["disable"](x0)}function _glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _glDrawArraysInstanced(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _glDrawBuffers(n,bufs){var bufArray=__tempFixedLengthArray[n];for(var i=0;i<n;i++){bufArray[i]=HEAP32[bufs+i*4>>2]}GLctx["drawBuffers"](bufArray)}function _glDrawElementsInstanced(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _glEnable(x0){GLctx["enable"](x0)}function _glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _glEndTransformFeedback(){GLctx["endTransformFeedback"]()}function _glFinish(){GLctx["finish"]()}function _glFramebufferRenderbuffer(target,attachment,renderbuffertarget,renderbuffer){GLctx.framebufferRenderbuffer(target,attachment,renderbuffertarget,GL.renderbuffers[renderbuffer])}function _glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _glFramebufferTextureLayer(target,attachment,texture,level,layer){GLctx.framebufferTextureLayer(target,attachment,GL.textures[texture],level,layer)}function _glFrontFace(x0){GLctx["frontFace"](x0)}function _glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _glGenFramebuffers(n,ids){__glGenObject(n,ids,"createFramebuffer",GL.framebuffers)}function _glGenRenderbuffers(n,renderbuffers){__glGenObject(n,renderbuffers,"createRenderbuffer",GL.renderbuffers)}function _glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _glGenVertexArrays(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function _glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,"Float")}function _glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,"Integer")}function _glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}var ptable=GL.programInfos[program];if(!ptable){GL.recordError(1282);return}if(pname==35716){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){HEAP32[p>>2]=ptable.maxUniformLength}else if(pname==35722){if(ptable.maxAttributeLength==-1){program=GL.programs[program];var numAttribs=GLctx.getProgramParameter(program,35721);ptable.maxAttributeLength=0;for(var i=0;i<numAttribs;++i){var activeAttrib=GLctx.getActiveAttrib(program,i);ptable.maxAttributeLength=Math.max(ptable.maxAttributeLength,activeAttrib.name.length+1)}}HEAP32[p>>2]=ptable.maxAttributeLength}else if(pname==35381){if(ptable.maxUniformBlockNameLength==-1){program=GL.programs[program];var numBlocks=GLctx.getProgramParameter(program,35382);ptable.maxUniformBlockNameLength=0;for(var i=0;i<numBlocks;++i){var activeBlockName=GLctx.getActiveUniformBlockName(program,i);ptable.maxUniformBlockNameLength=Math.max(ptable.maxUniformBlockNameLength,activeBlockName.length+1)}}HEAP32[p>>2]=ptable.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(GL.programs[program],pname)}}function _glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source===null||source.length==0?0:source.length+1;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function _glGetString(name_){if(GL.stringCache[name_])return GL.stringCache[name_];var ret;switch(name_){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(exts[i]);gl_exts.push("GL_"+exts[i])}ret=stringToNewUTF8(gl_exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(GLctx.VERSION);if(GL.currentContext.version>=2)glVersion="OpenGL ES 3.0 ("+glVersion+")";else{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280);return 0}GL.stringCache[name_]=ret;return ret}function _glGetStringi(name,index){if(GL.currentContext.version<2){GL.recordError(1282);return 0}var stringiCache=GL.stringiCache[name];if(stringiCache){if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index]}switch(name){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(stringToNewUTF8(exts[i]));gl_exts.push(stringToNewUTF8("GL_"+exts[i]))}stringiCache=GL.stringiCache[name]=gl_exts;if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index];default:GL.recordError(1280);return 0}}function _glGetUniformBlockIndex(program,uniformBlockName){return GLctx["getUniformBlockIndex"](GL.programs[program],UTF8ToString(uniformBlockName))}function _glGetUniformLocation(program,name){name=UTF8ToString(name);var arrayIndex=0;if(name[name.length-1]=="]"){var leftBrace=name.lastIndexOf("[");arrayIndex=name[leftBrace+1]!="]"?parseInt(name.slice(leftBrace+1)):0;name=name.slice(0,leftBrace)}var uniformInfo=GL.programInfos[program]&&GL.programInfos[program].uniforms[name];if(uniformInfo&&arrayIndex>=0&&arrayIndex<uniformInfo[0]){return uniformInfo[1]+arrayIndex}else{return-1}}function _glInvalidateFramebuffer(target,numAttachments,attachments){var list=__tempFixedLengthArray[numAttachments];for(var i=0;i<numAttachments;i++){list[i]=HEAP32[attachments+i*4>>2]}GLctx["invalidateFramebuffer"](target,list)}function _glLinkProgram(program){GLctx.linkProgram(GL.programs[program]);GL.populateUniformTable(program)}function _glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _glReadBuffer(x0){GLctx["readBuffer"](x0)}function _glReadPixels(x,y,width,height,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelPackBufferBinding){GLctx.readPixels(x,y,width,height,format,type,pixels)}else{GLctx.readPixels(x,y,width,height,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}return}var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _glRenderbufferStorageMultisample(x0,x1,x2,x3,x4){GLctx["renderbufferStorageMultisample"](x0,x1,x2,x3,x4)}function _glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels!=0){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,null)}return}GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _glTexImage3D(target,level,internalFormat,width,height,depth,border,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,pixels)}else if(pixels!=0){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,null)}}function _glTexParameterf(x0,x1,x2){GLctx["texParameterf"](x0,x1,x2)}function _glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _glTexStorage2D(x0,x1,x2,x3,x4){GLctx["texStorage2D"](x0,x1,x2,x3,x4)}function _glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels)}else if(pixels!=0){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _glTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels)}else if(pixels!=0){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,__heapObjectForWebGLType(type),pixels>>(__heapAccessShiftForWebGLType[type]|0))}else{GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,null)}}function _glTransformFeedbackVaryings(program,count,varyings,bufferMode){program=GL.programs[program];var vars=[];for(var i=0;i<count;i++)vars.push(UTF8ToString(HEAP32[varyings+i*4>>2]));GLctx["transformFeedbackVaryings"](program,vars,bufferMode)}function _glUniform1f(location,v0){GLctx.uniform1f(GL.uniforms[location],v0)}function _glUniform1i(location,v0){GLctx.uniform1i(GL.uniforms[location],v0)}function _glUniform1iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform1iv(GL.uniforms[location],HEAP32,value>>2,count);return}GLctx.uniform1iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*4>>2))}function _glUniform1ui(location,v0){GLctx.uniform1ui(GL.uniforms[location],v0)}function _glUniform2f(location,v0,v1){GLctx.uniform2f(GL.uniforms[location],v0,v1)}function _glUniform2fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2fv(GL.uniforms[location],HEAPF32,value>>2,count*2);return}if(2*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(GL.uniforms[location],view)}function _glUniform2i(location,v0,v1){GLctx.uniform2i(GL.uniforms[location],v0,v1)}function _glUniform2iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2iv(GL.uniforms[location],HEAP32,value>>2,count*2);return}GLctx.uniform2iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*8>>2))}function _glUniform3f(location,v0,v1,v2){GLctx.uniform3f(GL.uniforms[location],v0,v1,v2)}function _glUniform3fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform3fv(GL.uniforms[location],HEAPF32,value>>2,count*3);return}if(3*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(GL.uniforms[location],view)}function _glUniform3i(location,v0,v1,v2){GLctx.uniform3i(GL.uniforms[location],v0,v1,v2)}function _glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(GL.uniforms[location],v0,v1,v2,v3)}function _glUniform4fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform4fv(GL.uniforms[location],HEAPF32,value>>2,count*4);return}if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(GL.uniforms[location],view)}function _glUniform4i(location,v0,v1,v2,v3){GLctx.uniform4i(GL.uniforms[location],v0,v1,v2,v3)}function _glUniformBlockBinding(program,uniformBlockIndex,uniformBlockBinding){program=GL.programs[program];GLctx["uniformBlockBinding"](program,uniformBlockIndex,uniformBlockBinding)}function _glUniformMatrix2fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix2fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*4);return}if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniformMatrix2fv(GL.uniforms[location],!!transpose,view)}function _glUniformMatrix3fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix3fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*9);return}if(9*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[9*count-1];for(var i=0;i<9*count;i+=9){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*36>>2)}GLctx.uniformMatrix3fv(GL.uniforms[location],!!transpose,view)}function _glUniformMatrix4fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*16);return}if(16*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[16*count-1];for(var i=0;i<16*count;i+=16){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2];view[i+9]=HEAPF32[value+(4*i+36)>>2];view[i+10]=HEAPF32[value+(4*i+40)>>2];view[i+11]=HEAPF32[value+(4*i+44)>>2];view[i+12]=HEAPF32[value+(4*i+48)>>2];view[i+13]=HEAPF32[value+(4*i+52)>>2];view[i+14]=HEAPF32[value+(4*i+56)>>2];view[i+15]=HEAPF32[value+(4*i+60)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,view)}function _glUseProgram(program){GLctx.useProgram(GL.programs[program])}function _glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _glVertexAttrib4fv(index,v){GLctx.vertexAttrib4f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2],HEAPF32[v+12>>2])}function _glVertexAttribDivisor(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _glVertexAttribI4ui(x0,x1,x2,x3,x4){GLctx["vertexAttribI4ui"](x0,x1,x2,x3,x4)}function _glVertexAttribIPointer(index,size,type,stride,ptr){GLctx["vertexAttribIPointer"](index,size,type,stride,ptr)}function _glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}var ___tm_current=1685920;var ___tm_timezone=(stringToUTF8("GMT",1685968,4),1685968);function _gmtime_r(time,tmPtr){var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getUTCSeconds();HEAP32[tmPtr+4>>2]=date.getUTCMinutes();HEAP32[tmPtr+8>>2]=date.getUTCHours();HEAP32[tmPtr+12>>2]=date.getUTCDate();HEAP32[tmPtr+16>>2]=date.getUTCMonth();HEAP32[tmPtr+20>>2]=date.getUTCFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getUTCDay();HEAP32[tmPtr+36>>2]=0;HEAP32[tmPtr+32>>2]=0;var start=Date.UTC(date.getUTCFullYear(),0,1,0,0,0,0);var yday=(date.getTime()-start)/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+40>>2]=___tm_timezone;return tmPtr}function _gmtime(time){return _gmtime_r(time,___tm_current)}var GodotHTTPRequest={requests:[],getUnusedRequestId:function(){var idMax=GodotHTTPRequest.requests.length;for(var potentialId=0;potentialId<idMax;++potentialId){if(GodotHTTPRequest.requests[potentialId]instanceof XMLHttpRequest){continue}return potentialId}GodotHTTPRequest.requests.push(null);return idMax},setupRequest:function(xhr){xhr.responseType="arraybuffer"}};function _godot_xhr_free(xhrId){GodotHTTPRequest.requests[xhrId].abort();GodotHTTPRequest.requests[xhrId]=null}function _godot_xhr_get_ready_state(xhrId){return GodotHTTPRequest.requests[xhrId].readyState}function _godot_xhr_get_response(xhrId,dst,len){var buf=GodotHTTPRequest.requests[xhrId].response;if(buf===null)return;buf=new Uint8Array(buf).subarray(0,len);HEAPU8.set(buf,dst)}function _godot_xhr_get_response_headers(xhrId,dst,len){var str=GodotHTTPRequest.requests[xhrId].getAllResponseHeaders();if(str===null)return;var buf=new Uint8Array(len+1);stringToUTF8Array(str,buf,0,buf.length);buf=buf.subarray(0,-1);HEAPU8.set(buf,dst)}function _godot_xhr_get_response_headers_length(xhrId){var headers=GodotHTTPRequest.requests[xhrId].getAllResponseHeaders();return headers===null?0:lengthBytesUTF8(headers)}function _godot_xhr_get_response_length(xhrId){var body=GodotHTTPRequest.requests[xhrId].response;return body===null?0:body.byteLength}function _godot_xhr_get_status(xhrId){return GodotHTTPRequest.requests[xhrId].status}function _godot_xhr_new(){var newId=GodotHTTPRequest.getUnusedRequestId();GodotHTTPRequest.requests[newId]=new XMLHttpRequest;GodotHTTPRequest.setupRequest(GodotHTTPRequest.requests[newId]);return newId}function _godot_xhr_open(xhrId,method,url,user,password){user=user>0?UTF8ToString(user):null;password=password>0?UTF8ToString(password):null;GodotHTTPRequest.requests[xhrId].open(UTF8ToString(method),UTF8ToString(url),true,user,password)}function _godot_xhr_reset(xhrId){GodotHTTPRequest.requests[xhrId]=new XMLHttpRequest;GodotHTTPRequest.setupRequest(GodotHTTPRequest.requests[xhrId])}function _godot_xhr_send_data(xhrId,ptr,len){if(!ptr){err("Failed to send data per XHR: null pointer");return}if(len<0){err("Failed to send data per XHR: buffer length less than 0");return}GodotHTTPRequest.requests[xhrId].send(HEAPU8.subarray(ptr,ptr+len))}function _godot_xhr_send_string(xhrId,strPtr){if(!strPtr){err("Failed to send string per XHR: null pointer");return}GodotHTTPRequest.requests[xhrId].send(UTF8ToString(strPtr))}function _godot_xhr_set_request_header(xhrId,header,value){GodotHTTPRequest.requests[xhrId].setRequestHeader(UTF8ToString(header),UTF8ToString(value))}function _inet_addr(ptr){var addr=__inet_pton4_raw(UTF8ToString(ptr));if(addr===null){return-1}return addr}function _kill(pid,sig){___setErrNo(ERRNO_CODES.EPERM);return-1}function _llvm_bswap_i64(l,h){var retl=_llvm_bswap_i32(h)>>>0;var reth=_llvm_bswap_i32(l)>>>0;return(setTempRet0(reth),retl)|0}function _llvm_exp2_f32(x){return Math.pow(2,x)}function _llvm_exp2_f64(a0){return _llvm_exp2_f32(a0)}function _llvm_log10_f32(x){return Math.log(x)/Math.LN10}function _llvm_log10_f64(a0){return _llvm_log10_f32(a0)}function _llvm_log2_f32(x){return Math.log(x)/Math.LN2}function _llvm_stackrestore(p){var self=_llvm_stacksave;var ret=self.LLVM_SAVEDSTACKS[p];self.LLVM_SAVEDSTACKS.splice(p,1);stackRestore(ret)}function _llvm_stacksave(){var self=_llvm_stacksave;if(!self.LLVM_SAVEDSTACKS){self.LLVM_SAVEDSTACKS=[]}self.LLVM_SAVEDSTACKS.push(stackSave());return self.LLVM_SAVEDSTACKS.length-1}function _llvm_trap(){abort("trap!")}function _tzset(){if(_tzset.called)return;_tzset.called=true;HEAP32[__get_timezone()>>2]=(new Date).getTimezoneOffset()*60;var winter=new Date(2e3,0,1);var summer=new Date(2e3,6,1);HEAP32[__get_daylight()>>2]=Number(winter.getTimezoneOffset()!=summer.getTimezoneOffset());function extractZone(date){var match=date.toTimeString().match(/\(([A-Za-z ]+)\)$/);return match?match[1]:"GMT"}var winterName=extractZone(winter);var summerName=extractZone(summer);var winterNamePtr=allocate(intArrayFromString(winterName),"i8",ALLOC_NORMAL);var summerNamePtr=allocate(intArrayFromString(summerName),"i8",ALLOC_NORMAL);if(summer.getTimezoneOffset()<winter.getTimezoneOffset()){HEAP32[__get_tzname()>>2]=winterNamePtr;HEAP32[__get_tzname()+4>>2]=summerNamePtr}else{HEAP32[__get_tzname()>>2]=summerNamePtr;HEAP32[__get_tzname()+4>>2]=winterNamePtr}}function _localtime_r(time,tmPtr){_tzset();var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getSeconds();HEAP32[tmPtr+4>>2]=date.getMinutes();HEAP32[tmPtr+8>>2]=date.getHours();HEAP32[tmPtr+12>>2]=date.getDate();HEAP32[tmPtr+16>>2]=date.getMonth();HEAP32[tmPtr+20>>2]=date.getFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getDay();var start=new Date(date.getFullYear(),0,1);var yday=(date.getTime()-start.getTime())/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+36>>2]=-(date.getTimezoneOffset()*60);var summerOffset=new Date(2e3,6,1).getTimezoneOffset();var winterOffset=start.getTimezoneOffset();var dst=(summerOffset!=winterOffset&&date.getTimezoneOffset()==Math.min(winterOffset,summerOffset))|0;HEAP32[tmPtr+32>>2]=dst;var zonePtr=HEAP32[__get_tzname()+(dst?4:0)>>2];HEAP32[tmPtr+40>>2]=zonePtr;return tmPtr}function _localtime(time){return _localtime_r(time,___tm_current)}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest)}function _usleep(useconds){var msec=useconds/1e3;if((ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&self["performance"]&&self["performance"]["now"]){var start=self["performance"]["now"]();while(self["performance"]["now"]()-start<msec){}}else{var start=Date.now();while(Date.now()-start<msec){}}return 0}function _nanosleep(rqtp,rmtp){var seconds=HEAP32[rqtp>>2];var nanoseconds=HEAP32[rqtp+4>>2];if(rmtp!==0){HEAP32[rmtp>>2]=0;HEAP32[rmtp+4>>2]=0}return _usleep(seconds*1e6+nanoseconds/1e3)}function _setenv(envname,envval,overwrite){if(envname===0){___setErrNo(22);return-1}var name=UTF8ToString(envname);var val=UTF8ToString(envval);if(name===""||name.indexOf("=")!==-1){___setErrNo(22);return-1}if(ENV.hasOwnProperty(name)&&!overwrite)return 0;ENV[name]=val;___buildEnvironment(__get_environ());return 0}function _sigaction(signum,act,oldact){return 0}function _sigemptyset(set){HEAP32[set>>2]=0;return 0}function __isLeapYear(year){return year%4===0&&(year%100!==0||year%400===0)}function __arraySum(array,index){var sum=0;for(var i=0;i<=index;sum+=array[i++]);return sum}var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31];var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date,days){var newDate=new Date(date.getTime());while(days>0){var leap=__isLeapYear(newDate.getFullYear());var currentMonth=newDate.getMonth();var daysInCurrentMonth=(leap?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR)[currentMonth];if(days>daysInCurrentMonth-newDate.getDate()){days-=daysInCurrentMonth-newDate.getDate()+1;newDate.setDate(1);if(currentMonth<11){newDate.setMonth(currentMonth+1)}else{newDate.setMonth(0);newDate.setFullYear(newDate.getFullYear()+1)}}else{newDate.setDate(newDate.getDate()+days);return newDate}}return newDate}function _strftime(s,maxsize,format,tm){var tm_zone=HEAP32[tm+40>>2];var date={tm_sec:HEAP32[tm>>2],tm_min:HEAP32[tm+4>>2],tm_hour:HEAP32[tm+8>>2],tm_mday:HEAP32[tm+12>>2],tm_mon:HEAP32[tm+16>>2],tm_year:HEAP32[tm+20>>2],tm_wday:HEAP32[tm+24>>2],tm_yday:HEAP32[tm+28>>2],tm_isdst:HEAP32[tm+32>>2],tm_gmtoff:HEAP32[tm+36>>2],tm_zone:tm_zone?UTF8ToString(tm_zone):""};var pattern=UTF8ToString(format);var EXPANSION_RULES_1={"%c":"%a %b %d %H:%M:%S %Y","%D":"%m/%d/%y","%F":"%Y-%m-%d","%h":"%b","%r":"%I:%M:%S %p","%R":"%H:%M","%T":"%H:%M:%S","%x":"%m/%d/%y","%X":"%H:%M:%S"};for(var rule in EXPANSION_RULES_1){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_1[rule])}var WEEKDAYS=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"];var MONTHS=["January","February","March","April","May","June","July","August","September","October","November","December"];function leadingSomething(value,digits,character){var str=typeof value==="number"?value.toString():value||"";while(str.length<digits){str=character[0]+str}return str}function leadingNulls(value,digits){return leadingSomething(value,digits,"0")}function compareByDay(date1,date2){function sgn(value){return value<0?-1:value>0?1:0}var compare;if((compare=sgn(date1.getFullYear()-date2.getFullYear()))===0){if((compare=sgn(date1.getMonth()-date2.getMonth()))===0){compare=sgn(date1.getDate()-date2.getDate())}}return compare}function getFirstWeekStartDate(janFourth){switch(janFourth.getDay()){case 0:return new Date(janFourth.getFullYear()-1,11,29);case 1:return janFourth;case 2:return new Date(janFourth.getFullYear(),0,3);case 3:return new Date(janFourth.getFullYear(),0,2);case 4:return new Date(janFourth.getFullYear(),0,1);case 5:return new Date(janFourth.getFullYear()-1,11,31);case 6:return new Date(janFourth.getFullYear()-1,11,30)}}function getWeekBasedYear(date){var thisDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);var janFourthThisYear=new Date(thisDate.getFullYear(),0,4);var janFourthNextYear=new Date(thisDate.getFullYear()+1,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);if(compareByDay(firstWeekStartThisYear,thisDate)<=0){if(compareByDay(firstWeekStartNextYear,thisDate)<=0){return thisDate.getFullYear()+1}else{return thisDate.getFullYear()}}else{return thisDate.getFullYear()-1}}var EXPANSION_RULES_2={"%a":function(date){return WEEKDAYS[date.tm_wday].substring(0,3)},"%A":function(date){return WEEKDAYS[date.tm_wday]},"%b":function(date){return MONTHS[date.tm_mon].substring(0,3)},"%B":function(date){return MONTHS[date.tm_mon]},"%C":function(date){var year=date.tm_year+1900;return leadingNulls(year/100|0,2)},"%d":function(date){return leadingNulls(date.tm_mday,2)},"%e":function(date){return leadingSomething(date.tm_mday,2," ")},"%g":function(date){return getWeekBasedYear(date).toString().substring(2)},"%G":function(date){return getWeekBasedYear(date)},"%H":function(date){return leadingNulls(date.tm_hour,2)},"%I":function(date){var twelveHour=date.tm_hour;if(twelveHour==0)twelveHour=12;else if(twelveHour>12)twelveHour-=12;return leadingNulls(twelveHour,2)},"%j":function(date){return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900)?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,date.tm_mon-1),3)},"%m":function(date){return leadingNulls(date.tm_mon+1,2)},"%M":function(date){return leadingNulls(date.tm_min,2)},"%n":function(){return"\n"},"%p":function(date){if(date.tm_hour>=0&&date.tm_hour<12){return"AM"}else{return"PM"}},"%S":function(date){return leadingNulls(date.tm_sec,2)},"%t":function(){return"\t"},"%u":function(date){var day=new Date(date.tm_year+1900,date.tm_mon+1,date.tm_mday,0,0,0,0);return day.getDay()||7},"%U":function(date){var janFirst=new Date(date.tm_year+1900,0,1);var firstSunday=janFirst.getDay()===0?janFirst:__addDays(janFirst,7-janFirst.getDay());var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstSunday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstSundayUntilEndJanuary=31-firstSunday.getDate();var days=firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstSunday,janFirst)===0?"01":"00"},"%V":function(date){var janFourthThisYear=new Date(date.tm_year+1900,0,4);var janFourthNextYear=new Date(date.tm_year+1901,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);var endDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);if(compareByDay(endDate,firstWeekStartThisYear)<0){return"53"}if(compareByDay(firstWeekStartNextYear,endDate)<=0){return"01"}var daysDifference;if(firstWeekStartThisYear.getFullYear()<date.tm_year+1900){daysDifference=date.tm_yday+32-firstWeekStartThisYear.getDate()}else{daysDifference=date.tm_yday+1-firstWeekStartThisYear.getDate()}return leadingNulls(Math.ceil(daysDifference/7),2)},"%w":function(date){var day=new Date(date.tm_year+1900,date.tm_mon+1,date.tm_mday,0,0,0,0);return day.getDay()},"%W":function(date){var janFirst=new Date(date.tm_year,0,1);var firstMonday=janFirst.getDay()===1?janFirst:__addDays(janFirst,janFirst.getDay()===0?1:7-janFirst.getDay()+1);var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstMonday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstMondayUntilEndJanuary=31-firstMonday.getDate();var days=firstMondayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstMonday,janFirst)===0?"01":"00"},"%y":function(date){return(date.tm_year+1900).toString().substring(2)},"%Y":function(date){return date.tm_year+1900},"%z":function(date){var off=date.tm_gmtoff;var ahead=off>=0;off=Math.abs(off)/60;off=off/60*100+off%60;return(ahead?"+":"-")+String("0000"+off).slice(-4)},"%Z":function(date){return date.tm_zone},"%%":function(){return"%"}};for(var rule in EXPANSION_RULES_2){if(pattern.indexOf(rule)>=0){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_2[rule](date))}}var bytes=intArrayFromString(pattern,false);if(bytes.length>maxsize){return 0}writeArrayToMemory(bytes,s);return bytes.length-1}function _sysconf(name){switch(name){case 30:return PAGE_SIZE;case 85:var maxHeapSize=2*1024*1024*1024-65536;return maxHeapSize/PAGE_SIZE;case 132:case 133:case 12:case 137:case 138:case 15:case 235:case 16:case 17:case 18:case 19:case 20:case 149:case 13:case 10:case 236:case 153:case 9:case 21:case 22:case 159:case 154:case 14:case 77:case 78:case 139:case 80:case 81:case 82:case 68:case 67:case 164:case 11:case 29:case 47:case 48:case 95:case 52:case 51:case 46:return 200809;case 79:return 0;case 27:case 246:case 127:case 128:case 23:case 24:case 160:case 161:case 181:case 182:case 242:case 183:case 184:case 243:case 244:case 245:case 165:case 178:case 179:case 49:case 50:case 168:case 169:case 175:case 170:case 171:case 172:case 97:case 76:case 32:case 173:case 35:return-1;case 176:case 177:case 7:case 155:case 8:case 157:case 125:case 126:case 92:case 93:case 129:case 130:case 131:case 94:case 91:return 1;case 74:case 60:case 69:case 70:case 4:return 1024;case 31:case 42:case 72:return 32;case 87:case 26:case 33:return 2147483647;case 34:case 1:return 47839;case 38:case 36:return 99;case 43:case 37:return 2048;case 0:return 2097152;case 3:return 65536;case 28:return 32768;case 44:return 32767;case 75:return 16384;case 39:return 1e3;case 89:return 700;case 71:return 256;case 40:return 255;case 2:return 100;case 180:return 64;case 25:return 20;case 5:return 16;case 6:return 6;case 73:return 4;case 84:{if(typeof navigator==="object")return navigator["hardwareConcurrency"]||1;return 1}}___setErrNo(22);return-1}function _time(ptr){var ret=Date.now()/1e3|0;if(ptr){HEAP32[ptr>>2]=ret}return ret}function _wait(stat_loc){___setErrNo(10);return-1}function _waitpid(){return _wait.apply(null,arguments)}FS.staticInit();if(ENVIRONMENT_IS_NODE){var fs=require("fs");var NODEJS_PATH=require("path");NODEFS.staticInit()}if(ENVIRONMENT_IS_NODE){_emscripten_get_now=function _emscripten_get_now_actual(){var t=process["hrtime"]();return t[0]*1e3+t[1]/1e6}}else if(typeof dateNow!=="undefined"){_emscripten_get_now=dateNow}else if(typeof performance==="object"&&performance&&typeof performance["now"]==="function"){_emscripten_get_now=function(){return performance["now"]()}}else{_emscripten_get_now=Date.now}Module["requestFullScreen"]=function Module_requestFullScreen(lockPointer,resizeCanvas,vrDevice){err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead.");Module["requestFullScreen"]=Module["requestFullscreen"];Browser.requestFullScreen(lockPointer,resizeCanvas,vrDevice)};Module["requestFullscreen"]=function Module_requestFullscreen(lockPointer,resizeCanvas,vrDevice){Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)};Module["requestAnimationFrame"]=function Module_requestAnimationFrame(func){Browser.requestAnimationFrame(func)};Module["setCanvasSize"]=function Module_setCanvasSize(width,height,noUpdates){Browser.setCanvasSize(width,height,noUpdates)};Module["pauseMainLoop"]=function Module_pauseMainLoop(){Browser.mainLoop.pause()};Module["resumeMainLoop"]=function Module_resumeMainLoop(){Browser.mainLoop.resume()};Module["getUserMedia"]=function Module_getUserMedia(){Browser.getUserMedia()};Module["createContext"]=function Module_createContext(canvas,useWebGL,setInModule,webGLContextAttributes){return Browser.createContext(canvas,useWebGL,setInModule,webGLContextAttributes)};var GLctx;GL.init();for(var i=0;i<32;i++)__tempFixedLengthArray.push(new Array(i));function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}function invoke_i(index){var sp=stackSave();try{return dynCall_i(index)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_ii(index,a1){var sp=stackSave();try{return dynCall_ii(index,a1)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iii(index,a1,a2){var sp=stackSave();try{return dynCall_iii(index,a1,a2)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiii(index,a1,a2,a3){var sp=stackSave();try{return dynCall_iiii(index,a1,a2,a3)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiii(index,a1,a2,a3,a4){var sp=stackSave();try{return dynCall_iiiii(index,a1,a2,a3,a4)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiiii(index,a1,a2,a3,a4,a5){var sp=stackSave();try{return dynCall_iiiiii(index,a1,a2,a3,a4,a5)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6){var sp=stackSave();try{return dynCall_iiiiiii(index,a1,a2,a3,a4,a5,a6)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7){var sp=stackSave();try{return dynCall_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){var sp=stackSave();try{return dynCall_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_iiiij(index,a1,a2,a3,a4,a5){var sp=stackSave();try{return dynCall_iiiij(index,a1,a2,a3,a4,a5)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_v(index){var sp=stackSave();try{dynCall_v(index)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_vi(index,a1){var sp=stackSave();try{dynCall_vi(index,a1)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_vii(index,a1,a2){var sp=stackSave();try{dynCall_vii(index,a1,a2)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viii(index,a1,a2,a3){var sp=stackSave();try{dynCall_viii(index,a1,a2,a3)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viiii(index,a1,a2,a3,a4){var sp=stackSave();try{dynCall_viiii(index,a1,a2,a3,a4)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viiiii(index,a1,a2,a3,a4,a5){var sp=stackSave();try{dynCall_viiiii(index,a1,a2,a3,a4,a5)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6){var sp=stackSave();try{dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7){var sp=stackSave();try{dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){var sp=stackSave();try{dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){stackRestore(sp);if(e!==e+0&&e!=="longjmp")throw e;_setThrew(1,0)}}var asmGlobalArg={};var asmLibraryArg={"o":abort,"i":setTempRet0,"g":getTempRet0,"Fb":invoke_i,"P":invoke_ii,"fa":invoke_iii,"ja":invoke_iiii,"Ra":invoke_iiiii,"ic":invoke_iiiiii,"hc":invoke_iiiiiii,"gc":invoke_iiiiiiii,"Xa":invoke_iiiiiiiiii,"bc":invoke_iiiij,"Eb":invoke_v,"B":invoke_vi,"I":invoke_vii,"da":invoke_viii,"ka":invoke_viiii,"Y":invoke_viiiii,"fc":invoke_viiiiii,"Db":invoke_viiiiiii,"Cb":invoke_viiiiiiiii,"c":___assert_fail,"Ui":___buildEnvironment,"Ti":___cxa_pure_virtual,"Si":___lock,"ac":___setErrNo,"Ri":___syscall10,"za":___syscall102,"Qi":___syscall12,"Pi":___syscall140,"Oi":___syscall142,"Ni":___syscall145,"$b":___syscall146,"Mi":___syscall15,"Li":___syscall168,"Ki":___syscall183,"Ji":___syscall195,"Ii":___syscall20,"Hi":___syscall220,"ea":___syscall221,"Gi":___syscall268,"Fi":___syscall3,"Ei":___syscall33,"Di":___syscall38,"Ci":___syscall39,"Bi":___syscall4,"Ai":___syscall40,"_b":___syscall5,"Bb":___syscall54,"Na":___syscall6,"Ab":___unlock,"zb":_abort,"Zb":_clock_gettime,"zi":_dlclose,"yb":_dlerror,"yi":_dlopen,"xi":_dlsym,"Yb":_eglGetProcAddress,"ia":_emscripten_asm_const_i,"na":_emscripten_asm_const_ii,"wi":_emscripten_asm_const_iii,"xb":_emscripten_asm_const_iiii,"wb":_emscripten_asm_const_iiiii,"vi":_emscripten_asm_const_iiiiii,"Xb":_emscripten_enter_soft_fullscreen,"ui":_emscripten_exit_fullscreen,"Wb":_emscripten_exit_pointerlock,"vb":_emscripten_exit_soft_fullscreen,"Vb":_emscripten_get_canvas_element_size,"ti":_emscripten_get_fullscreen_status,"si":_emscripten_get_gamepad_status,"ri":_emscripten_get_heap_size,"qi":_emscripten_get_num_gamepads,"pi":_emscripten_get_pointerlock_status,"oi":_emscripten_glActiveTexture,"ni":_emscripten_glAttachShader,"mi":_emscripten_glBeginQuery,"li":_emscripten_glBeginQueryEXT,"ki":_emscripten_glBeginTransformFeedback,"ji":_emscripten_glBindAttribLocation,"ii":_emscripten_glBindBuffer,"hi":_emscripten_glBindBufferBase,"gi":_emscripten_glBindBufferRange,"fi":_emscripten_glBindFramebuffer,"ei":_emscripten_glBindRenderbuffer,"di":_emscripten_glBindSampler,"ci":_emscripten_glBindTexture,"bi":_emscripten_glBindTransformFeedback,"ai":_emscripten_glBindVertexArray,"$h":_emscripten_glBindVertexArrayOES,"_h":_emscripten_glBlendColor,"Zh":_emscripten_glBlendEquation,"Yh":_emscripten_glBlendEquationSeparate,"Xh":_emscripten_glBlendFunc,"Wh":_emscripten_glBlendFuncSeparate,"Vh":_emscripten_glBlitFramebuffer,"Uh":_emscripten_glBufferData,"Th":_emscripten_glBufferSubData,"Sh":_emscripten_glCheckFramebufferStatus,"Rh":_emscripten_glClear,"Qh":_emscripten_glClearBufferfi,"Ph":_emscripten_glClearBufferfv,"Oh":_emscripten_glClearBufferiv,"Nh":_emscripten_glClearBufferuiv,"Mh":_emscripten_glClearColor,"Lh":_emscripten_glClearDepthf,"Kh":_emscripten_glClearStencil,"ec":_emscripten_glClientWaitSync,"Jh":_emscripten_glColorMask,"Ih":_emscripten_glCompileShader,"Hh":_emscripten_glCompressedTexImage2D,"Gh":_emscripten_glCompressedTexImage3D,"Fh":_emscripten_glCompressedTexSubImage2D,"Eh":_emscripten_glCompressedTexSubImage3D,"Dh":_emscripten_glCopyBufferSubData,"Ch":_emscripten_glCopyTexImage2D,"Bh":_emscripten_glCopyTexSubImage2D,"Ah":_emscripten_glCopyTexSubImage3D,"zh":_emscripten_glCreateProgram,"yh":_emscripten_glCreateShader,"xh":_emscripten_glCullFace,"wh":_emscripten_glDeleteBuffers,"vh":_emscripten_glDeleteFramebuffers,"uh":_emscripten_glDeleteProgram,"th":_emscripten_glDeleteQueries,"sh":_emscripten_glDeleteQueriesEXT,"rh":_emscripten_glDeleteRenderbuffers,"qh":_emscripten_glDeleteSamplers,"ph":_emscripten_glDeleteShader,"oh":_emscripten_glDeleteSync,"nh":_emscripten_glDeleteTextures,"mh":_emscripten_glDeleteTransformFeedbacks,"lh":_emscripten_glDeleteVertexArrays,"kh":_emscripten_glDeleteVertexArraysOES,"jh":_emscripten_glDepthFunc,"ih":_emscripten_glDepthMask,"hh":_emscripten_glDepthRangef,"gh":_emscripten_glDetachShader,"fh":_emscripten_glDisable,"eh":_emscripten_glDisableVertexAttribArray,"dh":_emscripten_glDrawArrays,"ch":_emscripten_glDrawArraysInstanced,"bh":_emscripten_glDrawArraysInstancedANGLE,"ah":_emscripten_glDrawArraysInstancedARB,"$g":_emscripten_glDrawArraysInstancedEXT,"_g":_emscripten_glDrawArraysInstancedNV,"Zg":_emscripten_glDrawBuffers,"Yg":_emscripten_glDrawBuffersEXT,"Xg":_emscripten_glDrawBuffersWEBGL,"Wg":_emscripten_glDrawElements,"Vg":_emscripten_glDrawElementsInstanced,"Ug":_emscripten_glDrawElementsInstancedANGLE,"Tg":_emscripten_glDrawElementsInstancedARB,"Sg":_emscripten_glDrawElementsInstancedEXT,"Rg":_emscripten_glDrawElementsInstancedNV,"Qg":_emscripten_glDrawRangeElements,"Pg":_emscripten_glEnable,"Og":_emscripten_glEnableVertexAttribArray,"Ng":_emscripten_glEndQuery,"Mg":_emscripten_glEndQueryEXT,"Lg":_emscripten_glEndTransformFeedback,"Kg":_emscripten_glFenceSync,"Jg":_emscripten_glFinish,"Ig":_emscripten_glFlush,"Hg":_emscripten_glFlushMappedBufferRange,"Gg":_emscripten_glFramebufferRenderbuffer,"Fg":_emscripten_glFramebufferTexture2D,"Eg":_emscripten_glFramebufferTextureLayer,"Dg":_emscripten_glFrontFace,"Cg":_emscripten_glGenBuffers,"Bg":_emscripten_glGenFramebuffers,"Ag":_emscripten_glGenQueries,"zg":_emscripten_glGenQueriesEXT,"yg":_emscripten_glGenRenderbuffers,"xg":_emscripten_glGenSamplers,"wg":_emscripten_glGenTextures,"vg":_emscripten_glGenTransformFeedbacks,"ug":_emscripten_glGenVertexArrays,"tg":_emscripten_glGenVertexArraysOES,"sg":_emscripten_glGenerateMipmap,"rg":_emscripten_glGetActiveAttrib,"qg":_emscripten_glGetActiveUniform,"pg":_emscripten_glGetActiveUniformBlockName,"og":_emscripten_glGetActiveUniformBlockiv,"ng":_emscripten_glGetActiveUniformsiv,"mg":_emscripten_glGetAttachedShaders,"lg":_emscripten_glGetAttribLocation,"kg":_emscripten_glGetBooleanv,"jg":_emscripten_glGetBufferParameteri64v,"ig":_emscripten_glGetBufferParameteriv,"hg":_emscripten_glGetBufferPointerv,"gg":_emscripten_glGetError,"fg":_emscripten_glGetFloatv,"eg":_emscripten_glGetFragDataLocation,"dg":_emscripten_glGetFramebufferAttachmentParameteriv,"cg":_emscripten_glGetInteger64i_v,"bg":_emscripten_glGetInteger64v,"ag":_emscripten_glGetIntegeri_v,"$f":_emscripten_glGetIntegerv,"_f":_emscripten_glGetInternalformativ,"Zf":_emscripten_glGetProgramBinary,"Yf":_emscripten_glGetProgramInfoLog,"Xf":_emscripten_glGetProgramiv,"Wf":_emscripten_glGetQueryObjecti64vEXT,"Vf":_emscripten_glGetQueryObjectivEXT,"Uf":_emscripten_glGetQueryObjectui64vEXT,"Tf":_emscripten_glGetQueryObjectuiv,"Sf":_emscripten_glGetQueryObjectuivEXT,"Rf":_emscripten_glGetQueryiv,"Qf":_emscripten_glGetQueryivEXT,"Pf":_emscripten_glGetRenderbufferParameteriv,"Of":_emscripten_glGetSamplerParameterfv,"Nf":_emscripten_glGetSamplerParameteriv,"Mf":_emscripten_glGetShaderInfoLog,"Lf":_emscripten_glGetShaderPrecisionFormat,"Kf":_emscripten_glGetShaderSource,"Jf":_emscripten_glGetShaderiv,"If":_emscripten_glGetString,"Hf":_emscripten_glGetStringi,"Gf":_emscripten_glGetSynciv,"Ff":_emscripten_glGetTexParameterfv,"Ef":_emscripten_glGetTexParameteriv,"Df":_emscripten_glGetTransformFeedbackVarying,"Cf":_emscripten_glGetUniformBlockIndex,"Bf":_emscripten_glGetUniformIndices,"Af":_emscripten_glGetUniformLocation,"zf":_emscripten_glGetUniformfv,"yf":_emscripten_glGetUniformiv,"xf":_emscripten_glGetUniformuiv,"wf":_emscripten_glGetVertexAttribIiv,"vf":_emscripten_glGetVertexAttribIuiv,"uf":_emscripten_glGetVertexAttribPointerv,"tf":_emscripten_glGetVertexAttribfv,"sf":_emscripten_glGetVertexAttribiv,"rf":_emscripten_glHint,"qf":_emscripten_glInvalidateFramebuffer,"pf":_emscripten_glInvalidateSubFramebuffer,"of":_emscripten_glIsBuffer,"nf":_emscripten_glIsEnabled,"mf":_emscripten_glIsFramebuffer,"lf":_emscripten_glIsProgram,"kf":_emscripten_glIsQuery,"jf":_emscripten_glIsQueryEXT,"hf":_emscripten_glIsRenderbuffer,"gf":_emscripten_glIsSampler,"ff":_emscripten_glIsShader,"ef":_emscripten_glIsSync,"df":_emscripten_glIsTexture,"cf":_emscripten_glIsTransformFeedback,"bf":_emscripten_glIsVertexArray,"af":_emscripten_glIsVertexArrayOES,"$e":_emscripten_glLineWidth,"_e":_emscripten_glLinkProgram,"Ze":_emscripten_glMapBufferRange,"Ye":_emscripten_glPauseTransformFeedback,"Xe":_emscripten_glPixelStorei,"We":_emscripten_glPolygonOffset,"Ve":_emscripten_glProgramBinary,"Ue":_emscripten_glProgramParameteri,"Te":_emscripten_glQueryCounterEXT,"Se":_emscripten_glReadBuffer,"Re":_emscripten_glReadPixels,"Qe":_emscripten_glReleaseShaderCompiler,"Pe":_emscripten_glRenderbufferStorage,"Oe":_emscripten_glRenderbufferStorageMultisample,"Ne":_emscripten_glResumeTransformFeedback,"Me":_emscripten_glSampleCoverage,"Le":_emscripten_glSamplerParameterf,"Ke":_emscripten_glSamplerParameterfv,"Je":_emscripten_glSamplerParameteri,"Ie":_emscripten_glSamplerParameteriv,"He":_emscripten_glScissor,"Ge":_emscripten_glShaderBinary,"Fe":_emscripten_glShaderSource,"Ee":_emscripten_glStencilFunc,"De":_emscripten_glStencilFuncSeparate,"Ce":_emscripten_glStencilMask,"Be":_emscripten_glStencilMaskSeparate,"Ae":_emscripten_glStencilOp,"ze":_emscripten_glStencilOpSeparate,"ye":_emscripten_glTexImage2D,"xe":_emscripten_glTexImage3D,"we":_emscripten_glTexParameterf,"ve":_emscripten_glTexParameterfv,"ue":_emscripten_glTexParameteri,"te":_emscripten_glTexParameteriv,"se":_emscripten_glTexStorage2D,"re":_emscripten_glTexStorage3D,"qe":_emscripten_glTexSubImage2D,"pe":_emscripten_glTexSubImage3D,"oe":_emscripten_glTransformFeedbackVaryings,"ne":_emscripten_glUniform1f,"me":_emscripten_glUniform1fv,"le":_emscripten_glUniform1i,"ke":_emscripten_glUniform1iv,"je":_emscripten_glUniform1ui,"ie":_emscripten_glUniform1uiv,"he":_emscripten_glUniform2f,"ge":_emscripten_glUniform2fv,"fe":_emscripten_glUniform2i,"ee":_emscripten_glUniform2iv,"de":_emscripten_glUniform2ui,"ce":_emscripten_glUniform2uiv,"be":_emscripten_glUniform3f,"ae":_emscripten_glUniform3fv,"$d":_emscripten_glUniform3i,"_d":_emscripten_glUniform3iv,"Zd":_emscripten_glUniform3ui,"Yd":_emscripten_glUniform3uiv,"Xd":_emscripten_glUniform4f,"Wd":_emscripten_glUniform4fv,"Vd":_emscripten_glUniform4i,"Ud":_emscripten_glUniform4iv,"Td":_emscripten_glUniform4ui,"Sd":_emscripten_glUniform4uiv,"Rd":_emscripten_glUniformBlockBinding,"Qd":_emscripten_glUniformMatrix2fv,"Pd":_emscripten_glUniformMatrix2x3fv,"Od":_emscripten_glUniformMatrix2x4fv,"Nd":_emscripten_glUniformMatrix3fv,"Md":_emscripten_glUniformMatrix3x2fv,"Ld":_emscripten_glUniformMatrix3x4fv,"Kd":_emscripten_glUniformMatrix4fv,"Jd":_emscripten_glUniformMatrix4x2fv,"Id":_emscripten_glUniformMatrix4x3fv,"Hd":_emscripten_glUnmapBuffer,"Gd":_emscripten_glUseProgram,"Fd":_emscripten_glValidateProgram,"Ed":_emscripten_glVertexAttrib1f,"Dd":_emscripten_glVertexAttrib1fv,"Cd":_emscripten_glVertexAttrib2f,"Bd":_emscripten_glVertexAttrib2fv,"Ad":_emscripten_glVertexAttrib3f,"zd":_emscripten_glVertexAttrib3fv,"yd":_emscripten_glVertexAttrib4f,"xd":_emscripten_glVertexAttrib4fv,"wd":_emscripten_glVertexAttribDivisor,"vd":_emscripten_glVertexAttribDivisorANGLE,"ud":_emscripten_glVertexAttribDivisorARB,"td":_emscripten_glVertexAttribDivisorEXT,"sd":_emscripten_glVertexAttribDivisorNV,"rd":_emscripten_glVertexAttribI4i,"qd":_emscripten_glVertexAttribI4iv,"pd":_emscripten_glVertexAttribI4ui,"od":_emscripten_glVertexAttribI4uiv,"nd":_emscripten_glVertexAttribIPointer,"md":_emscripten_glVertexAttribPointer,"ld":_emscripten_glViewport,"dc":_emscripten_glWaitSync,"kd":_emscripten_longjmp,"jd":_emscripten_memcpy_big,"id":_emscripten_request_fullscreen_strategy,"hd":_emscripten_request_pointerlock,"gd":_emscripten_resize_heap,"fd":_emscripten_sample_gamepad_data,"Ub":_emscripten_set_canvas_element_size,"ed":_emscripten_set_fullscreenchange_callback_on_thread,"dd":_emscripten_set_gamepadconnected_callback_on_thread,"cd":_emscripten_set_gamepaddisconnected_callback_on_thread,"bd":_emscripten_set_keydown_callback_on_thread,"ad":_emscripten_set_keypress_callback_on_thread,"$c":_emscripten_set_keyup_callback_on_thread,"_c":_emscripten_set_main_loop,"Zc":_emscripten_set_mousedown_callback_on_thread,"Yc":_emscripten_set_mousemove_callback_on_thread,"Xc":_emscripten_set_mouseup_callback_on_thread,"Wc":_emscripten_set_touchcancel_callback_on_thread,"Vc":_emscripten_set_touchend_callback_on_thread,"Uc":_emscripten_set_touchmove_callback_on_thread,"Tc":_emscripten_set_touchstart_callback_on_thread,"Sc":_emscripten_set_wheel_callback_on_thread,"Rc":_emscripten_webgl_create_context,"Qc":_emscripten_webgl_init_context_attributes,"Pc":_emscripten_webgl_make_context_current,"Oc":_exit,"ub":_gai_strerror,"tb":_getaddrinfo,"Wa":_getenv,"Nc":_getnameinfo,"Tb":_gettimeofday,"f":_glActiveTexture,"fb":_glAttachShader,"sb":_glBeginTransformFeedback,"Sb":_glBindAttribLocation,"e":_glBindBuffer,"$":_glBindBufferBase,"n":_glBindFramebuffer,"ma":_glBindRenderbuffer,"d":_glBindTexture,"r":_glBindVertexArray,"N":_glBlendEquation,"_":_glBlendFunc,"O":_glBlendFuncSeparate,"Da":_glBlitFramebuffer,"G":_glBufferData,"v":_glBufferSubData,"V":_glCheckFramebufferStatus,"T":_glClear,"Ma":_glClearBufferfv,"ca":_glClearColor,"sa":_glClearDepthf,"ba":_glColorMask,"eb":_glCompileShader,"Rb":_glCompressedTexImage2D,"Mc":_glCompressedTexImage3D,"Lc":_glCompressedTexSubImage2D,"rb":_glCompressedTexSubImage3D,"Kc":_glCopyBufferSubData,"qb":_glCopyTexSubImage2D,"Qb":_glCreateProgram,"db":_glCreateShader,"La":_glCullFace,"U":_glDeleteBuffers,"S":_glDeleteFramebuffers,"aa":_glDeleteProgram,"ya":_glDeleteRenderbuffers,"L":_glDeleteShader,"K":_glDeleteTextures,"ra":_glDeleteVertexArrays,"qa":_glDepthFunc,"R":_glDepthMask,"w":_glDisable,"u":_glDisableVertexAttribArray,"z":_glDrawArrays,"pa":_glDrawArraysInstanced,"Va":_glDrawBuffers,"Q":_glDrawElements,"Ca":_glDrawElementsInstanced,"E":_glEnable,"k":_glEnableVertexAttribArray,"pb":_glEndTransformFeedback,"Jc":_glFinish,"xa":_glFramebufferRenderbuffer,"J":_glFramebufferTexture2D,"Ic":_glFramebufferTextureLayer,"Pb":_glFrontFace,"H":_glGenBuffers,"M":_glGenFramebuffers,"wa":_glGenRenderbuffers,"F":_glGenTextures,"ha":_glGenVertexArrays,"ga":_glGenerateMipmap,"Hc":_glGetFloatv,"Ga":_glGetIntegerv,"Ob":_glGetProgramInfoLog,"cb":_glGetProgramiv,"bb":_glGetShaderInfoLog,"Ka":_glGetShaderiv,"ab":_glGetString,"Gc":_glGetStringi,"Fc":_glGetUniformBlockIndex,"Pa":_glGetUniformLocation,"Ec":_glInvalidateFramebuffer,"Nb":_glLinkProgram,"Ba":_glPixelStorei,"Fa":_glReadBuffer,"ob":_glReadPixels,"va":_glRenderbufferStorage,"Ua":_glRenderbufferStorageMultisample,"ua":_glScissor,"$a":_glShaderSource,"D":_glTexImage2D,"Ta":_glTexImage3D,"s":_glTexParameterf,"m":_glTexParameteri,"Dc":_glTexStorage2D,"Sa":_glTexSubImage2D,"_a":_glTexSubImage3D,"Cc":_glTransformFeedbackVaryings,"p":_glUniform1f,"q":_glUniform1i,"nb":_glUniform1iv,"Mb":_glUniform1ui,"mb":_glUniform2f,"t":_glUniform2fv,"Ja":_glUniform2i,"Ea":_glUniform2iv,"lb":_glUniform3f,"la":_glUniform3fv,"Ia":_glUniform3i,"Qa":_glUniform4f,"y":_glUniform4fv,"Ha":_glUniform4i,"Bc":_glUniformBlockBinding,"kb":_glUniformMatrix2fv,"jb":_glUniformMatrix3fv,"l":_glUniformMatrix4fv,"oa":_glUseProgram,"x":_glVertexAttrib4f,"X":_glVertexAttrib4fv,"A":_glVertexAttribDivisor,"Za":_glVertexAttribI4ui,"Oa":_glVertexAttribIPointer,"j":_glVertexAttribPointer,"C":_glViewport,"Lb":_gmtime,"Ac":_godot_xhr_free,"zc":_godot_xhr_get_ready_state,"yc":_godot_xhr_get_response,"xc":_godot_xhr_get_response_headers,"wc":_godot_xhr_get_response_headers_length,"vc":_godot_xhr_get_response_length,"uc":_godot_xhr_get_status,"tc":_godot_xhr_new,"Kb":_godot_xhr_open,"ib":_godot_xhr_reset,"sc":_godot_xhr_send_data,"rc":_godot_xhr_send_string,"qc":_godot_xhr_set_request_header,"pc":_inet_addr,"oc":_kill,"cc":_llvm_bswap_i64,"Aa":_llvm_exp2_f32,"ta":_llvm_exp2_f64,"nc":_llvm_log10_f64,"hb":_llvm_log2_f32,"Z":_llvm_stackrestore,"W":_llvm_stacksave,"b":_llvm_trap,"gb":_localtime,"h":_longjmp,"mc":_nanosleep,"Jb":_setenv,"Ib":_sigaction,"lc":_sigemptyset,"Hb":_strftime,"kc":_sysconf,"Ya":_time,"Gb":_waitpid,"jc":abortOnCannotGrowMemory,"a":DYNAMICTOP_PTR};var asm=Module["asm"](asmGlobalArg,asmLibraryArg,buffer);Module["asm"]=asm;var ___errno_location=Module["___errno_location"]=function(){return Module["asm"]["Vi"].apply(null,arguments)};var __esws_on_close=Module["__esws_on_close"]=function(){return Module["asm"]["Wi"].apply(null,arguments)};var __esws_on_connect=Module["__esws_on_connect"]=function(){return Module["asm"]["Xi"].apply(null,arguments)};var __esws_on_error=Module["__esws_on_error"]=function(){return Module["asm"]["Yi"].apply(null,arguments)};var __esws_on_message=Module["__esws_on_message"]=function(){return Module["asm"]["Zi"].apply(null,arguments)};var __get_daylight=Module["__get_daylight"]=function(){return Module["asm"]["_i"].apply(null,arguments)};var __get_environ=Module["__get_environ"]=function(){return Module["asm"]["$i"].apply(null,arguments)};var __get_timezone=Module["__get_timezone"]=function(){return Module["asm"]["aj"].apply(null,arguments)};var __get_tzname=Module["__get_tzname"]=function(){return Module["asm"]["bj"].apply(null,arguments)};var _audio_driver_js_mix=Module["_audio_driver_js_mix"]=function(){return Module["asm"]["cj"].apply(null,arguments)};var _audio_driver_process_capture=Module["_audio_driver_process_capture"]=function(){return Module["asm"]["dj"].apply(null,arguments)};var _emscripten_GetProcAddress=Module["_emscripten_GetProcAddress"]=function(){return Module["asm"]["ej"].apply(null,arguments)};var _free=Module["_free"]=function(){return Module["asm"]["fj"].apply(null,arguments)};var _htonl=Module["_htonl"]=function(){return Module["asm"]["gj"].apply(null,arguments)};var _htons=Module["_htons"]=function(){return Module["asm"]["hj"].apply(null,arguments)};var _llvm_bswap_i32=Module["_llvm_bswap_i32"]=function(){return Module["asm"]["ij"].apply(null,arguments)};var _main=Module["_main"]=function(){return Module["asm"]["jj"].apply(null,arguments)};var _main_after_fs_sync=Module["_main_after_fs_sync"]=function(){return Module["asm"]["kj"].apply(null,arguments)};var _malloc=Module["_malloc"]=function(){return Module["asm"]["lj"].apply(null,arguments)};var _ntohs=Module["_ntohs"]=function(){return Module["asm"]["mj"].apply(null,arguments)};var _resize_poolbytearray_and_open_write=Module["_resize_poolbytearray_and_open_write"]=function(){return Module["asm"]["nj"].apply(null,arguments)};var _send_notification=Module["_send_notification"]=function(){return Module["asm"]["oj"].apply(null,arguments)};var _setThrew=Module["_setThrew"]=function(){return Module["asm"]["pj"].apply(null,arguments)};var globalCtors=Module["globalCtors"]=function(){return Module["asm"]["Jj"].apply(null,arguments)};var stackAlloc=Module["stackAlloc"]=function(){return Module["asm"]["Kj"].apply(null,arguments)};var stackRestore=Module["stackRestore"]=function(){return Module["asm"]["Lj"].apply(null,arguments)};var stackSave=Module["stackSave"]=function(){return Module["asm"]["Mj"].apply(null,arguments)};var dynCall_i=Module["dynCall_i"]=function(){return Module["asm"]["qj"].apply(null,arguments)};var dynCall_ii=Module["dynCall_ii"]=function(){return Module["asm"]["rj"].apply(null,arguments)};var dynCall_iii=Module["dynCall_iii"]=function(){return Module["asm"]["sj"].apply(null,arguments)};var dynCall_iiii=Module["dynCall_iiii"]=function(){return Module["asm"]["tj"].apply(null,arguments)};var dynCall_iiiii=Module["dynCall_iiiii"]=function(){return Module["asm"]["uj"].apply(null,arguments)};var dynCall_iiiiii=Module["dynCall_iiiiii"]=function(){return Module["asm"]["vj"].apply(null,arguments)};var dynCall_iiiiiii=Module["dynCall_iiiiiii"]=function(){return Module["asm"]["wj"].apply(null,arguments)};var dynCall_iiiiiiii=Module["dynCall_iiiiiiii"]=function(){return Module["asm"]["xj"].apply(null,arguments)};var dynCall_iiiiiiiiii=Module["dynCall_iiiiiiiiii"]=function(){return Module["asm"]["yj"].apply(null,arguments)};var dynCall_iiiij=Module["dynCall_iiiij"]=function(){return Module["asm"]["zj"].apply(null,arguments)};var dynCall_v=Module["dynCall_v"]=function(){return Module["asm"]["Aj"].apply(null,arguments)};var dynCall_vi=Module["dynCall_vi"]=function(){return Module["asm"]["Bj"].apply(null,arguments)};var dynCall_vii=Module["dynCall_vii"]=function(){return Module["asm"]["Cj"].apply(null,arguments)};var dynCall_viii=Module["dynCall_viii"]=function(){return Module["asm"]["Dj"].apply(null,arguments)};var dynCall_viiii=Module["dynCall_viiii"]=function(){return Module["asm"]["Ej"].apply(null,arguments)};var dynCall_viiiii=Module["dynCall_viiiii"]=function(){return Module["asm"]["Fj"].apply(null,arguments)};var dynCall_viiiiii=Module["dynCall_viiiiii"]=function(){return Module["asm"]["Gj"].apply(null,arguments)};var dynCall_viiiiiii=Module["dynCall_viiiiiii"]=function(){return Module["asm"]["Hj"].apply(null,arguments)};var dynCall_viiiiiiiii=Module["dynCall_viiiiiiiii"]=function(){return Module["asm"]["Ij"].apply(null,arguments)};Module["asm"]=asm;function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}ExitStatus.prototype=new Error;ExitStatus.prototype.constructor=ExitStatus;var calledMain=false;dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};Module["callMain"]=function callMain(args){args=args||[];ensureInitRuntime();var argc=args.length+1;var argv=stackAlloc((argc+1)*4);HEAP32[argv>>2]=allocateUTF8OnStack(Module["thisProgram"]);for(var i=1;i<argc;i++){HEAP32[(argv>>2)+i]=allocateUTF8OnStack(args[i-1])}HEAP32[(argv>>2)+argc]=0;try{var ret=Module["_main"](argc,argv,0);exit(ret,true)}catch(e){if(e instanceof ExitStatus){return}else if(e=="SimulateInfiniteLoop"){Module["noExitRuntime"]=true;return}else{var toLog=e;if(e&&typeof e==="object"&&e.stack){toLog=[e,e.stack]}err("exception thrown: "+toLog);Module["quit"](1,e)}}finally{calledMain=true}};function run(args){args=args||Module["arguments"];if(runDependencies>0){return}preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;ensureInitRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();if(Module["_main"]&&shouldRunNow)Module["callMain"](args);postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout(function(){setTimeout(function(){Module["setStatus"]("")},1);doRun()},1)}else{doRun()}}Module["run"]=run;function exit(status,implicit){if(implicit&&Module["noExitRuntime"]&&status===0){return}if(Module["noExitRuntime"]){}else{ABORT=true;EXITSTATUS=status;exitRuntime();if(Module["onExit"])Module["onExit"](status)}Module["quit"](status,new ExitStatus(status))}function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}if(what!==undefined){out(what);err(what);what=JSON.stringify(what)}else{what=""}ABORT=true;EXITSTATUS=1;throw"abort("+what+"). Build with -s ASSERTIONS=1 for more info."}Module["abort"]=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}var shouldRunNow=false;if(Module["noInitialRun"]){shouldRunNow=false}Module["noExitRuntime"]=true;run(); + + // The following is concatenated with generated code, and acts as the end + // of a wrapper for said code. See pre.js for the other part of the + // wrapper. + exposedLibs['PATH'] = PATH; + exposedLibs['FS'] = FS; + return Module; + }, +}; + +(function() { + var engine = Engine; + + var DOWNLOAD_ATTEMPTS_MAX = 4; + + var basePath = null; + var wasmFilenameExtensionOverride = null; + var engineLoadPromise = null; + + var loadingFiles = {}; + + function getPathLeaf(path) { + + while (path.endsWith('/')) + path = path.slice(0, -1); + return path.slice(path.lastIndexOf('/') + 1); + } + + function getBasePath(path) { + + if (path.endsWith('/')) + path = path.slice(0, -1); + if (path.lastIndexOf('.') > path.lastIndexOf('/')) + path = path.slice(0, path.lastIndexOf('.')); + return path; + } + + function getBaseName(path) { + + return getPathLeaf(getBasePath(path)); + } + + Engine = function Engine() { + + this.rtenv = null; + + var LIBS = {}; + + var initPromise = null; + var unloadAfterInit = true; + + var preloadedFiles = []; + + var resizeCanvasOnStart = true; + var progressFunc = null; + var preloadProgressTracker = {}; + var lastProgress = { loaded: 0, total: 0 }; + + var canvas = null; + var executableName = null; + var locale = null; + var stdout = null; + var stderr = null; + + this.init = function(newBasePath) { + + if (!initPromise) { + initPromise = Engine.load(newBasePath).then( + instantiate.bind(this) + ); + requestAnimationFrame(animateProgress); + if (unloadAfterInit) + initPromise.then(Engine.unloadEngine); + } + return initPromise; + }; + + function instantiate(wasmBuf) { + + var rtenvProps = { + engine: this, + ENV: {}, + }; + if (typeof stdout === 'function') + rtenvProps.print = stdout; + if (typeof stderr === 'function') + rtenvProps.printErr = stderr; + rtenvProps.instantiateWasm = function(imports, onSuccess) { + WebAssembly.instantiate(wasmBuf, imports).then(function(result) { + onSuccess(result.instance); + }); + return {}; + }; + + return new Promise(function(resolve, reject) { + rtenvProps.onRuntimeInitialized = resolve; + rtenvProps.onAbort = reject; + rtenvProps.engine.rtenv = Engine.RuntimeEnvironment(rtenvProps, LIBS); + }); + } + + this.preloadFile = function(pathOrBuffer, destPath) { + + if (pathOrBuffer instanceof ArrayBuffer) { + pathOrBuffer = new Uint8Array(pathOrBuffer); + } else if (ArrayBuffer.isView(pathOrBuffer)) { + pathOrBuffer = new Uint8Array(pathOrBuffer.buffer); + } + if (pathOrBuffer instanceof Uint8Array) { + preloadedFiles.push({ + path: destPath, + buffer: pathOrBuffer + }); + return Promise.resolve(); + } else if (typeof pathOrBuffer === 'string') { + return loadPromise(pathOrBuffer, preloadProgressTracker).then(function(xhr) { + preloadedFiles.push({ + path: destPath || pathOrBuffer, + buffer: xhr.response + }); + }); + } else { + throw Promise.reject("Invalid object for preloading"); + } + }; + + this.start = function() { + + return this.init().then( + Function.prototype.apply.bind(synchronousStart, this, arguments) + ); + }; + + this.startGame = function(mainPack) { + + executableName = getBaseName(mainPack); + var mainArgs = []; + if (!getPathLeaf(mainPack).endsWith('.pck')) { + mainArgs = ['--main-pack', getPathLeaf(mainPack)]; + } + return Promise.all([ + // Load from directory, + this.init(getBasePath(mainPack)), + // ...but write to root where the engine expects it. + this.preloadFile(mainPack, getPathLeaf(mainPack)) + ]).then( + Function.prototype.apply.bind(synchronousStart, this, mainArgs) + ); + }; + + function synchronousStart() { + + if (canvas instanceof HTMLCanvasElement) { + this.rtenv.canvas = canvas; + } else { + var firstCanvas = document.getElementsByTagName('canvas')[0]; + if (firstCanvas instanceof HTMLCanvasElement) { + this.rtenv.canvas = firstCanvas; + } else { + throw new Error("No canvas found"); + } + } + + var actualCanvas = this.rtenv.canvas; + // canvas can grab focus on click + if (actualCanvas.tabIndex < 0) { + actualCanvas.tabIndex = 0; + } + // necessary to calculate cursor coordinates correctly + actualCanvas.style.padding = 0; + actualCanvas.style.borderWidth = 0; + actualCanvas.style.borderStyle = 'none'; + // disable right-click context menu + actualCanvas.addEventListener('contextmenu', function(ev) { + ev.preventDefault(); + }, false); + // until context restoration is implemented + actualCanvas.addEventListener('webglcontextlost', function(ev) { + alert("WebGL context lost, please reload the page"); + ev.preventDefault(); + }, false); + + if (locale) { + this.rtenv.locale = locale; + } else { + this.rtenv.locale = navigator.languages ? navigator.languages[0] : navigator.language; + } + this.rtenv.locale = this.rtenv.locale.split('.')[0]; + this.rtenv.resizeCanvasOnStart = resizeCanvasOnStart; + + this.rtenv.thisProgram = executableName || getBaseName(basePath); + + preloadedFiles.forEach(function(file) { + var dir = LIBS.PATH.dirname(file.path); + try { + LIBS.FS.stat(dir); + } catch (e) { + if (e.code !== 'ENOENT') { + throw e; + } + LIBS.FS.mkdirTree(dir); + } + // With memory growth, canOwn should be false. + LIBS.FS.createDataFile(file.path, null, new Uint8Array(file.buffer), true, true, false); + }, this); + + preloadedFiles = null; + initPromise = null; + this.rtenv.callMain(arguments); + } + + this.setProgressFunc = function(func) { + progressFunc = func; + }; + + this.setResizeCanvasOnStart = function(enabled) { + resizeCanvasOnStart = enabled; + }; + + function animateProgress() { + + var loaded = 0; + var total = 0; + var totalIsValid = true; + var progressIsFinal = true; + + [loadingFiles, preloadProgressTracker].forEach(function(tracker) { + Object.keys(tracker).forEach(function(file) { + if (!tracker[file].final) + progressIsFinal = false; + if (!totalIsValid || tracker[file].total === 0) { + totalIsValid = false; + total = 0; + } else { + total += tracker[file].total; + } + loaded += tracker[file].loaded; + }); + }); + if (loaded !== lastProgress.loaded || total !== lastProgress.total) { + lastProgress.loaded = loaded; + lastProgress.total = total; + if (typeof progressFunc === 'function') + progressFunc(loaded, total); + } + if (!progressIsFinal) + requestAnimationFrame(animateProgress); + } + + this.setCanvas = function(elem) { + canvas = elem; + }; + + this.setExecutableName = function(newName) { + + executableName = newName; + }; + + this.setLocale = function(newLocale) { + + locale = newLocale; + }; + + this.setUnloadAfterInit = function(enabled) { + + if (enabled && !unloadAfterInit && initPromise) { + initPromise.then(Engine.unloadEngine); + } + unloadAfterInit = enabled; + }; + + this.setStdoutFunc = function(func) { + + var print = function(text) { + if (arguments.length > 1) { + text = Array.prototype.slice.call(arguments).join(" "); + } + func(text); + }; + if (this.rtenv) + this.rtenv.print = print; + stdout = print; + }; + + this.setStderrFunc = function(func) { + + var printErr = function(text) { + if (arguments.length > 1) + text = Array.prototype.slice.call(arguments).join(" "); + func(text); + }; + if (this.rtenv) + this.rtenv.printErr = printErr; + stderr = printErr; + }; + + + }; // Engine() + + Engine.RuntimeEnvironment = engine.RuntimeEnvironment; + + Engine.isWebGLAvailable = function(majorVersion = 1) { + + var testContext = false; + try { + var testCanvas = document.createElement('canvas'); + if (majorVersion === 1) { + testContext = testCanvas.getContext('webgl') || testCanvas.getContext('experimental-webgl'); + } else if (majorVersion === 2) { + testContext = testCanvas.getContext('webgl2') || testCanvas.getContext('experimental-webgl2'); + } + } catch (e) {} + return !!testContext; + }; + + Engine.setWebAssemblyFilenameExtension = function(override) { + + if (String(override).length === 0) { + throw new Error('Invalid WebAssembly filename extension override'); + } + wasmFilenameExtensionOverride = String(override); + } + + Engine.load = function(newBasePath) { + + if (newBasePath !== undefined) basePath = getBasePath(newBasePath); + if (engineLoadPromise === null) { + if (typeof WebAssembly !== 'object') + return Promise.reject(new Error("Browser doesn't support WebAssembly")); + // TODO cache/retrieve module to/from idb + engineLoadPromise = loadPromise(basePath + '.' + (wasmFilenameExtensionOverride || 'wasm')).then(function(xhr) { + return xhr.response; + }); + engineLoadPromise = engineLoadPromise.catch(function(err) { + engineLoadPromise = null; + throw err; + }); + } + return engineLoadPromise; + }; + + Engine.unload = function() { + engineLoadPromise = null; + }; + + function loadPromise(file, tracker) { + if (tracker === undefined) + tracker = loadingFiles; + return new Promise(function(resolve, reject) { + loadXHR(resolve, reject, file, tracker); + }); + } + + function loadXHR(resolve, reject, file, tracker) { + + var xhr = new XMLHttpRequest; + xhr.open('GET', file); + if (!file.endsWith('.js')) { + xhr.responseType = 'arraybuffer'; + } + ['loadstart', 'progress', 'load', 'error', 'abort'].forEach(function(ev) { + xhr.addEventListener(ev, onXHREvent.bind(xhr, resolve, reject, file, tracker)); + }); + xhr.send(); + } + + function onXHREvent(resolve, reject, file, tracker, ev) { + + if (this.status >= 400) { + + if (this.status < 500 || ++tracker[file].attempts >= DOWNLOAD_ATTEMPTS_MAX) { + reject(new Error("Failed loading file '" + file + "': " + this.statusText)); + this.abort(); + return; + } else { + setTimeout(loadXHR.bind(null, resolve, reject, file, tracker), 1000); + } + } + + switch (ev.type) { + case 'loadstart': + if (tracker[file] === undefined) { + tracker[file] = { + total: ev.total, + loaded: ev.loaded, + attempts: 0, + final: false, + }; + } + break; + + case 'progress': + tracker[file].loaded = ev.loaded; + tracker[file].total = ev.total; + break; + + case 'load': + tracker[file].final = true; + resolve(this); + break; + + case 'error': + if (++tracker[file].attempts >= DOWNLOAD_ATTEMPTS_MAX) { + tracker[file].final = true; + reject(new Error("Failed loading file '" + file + "'")); + } else { + setTimeout(loadXHR.bind(null, resolve, reject, file, tracker), 1000); + } + break; + + case 'abort': + tracker[file].final = true; + reject(new Error("Loading file '" + file + "' was aborted.")); + break; + } + } +})(); diff --git a/Builds/HTML/P-NG.pck b/Builds/HTML/P-NG.pck Binary files differ. diff --git a/Builds/HTML/P-NG.png b/Builds/HTML/P-NG.png Binary files differ. diff --git a/Builds/HTML/P-NG.png.import b/Builds/HTML/P-NG.png.import @@ -0,0 +1,34 @@ +[remap] + +importer="texture" +type="StreamTexture" +path="res://.import/P-NG.png-8cd8d96499d3c1462e90a97ad4b6038d.stex" +metadata={ +"vram_texture": false +} + +[deps] + +source_file="res://Builds/HTML/P-NG.png" +dest_files=[ "res://.import/P-NG.png-8cd8d96499d3c1462e90a97ad4b6038d.stex" ] + +[params] + +compress/mode=0 +compress/lossy_quality=0.7 +compress/hdr_mode=0 +compress/bptc_ldr=0 +compress/normal_map=0 +flags/repeat=0 +flags/filter=true +flags/mipmaps=false +flags/anisotropic=false +flags/srgb=2 +process/fix_alpha_border=true +process/premult_alpha=false +process/HDR_as_SRGB=false +process/invert_color=false +stream=false +size_limit=0 +detect_3d=true +svg/scale=1.0 diff --git a/Builds/HTML/P-NG.wasm b/Builds/HTML/P-NG.wasm Binary files differ. diff --git a/Builds/HTML/index.html b/Builds/HTML/index.html @@ -0,0 +1,261 @@ +<!DOCTYPE html> +<html xmlns='http://www.w3.org/1999/xhtml' lang='' xml:lang=''> +<head> + <meta charset='utf-8' /> + <meta name='viewport' content='width=device-width, user-scalable=no' /> + <title></title> + <style type='text/css'> + + body { + touch-action: none; + margin: 0; + border: 0 none; + padding: 0; + text-align: center; + background-color: black; + } + + #canvas { + display: block; + margin: 0; + color: white; + } + + #canvas:focus { + outline: none; + } + + .godot { + font-family: 'Noto Sans', 'Droid Sans', Arial, sans-serif; + color: #e0e0e0; + background-color: #3b3943; + background-image: linear-gradient(to bottom, #403e48, #35333c); + border: 1px solid #45434e; + box-shadow: 0 0 1px 1px #2f2d35; + } + + + /* Status display + * ============== */ + + #status { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; + display: flex; + justify-content: center; + align-items: center; + /* don't consume click events - make children visible explicitly */ + visibility: hidden; + } + + #status-progress { + width: 366px; + height: 7px; + background-color: #38363A; + border: 1px solid #444246; + padding: 1px; + box-shadow: 0 0 2px 1px #1B1C22; + border-radius: 2px; + visibility: visible; + } + + @media only screen and (orientation:portrait) { + #status-progress { + width: 61.8%; + } + } + + #status-progress-inner { + height: 100%; + width: 0; + box-sizing: border-box; + transition: width 0.5s linear; + background-color: #202020; + border: 1px solid #222223; + box-shadow: 0 0 1px 1px #27282E; + border-radius: 3px; + } + + #status-indeterminate { + visibility: visible; + position: relative; + } + + #status-indeterminate > div { + width: 4.5px; + height: 0; + border-style: solid; + border-width: 9px 3px 0 3px; + border-color: #2b2b2b transparent transparent transparent; + transform-origin: center 21px; + position: absolute; + } + + #status-indeterminate > div:nth-child(1) { transform: rotate( 22.5deg); } + #status-indeterminate > div:nth-child(2) { transform: rotate( 67.5deg); } + #status-indeterminate > div:nth-child(3) { transform: rotate(112.5deg); } + #status-indeterminate > div:nth-child(4) { transform: rotate(157.5deg); } + #status-indeterminate > div:nth-child(5) { transform: rotate(202.5deg); } + #status-indeterminate > div:nth-child(6) { transform: rotate(247.5deg); } + #status-indeterminate > div:nth-child(7) { transform: rotate(292.5deg); } + #status-indeterminate > div:nth-child(8) { transform: rotate(337.5deg); } + + #status-notice { + margin: 0 100px; + line-height: 1.3; + visibility: visible; + padding: 4px 6px; + visibility: visible; + } + </style> + +</head> +<body> + <canvas id='canvas'> + HTML5 canvas appears to be unsupported in the current browser.<br /> + Please try updating or use a different browser. + </canvas> + <div id='status'> + <div id='status-progress' style='display: none;' oncontextmenu='event.preventDefault();'><div id ='status-progress-inner'></div></div> + <div id='status-indeterminate' style='display: none;' oncontextmenu='event.preventDefault();'> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + </div> + <div id='status-notice' class='godot' style='display: none;'></div> + </div> + + <script type='text/javascript' src='P-NG.js'></script> + <script type='text/javascript'>//<![CDATA[ + + var engine = new Engine; + var setStatusMode; + var setStatusNotice; + + (function() { + + const MAIN_PACK = 'P-NG.pck'; + const INDETERMINATE_STATUS_STEP_MS = 100; + + var canvas = document.getElementById('canvas'); + var statusProgress = document.getElementById('status-progress'); + var statusProgressInner = document.getElementById('status-progress-inner'); + var statusIndeterminate = document.getElementById('status-indeterminate'); + var statusNotice = document.getElementById('status-notice'); + + var initializing = true; + var statusMode = 'hidden'; + + var animationCallbacks = []; + function animate(time) { + animationCallbacks.forEach(callback => callback(time)); + requestAnimationFrame(animate); + } + requestAnimationFrame(animate); + + function adjustCanvasDimensions() { + canvas.width = innerWidth; + canvas.height = innerHeight; + } + animationCallbacks.push(adjustCanvasDimensions); + adjustCanvasDimensions(); + + setStatusMode = function setStatusMode(mode) { + + if (statusMode === mode || !initializing) + return; + [statusProgress, statusIndeterminate, statusNotice].forEach(elem => { + elem.style.display = 'none'; + }); + if (animateStatusIndeterminate in animationCallbacks) { + animationCallbacks.erase(animateStatusIndeterminate); + } + switch (mode) { + case 'progress': + statusProgress.style.display = 'block'; + break; + case 'indeterminate': + statusIndeterminate.style.display = 'block'; + animationCallbacks.push(animateStatusIndeterminate); + break; + case 'notice': + statusNotice.style.display = 'block'; + break; + case 'hidden': + break; + default: + throw new Error('Invalid status mode'); + } + statusMode = mode; + } + + function animateStatusIndeterminate(ms) { + + var i = Math.floor(ms / INDETERMINATE_STATUS_STEP_MS % 8); + if (statusIndeterminate.children[i].style.borderTopColor == '') { + Array.prototype.slice.call(statusIndeterminate.children).forEach(child => { + child.style.borderTopColor = ''; + }); + statusIndeterminate.children[i].style.borderTopColor = '#dfdfdf'; + } + } + + setStatusNotice = function setStatusNotice(text) { + + while (statusNotice.lastChild) { + statusNotice.removeChild(statusNotice.lastChild); + } + var lines = text.split('\n'); + lines.forEach((line) => { + statusNotice.appendChild(document.createTextNode(line)); + statusNotice.appendChild(document.createElement('br')); + }); + }; + + engine.setProgressFunc((current, total) => { + + if (total > 0) { + statusProgressInner.style.width = current/total * 100 + '%'; + setStatusMode('progress'); + if (current === total) { + // wait for progress bar animation + setTimeout(() => { + setStatusMode('indeterminate'); + }, 500); + } + } else { + setStatusMode('indeterminate'); + } + }); + + function displayFailureNotice(err) { + var msg = err.message || err; + console.error(msg); + setStatusNotice(msg); + setStatusMode('notice'); + initializing = false; + }; + + if (!Engine.isWebGLAvailable()) { + displayFailureNotice('WebGL not available'); + } else { + setStatusMode('indeterminate'); + engine.setCanvas(canvas); + engine.startGame(MAIN_PACK).then(() => { + setStatusMode('hidden'); + initializing = false; + }, displayFailureNotice); + } + })(); + //]]></script> +</body> +</html> + diff --git a/Builds/HTML/p-ng.zip b/Builds/HTML/p-ng.zip Binary files differ. diff --git a/Builds/Windows/P-NG.exe b/Builds/Windows/P-NG.exe Binary files differ. diff --git a/Builds/Windows/P-NG.pck b/Builds/Windows/P-NG.pck Binary files differ. diff --git a/Game.gd b/Game.gd @@ -37,10 +37,12 @@ func _on_Goal_1_body_entered(area): if area == $Ball: $GoalSFX.play() $Ball.free() - p2_score += 1 + p1_score += 1 _print_score() - if p2_score >= game_score: - print("P2 Wins!") + if p1_score >= game_score: + print("P1 Wins!") + $LabelPanel/Label.text = "P1 WINS!" + _game_over() else: _reset() @@ -49,9 +51,22 @@ func _on_Goal_2_body_entered(area): if area == $Ball: $GoalSFX.play() $Ball.free() - p1_score += 1 + p2_score += 1 _print_score() - if p1_score >= game_score: - print("P1 Wins!") + if p2_score >= game_score: + print("P2 Wins!") + $LabelPanel/Label.text = "P2 WINS!" + _game_over() else: - _reset()- \ No newline at end of file + _reset() + +func _game_over(): + $LabelPanel.visible = true + $Timer.disconnect("timeout", self, "_start_game") + $Timer.connect("timeout", self, "_game_over_load") + $Timer.one_shot = true + $Timer.start(3) + + +func _game_over_load(): + get_tree().change_scene("res://MainMenu.tscn")+ \ No newline at end of file